Which of the following is NOT a dye used to help identify shoeprints made with blood?...
Which of the following is NOT a dye used to help identify shoeprints made with blood?
A. Amido Black dye
B. Acid Fuchsin
C. Leuco Crystal Violet
D. Green Acid 7
Homework Answers
Option D is correct as except Green acid 7 , all mentioned dyes are widely used for the fingerprinting or shoeprinting in the blood specially for the identification of the crime scenes.
Yellow acid 7 is used for shoe printing.
Add Answer to:
Which of the following is NOT a dye used to help identify
shoeprints made with blood?...
2. Below the color scale you dow n , which is e the dye measured at...
2. Below the color scale you dow n , which is e the dye measured at different so m Apply ad the whole different between th dyes COVERI A NAD NADH Laboratory Report 10 OM DORD 1. Draw the boundaries for the various ta below: bus ranges of colors of visible light on the wa le light on the wavelelige 750 nm 400 nm 700 nm 500 nm 600 nm 2. Below is an absorbance spectrum for a violet/purple the...
Which of the following pairs is mismatched?
- Which of the following pairs is mismatched? d. iodine mordant e. none of the above a. alcohol-decolorizer b. crystal violet-basic dye c. safranin-acid dye 2, Suppose you Gram stained a sample from one colony and observed a field of red and blue cocci. Adjacent cells were not always the same color. You could conclude that you have d. old cells e. made a mistake a. a mixed culture b. young cells c. dividing cells 3. Which of the following...
Write the mechanism for the formation of Malachite Green from methyl benzoate. Be sure to show...
Write the mechanism for the formation of Malachite Green from methyl benzoate. Be sure to show all steps, including the loss of water. 1. 2. Write the mechanism for the formation of Crystal violet from diethyl carbonate. 3. Methyl benzoate is an ester, but is technically a carboxylate ester. Diethyl carbonate is a 4. Why is the green dye in this experiment called "Malachite Green"? Hint: Try looking in a 5. Write the balanced equation for the reaction of hydrochloric...
Pre-lab: Concentration of Riboflavin 1. The following absorbance spectrum is recorded for a dye. Which is...
Pre-lab: Concentration of Riboflavin 1. The following absorbance spectrum is recorded for a dye. Which is the most likely color of this dye? a. Blue-green b. Colorless c. Red d. Black M stock solution is diluted to 10.00 ml, what is the final 2. If 4.00 mL of a 5.00 x 10 concentration? 3. The absorbance of known concentrations of red food dye were measured in order to generate the following calibration curve. 2. Annotate the graph with the labels...
15. Which mixture would be the best butter? a. 1 M HF; 0.01 MF d. 0.1...
15. Which mixture would be the best butter? a. 1 M HF; 0.01 MF d. 0.1 M HC2H3O2; 0.01 M C2H302 b. 2 M HCI; 0.5 M CI e. 0.003 M HCIO; 0.003 M CIO C. 0.8 M H2C2O4; 0.8 M NaHC204 Thymol Blue 16. Which indicator would be the best for a titration of an hypoiodous acid (HIO), Ka = 2x 10-11 TABLE 16.1 Ranges of Color Changes for Several Acid-Base Indicators a. Crystal violet pH 2 0 3...
1) MacConkey agar is elective because a) It can identify mixed acid producing E.coli b) Contains...
1) MacConkey agar is elective because a) It can identify mixed acid producing E.coli b) Contains bile salts and crystal violet c) It contains lactose d) It contains glucose
69. THE ENDOSPORE itself is might to stain_?_ color in an ACID FAST stain. (a) HOT...
69. THE ENDOSPORE itself is might to stain_?_ color in an ACID FAST stain. (a) HOT pink (c) purple (d) green (e) baby-blue 70. All STAINS begin with a properly prepared _?_ . (a) dye (b) slide (c) smear (d) dog (e) cat 71. Which of the following is an ENDOTOXIN found in some microbes? This is results in fever, blood vessel dilation and possibly SHOCK when it is released into the human blood stream? (a) the plasma membrane (b)...
1. Identify and explain which solvents can be used from the list below to perform the...
1. Identify and explain which solvents can be used from the list below to perform the extraction described in this experiment. Ethanol Acetone Diethyl ether Methylene chloride Benzene Toluene Methanol Carbon tetrachloride Acetic acid 2-propanol 2. An aqueous solution of a dye with molar extinction coefficient of 60,000, has an absorbance of 0.8 when a 1 cm cuvette is used. Calculate the concentration of the dye using Beer’s Law. (MW of the dye = 374) 3. A 20 mL portion...
