1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH...
.corre YouTube Popular Imported From Sa... 3. The combustion of the sugar glucose, C6H12O6, is described by the following equation: C6H1206(s) + 602(g) - 6CO2(g) + 6H20(1) AH = -2816 kJ How much heat in kilojoules can be produced by the metabolism of 1.0 g of glucose in the human body? 5 2
Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for the reaction is -2837 kJ/mole. Is this reaction endothermic or exothermic? Write an expression for the equilibrium constant for this reaction. Given that the value of the equilibrium constant is very large, would you expect this reaction to be fast or slow? Explain the effect on equilibrium of Increasing temperature Increasing pressure by decreasing the volume Decreasing concentration of oxygen Increasing the concentration of...
6CO2 + 6H20 → C6H12O6 + 602 Glucose Oxygen Carbon Dioxide Water What type of energy needs to be added to make this reaction occur?
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy of formation data, determine which of the following reactions is more energetically favorable. .
The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2 --> 6CO2 + 6H2O + 686 Kcal Where is the energy that is released or absorbed (depends on the reaction) found?
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g
Calculate the amount of energy released as heat at constant pressure when 1.00 g of glucose undergoes a combustion reaction according to the equation below: C6H12O6(s) + 6O2(g) ® 6CO2(g) + 6H2O(g) ∆rHϴ = –2806 kJ (A) 16.00 kJ (B) 156.0 kJ (C) 468.0 kJ (D) 2806 kJ (E) 505600 kJ
1) the photosynthetic conversion of co2 to o2 can be represented by 6co2 + 6h2o <>c6h12o6+6o2 what is the equilibrium expression for this reaction? 2) what is the state of the system if I2=1.0 M and I=1.0×10^-3 M I2 <>2I. kc=3.8×10^-5 a. the system is at equilibrium b. the system is at a steady state c. the system is not at equilibrium and will produce more reactants d. the system is not at equilibrium and will produce more products 3)...
LUCJLIUILI Calculate the AH°rxn (in kJ) for combustion of acetone (C3HO): 2C3H6O(g) + 9O2(g) — 6CO2(g) + 6H2O(1) The standard enthalpies of formation are: CO2(g) AH°F = -393.5 kJ/mol H2O(1) AHºr=-285.9 kJ/mol C3H6O(g) AH° = -216.6 kJ/mol