Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4
Balanced equation:
Ionic equation:
Net ionic equation:
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
Pick the redox reaction! I) H2SO4 + 2NH3 → (NH4)2SO4 II) H2SO4 + Na2CO3 → Na2SO4 + H2O + CO2 III) 2H2SO4 + Cu → CuSO4 + 2H2O + SO2 IV) 2K2CrO4 + H2SO4 → K2Cr2O7 + K2SO4 + H2O
For H2SO4(aq) + 2NH4OH(aq) --> (NH4)2SO4(aq)+2H2O what is the: Total Ionic equation: Specator Ions: Net Ionic equation:
What is the Net ionic equation for 1) KCl + Na2CO3 2)NaCl + Na2SO4 3)KBr + HCl 4) KCl + Na2CO3
Write the net ionic equation for this precipitation reaction. Include physical states. (NH4)2CO3(aq)+Ca(ClO4)2(aq)⟶CaCO3(s)+2NH4ClO4(aq) net ionic equation:
2. Write the net ionic equation for the following. Which ions are spectator ions? (NH4)2CO3(aq) + Cu(NO3)2(aq) → CuC03(s) + 2 NH4NOg(aq)
Write Balanced Ionic Equations and Balanced Net Ionic Equations for the following combinations (including states ex.(s) or (aq)): BaCl2 and AgNO3, KBr and AgNO3, K2CrO4 and AgNO3, NaOH and AgNO3, Na2CO3 and BaCl2, (NH4)2SO4 and BaCl2, Pb(NO3)2 and Na2CO3, Zn(NO3)2 and Na2CO3, FeCl3 and Na2CO3, Cu(NO3)2 and Na2CO3, K2CrO4 and Pb(NO3)2, NaOH and Pb(NO3)2, NaOH and FeCl3, NaCH3COO and FeCl3, MgCl2 and NaOH, Cu(NO3)2 and NaOH.
Write the molecular, total ionic, and net ionic formulas for each: 1. (NH4)2CO3 (aq) + CaCl2 (aq) 2.(NH4)2CO3 (aq) + CuBr2 (aq) 3. (NH4)2CO3 (aq) + Ag2SO4 4. (NH4)2CO3 (aq) + SrNO3 5. Ba(C2H3O2) (aq) + K2CrO4 6. Ba(C2H3O2) (aq) + AgSO4 7. Ba(C2H3O2) (aq) + NaOH 8. AgSO4 + CaCl2 9. CaCl2 + NaOH 10. CuBr2 + K2CrO7 11. CuBr2 + Ag2SO4 12. CuBr2 + NaOH 13. K2CrO7 + Ag2SO4 14. Ag2SO4 + NaOH 15. NaOH + SrNO3 Pls...
Help me solve and understand this
3 Balanced Reaction - CaCl2(aq) + Complete Ionic Equation: Net Ionic Reaction Balanced: Na2CO3 (aa) 4 Balanced Reaction - H₂SO4 (aq) + NaOH (aa) → Complete Ionic Equation: Net Ionic Reaction Balanced (5) Balanced Reaction _HCl(aq) + NaOH (as) Complete Ionic Equation: Net ionic Reaction Balanced: (6) Balanced Reaction -NH₂ NO3(aq) + Na2SO4 (99) Complete Ionic Equation: Net Ionic Reaction Balanced: 6 Balanced Reaction AgNO3(aq)+ NaBr (aq) → Complete Ionic Equation: Net Ionic Equation...
Given the following balanced chemical reaction answer questions a-c below. Cr2(SO4)3 (aq) + 3 (NH4)2CO3 (aq) -> Cr2CO3 (s) + 3 (NH4)2 SO4 (aq) Write the overall ionic balanced chemical equation. Write the net ionic balanced chemical equation. List the spectator ion(s). Given the following balanced chemical reaction answer questions a-c below. Ca(OH)2 (aq) + 2 HClO4 (aq) -> 2 H2O (l) + Ca(ClO4)2 (aq) Write the overall ionic balanced chemical equation. Write the net ionic balanced chemical equation. List...
Write molecular, ionic, and net ionic equations for the following Na3PO4 + FeSO4 (NH4)2CO3 + Cr(NO3)3 . Na2S + Zn(NO3)2 NaCl + KNO3