6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for the reaction is -2837 kJ/mole. Is this reaction endothermic or exothermic? Write an expression for the equilibrium constant for this reaction. Given that the value of the equilibrium constant is very large, would you expect this reaction to be fast or slow? Explain the effect on equilibrium of Increasing temperature Increasing pressure by decreasing the volume Decreasing concentration of oxygen Increasing the concentration of...
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy of formation data, determine which of the following reactions is more energetically favorable. .
Glucose, C6H12O6,C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equation C6H12O6(aq)+6O2(g)⟶6CO2(g)+6H2O(l)C6H12O6(aq)+6O2(g)⟶6CO2(g)+6H2O(l) Calculate the number of grams of oxygen required to convert 13.0 g13.0 g of glucose to CO2CO2 and H2O.H2O.
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86 mol of C6H12O6, how many moles of CO2 are needed?
1) the photosynthetic conversion of co2 to o2 can be represented by 6co2 + 6h2o <>c6h12o6+6o2 what is the equilibrium expression for this reaction? 2) what is the state of the system if I2=1.0 M and I=1.0×10^-3 M I2 <>2I. kc=3.8×10^-5 a. the system is at equilibrium b. the system is at a steady state c. the system is not at equilibrium and will produce more reactants d. the system is not at equilibrium and will produce more products 3)...
The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2 --> 6CO2 + 6H2O + 686 Kcal Where is the energy that is released or absorbed (depends on the reaction) found?
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g
Glucose (C6H12O6) is an important energy-rich compound, produced by photosynthesis according to the equation below. What mass of glucose can be produced from 2.50 g of CO2 and the necessary water? 6CO2(g) + 6H2O(l) → C6H12O6(l) + 6O2(g)
please help greatly appreciated.. Is the following reaction endothermic or exothermic ? CH4 (g) + O2 (g) + CO2(g) + H20 (g) + energy endothermic, energy is given off by the reaction AH = (+) value exothermic, energy is absorbed by the reaction exothermic, energy is given off by the reaction endothermic, energy is absorbed by the reaction