The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2...
The respiration of 1 mole of glucose is represented by the following equation
C6H12O6 + 6O2 --> 6CO2 + 6H2O + 686 Kcal
Where is the energy that is released or absorbed (depends on the reaction) found?
Homework Answers
In given reaction, we can see that 686 Kcal is written on right side of the reaction, this means overall 686 Kcal energy is released in the reaction because it is written on the product side.
If the energy is written on left side of the reaction i.e. the reactant side, this means that overall energy is absorbed in the reaction.
Add Answer to:
The respiration of 1 mole of glucose is represented by
the following equation
C6H12O6 + 6O2...
Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for...
Question 1
Glucose metabolism can be represented by the following chemical
reaction:
C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l)
H for the
reaction is -2837 kJ/mole.
Is this reaction endothermic or exothermic?
Write an expression for the equilibrium constant for this
reaction.
Given that the value of the equilibrium constant is very large,
would you expect this reaction to be fast or slow?
Explain the effect on equilibrium of
Increasing temperature
Increasing pressure by decreasing the volume
Decreasing concentration of oxygen
Increasing the concentration of...
Glucose, C6H12O6,C6H12O6, is used as an energy source by the human body. The overall reaction in...
Glucose, C6H12O6,C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equation C6H12O6(aq)+6O2(g)⟶6CO2(g)+6H2O(l)C6H12O6(aq)+6O2(g)⟶6CO2(g)+6H2O(l) Calculate the number of grams of oxygen required to convert 13.0 g13.0 g of glucose to CO2CO2 and H2O.H2O.
Glucose (C6H12O6) is an important energy-rich compound, produced by photosynthesis according to the equation below. What...
Glucose (C6H12O6) is an important energy-rich compound, produced by photosynthesis according to the equation below. What mass of glucose can be produced from 2.50 g of CO2 and the necessary water? 6CO2(g) + 6H2O(l) → C6H12O6(l) + 6O2(g)
Glucose, C6H12O6, is used as an energy source by the human body.
Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g
The glucose (C6H12O6) from the food we eat is broken down to provide energy (ATP) for...
The glucose (C6H12O6) from the food we eat is broken down to provide energy (ATP) for growth and function. A general overall equation for this very complex process is given below. How many moles of CO2 waste are produced if you started out with 2.3 moles of glucose? C6H12O6 + 6O2⟶ 6CO2 + 6H2O
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86...
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86 mol of C6H12O6, how many moles of CO2 are needed?
Calculate the amount of energy released as heat at constant pressure when 1.00 g of glucose...
Calculate the amount of energy released as heat at constant pressure when 1.00 g of glucose undergoes a combustion reaction according to the equation below: C6H12O6(s) + 6O2(g) ® 6CO2(g) + 6H2O(g) ∆rHϴ = –2806 kJ (A) 16.00 kJ (B) 156.0 kJ (C) 468.0 kJ (D) 2806 kJ (E) 505600 kJ
1) the photosynthetic conversion of co2 to o2 can be represented by 6co2 + 6h2o <>c6h12o6+6o2...
1) the photosynthetic conversion of co2 to o2 can be represented by 6co2 + 6h2o <>c6h12o6+6o2 what is the equilibrium expression for this reaction? 2) what is the state of the system if I2=1.0 M and I=1.0×10^-3 M I2 <>2I. kc=3.8×10^-5 a. the system is at equilibrium b. the system is at a steady state c. the system is not at equilibrium and will produce more reactants d. the system is not at equilibrium and will produce more products 3)...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy...
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy of formation data, determine which of the following reactions is more energetically favorable. .
Question 1
Glucose metabolism can be represented by the following chemical
reaction:
C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l)
H for the
reaction is -2837 kJ/mole.
Is this reaction endothermic or exothermic?
Write an expression for the equilibrium constant for this
reaction.
Given that the value of the equilibrium constant is very large,
would you expect this reaction to be fast or slow?
Explain the effect on equilibrium of
Increasing temperature
Increasing pressure by decreasing the volume
Decreasing concentration of oxygen
Increasing the concentration of...
Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
Most questions answered within 3 hours.
-
Write a program to solve the Josephus problem, with the following
modification:
Sample Input:
./a.out n...
asked 1 hour ago -
At the start of a CD it is spinning at a rate of 525 rpm
(revolutions...
asked 2 hours ago -
4. Without doing any calculations, predict whether the observed
∆T would increase, decrease or remain the...
asked 3 hours ago -
Based on the range, which of the following sets of scores has
the greatest variability? 3,...
asked 4 hours ago -
Ripples in a pond travel at a velocity of 3 m/s with one peak
passing a...
asked 4 hours ago -
A man stands on the roof of a building of height 13.0 mm and
throws a...
asked 4 hours ago -
The extent to which assets are financed by borrowed funds and
other liabilities is indicated by:...
asked 5 hours ago -
Explain in detail
Germany is the fifth largest economy
explain what goods and services Germany specializes...
asked 5 hours ago -
The density of platinum is 21.45 g/mL. If a cube of platinum
with a mass of...
asked 5 hours ago -
Accounts Receivable
Sales
A/R Posting
Extended Sales Invoice
Packing Slip
Compare invoice to packing slip 2...
asked 5 hours ago -
Michaella, age 23, is a full-time law student and is claimed by
her parents as a...
asked 5 hours ago -
Why are polymers not typically casted into products?
asked 6 hours ago