True (a) or false (b) 14. An acidic dye will bind more readily to the nucleic...
True (a) or false (b) 14. An acidic dye will bind more readily to the nucleic acids of a bacterial cell than a basic dye. d) 15. Bacterial cells divide by a process known as: a) meiosis b) mutation c)binary fission Osmosis 16-18. Match the following components of a stain with their correct descriptions A Benzene B. Ionachrome C. Auxochrome D. Chromophore 16. 17. 18. Conveys ionization to the colored component of the stain Colorless solvent of dye Colored component...
6. Identify safety techniques that can be used in responding to accidental exposure to: a. blood,...
6. Identify safety techniques that can be used in responding to accidental exposure to: a. blood, b. other body fluids, c. needle sticks, d. chemicals. (XII,C.2) A. blood: B. other body fluids C. needle sticks: D. chemicals: 7. Discuss fire safety issues in an ambulatory healthcare environment. (XII.C.3) Describe fundamental principles for evacuation of a healthcare setting. (XII.C.4) 8. Describe the purpose of Safety Data Sheets (SDS) in a healthcare setting. (XII.C.5) 9. 10. Discuss protocols for disposal of biological...
2. Below the color scale you dow n , which is e the dye measured at different so m Apply ad the whole different between th dyes COVERI A NAD NADH Laboratory Report 10 OM DORD 1. Draw the boundaries for the various ta below: bus ranges of colors of visible light on the wa le light on the wavelelige 750 nm 400 nm 700 nm 500 nm 600 nm 2. Below is an absorbance spectrum for a violet/purple the...
- Which of the following pairs is mismatched? d. iodine mordant e. none of the above a. alcohol-decolorizer b. crystal violet-basic dye c. safranin-acid dye 2, Suppose you Gram stained a sample from one colony and observed a field of red and blue cocci. Adjacent cells were not always the same color. You could conclude that you have d. old cells e. made a mistake a. a mixed culture b. young cells c. dividing cells 3. Which of the following...
Write the mechanism for the formation of Malachite Green from methyl benzoate. Be sure to show all steps, including the loss of water. 1. 2. Write the mechanism for the formation of Crystal violet from diethyl carbonate. 3. Methyl benzoate is an ester, but is technically a carboxylate ester. Diethyl carbonate is a 4. Why is the green dye in this experiment called "Malachite Green"? Hint: Try looking in a 5. Write the balanced equation for the reaction of hydrochloric...
Pre-lab: Concentration of Riboflavin 1. The following absorbance spectrum is recorded for a dye. Which is the most likely color of this dye? a. Blue-green b. Colorless c. Red d. Black M stock solution is diluted to 10.00 ml, what is the final 2. If 4.00 mL of a 5.00 x 10 concentration? 3. The absorbance of known concentrations of red food dye were measured in order to generate the following calibration curve. 2. Annotate the graph with the labels...
15. Which mixture would be the best butter? a. 1 M HF; 0.01 MF d. 0.1 M HC2H3O2; 0.01 M C2H302 b. 2 M HCI; 0.5 M CI e. 0.003 M HCIO; 0.003 M CIO C. 0.8 M H2C2O4; 0.8 M NaHC204 Thymol Blue 16. Which indicator would be the best for a titration of an hypoiodous acid (HIO), Ka = 2x 10-11 TABLE 16.1 Ranges of Color Changes for Several Acid-Base Indicators a. Crystal violet pH 2 0 3...
True (a) or false (b) 14. An acidic dye will bind more readily to the nucleic acids of a bacterial cell than a basic dye. d) 15. Bacterial cells divide by a process known as: a) meiosis b) mutation c)binary fission Osmosis 16-18. Match the following components of a stain with their correct descriptions A Benzene B. Ionachrome C. Auxochrome D. Chromophore 16. 17. 18. Conveys ionization to the colored component of the stain Colorless solvent of dye Colored component...
6. Identify safety techniques that can be used in responding to accidental exposure to: a. blood, b. other body fluids, c. needle sticks, d. chemicals. (XII,C.2) A. blood: B. other body fluids C. needle sticks: D. chemicals: 7. Discuss fire safety issues in an ambulatory healthcare environment. (XII.C.3) Describe fundamental principles for evacuation of a healthcare setting. (XII.C.4) 8. Describe the purpose of Safety Data Sheets (SDS) in a healthcare setting. (XII.C.5) 9. 10. Discuss protocols for disposal of biological...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago