(CH3CH2O)2POH + (CH3)3CNH2 + CCl4 = ? + ? + HCCl3 If one of the products...
Homework Answers
Add Answer to:
(CH3CH2O)2POH + (CH3)3CNH2 + CCl4 = ? + ? + HCCl3
If one of the products...
balance the following equation : (CH3CH2O)2POH + (CH3)3CNH2 + CCl4 = (CH3CH2O)2PONHCH2CH3 + ((CH3)3CNH3)Cl + CHCl3
balance the following equation : (CH3CH2O)2POH + (CH3)3CNH2 + CCl4 = (CH3CH2O)2PONHCH2CH3 + ((CH3)3CNH3)Cl + CHCl3
Write the products and balance the equation for the following: reacting diethylphosphite with tert-butylamine (CH3CH2O)...
Write the products and balance the equation for the following: reacting diethylphosphite with tert-butylamine (CH3CH2O)2POH + (CH3)3CNH2 + CCl4 --> ? Calculate theoretical yield for each product. 8.5 mmol of diethylphosphite, 20mmol of tert-butylamine, and 20 mmol of carbon tetrachloride were used in the reaction.
(1 pt) 3. Name the following compound and use the appropriate cis/trans designation. C(CH3)3 (1 pt)...
(1 pt) 3. Name the following compound and use the appropriate cis/trans designation. C(CH3)3 (1 pt) 4. The Chemical Engineering Question! Chemical Engineers write mass and energy balances all the time. To do that, they need to know the balanced chemical equation of the process in question. By using the appropriate molecular formulas, write a balanced equation that describes the complete combustion of cyclohexane.
Predict the products of the following reactions. Assume that both reactants are in aqueous solutions and...
Predict the products of the following reactions. Assume that both reactants are in aqueous solutions and mixed with each other, which products will be formed. Write a balanced chemical equation, and a net ionic equation. Name the type of reaction you have in each case. (in case there is no reactions, write NR) Products __ sulfuric acid + __lithium hydroxide ______________ + ________________ _________________ + _______________ Net ionic eq:______________________________________________________ __iron(III) sulfate + __sodium carbonate ______________ + ________________...
Write a balanced equation and Kb expression for the following Bronsted-Lowry base in water: (CH3)3N Include...
Write a balanced equation and Kb expression for the following Bronsted-Lowry base in water: (CH3)3N Include the states of all reactants and products in your equation. You do not need to include the states in the equilibrium expression. 1) Balance EQN: 2) Kb expression:
1, Write the balanced chemical equation for the formation of (S)-phenylsuccinic acid. Start with one equivalent...
1, Write the balanced chemical equation for the formation of (S)-phenylsuccinic acid. Start with one equivalent of (S,S,S)-bis proline phenylsuccinic acid salt and two equivalents of hydrochloric acid
what products would you expect from the following reaction? (alkene organic reaction with NBS/ CCl4) What...
what products would you expect from the following reaction?
(alkene organic reaction with NBS/ CCl4)
What product(s) would you expect from the following reaction? You do not have to consider stereochemistry. If more than one structure fits the description, draw them all. Draw one structure per sketcher. Add additional sketchers using the dropdown Separate structures with + signs from the dropdown menu.
K.Gunner Stoichiometry, Balance equations, Types of reaction An aqueous solution of Potassium chlorate reacts with an...
K.Gunner Stoichiometry, Balance equations, Types of reaction An aqueous solution of Potassium chlorate reacts with an aqueous solution of Iron Ill Carbonate to produce an aqueous salt solution and a precipitated salt containing the Iron Iillon, as products. 1) Predict the products that will be produced and Write the correct formulas for each. 2) Write the entire Chemical equation both products and reactants, include in your equation the correct formulas for each and the proper phases associated with each formula....
Draw the organic product(s) of the following reaction. CH3 CH3 NBS monosubstitution products CCI You do...
Draw the organic product(s) of the following reaction. CH3 CH3 NBS monosubstitution products CCI You do not have to consider stereochemistry. Draw one structure per sketcher. Add additional sketchers using the drop-down menu in the bottom right corner. Separate multiple products using the + sign from the drop-down menu. opy aste
One of the most common buffers used in protein chemistry is a weak base called TRIS...
One of the most common buffers used in protein chemistry is a weak base called TRIS (the nitrogen atom of the amino group is the basic portion of the molecule). Write balanced equations for the following. Include phases in parentheses. Use "TRIS" to represent (HOCH2)3CNH2. Write cations (if any) first, followed by molecules (if any), and finally anions (if any) last. For ions, put the charge in parentheses followed by phase in parentheses. If a charge is greater than one,...
(1 pt) 3. Name the following compound and use the appropriate cis/trans designation. C(CH3)3 (1 pt) 4. The Chemical Engineering Question! Chemical Engineers write mass and energy balances all the time. To do that, they need to know the balanced chemical equation of the process in question. By using the appropriate molecular formulas, write a balanced equation that describes the complete combustion of cyclohexane.
what products would you expect from the following reaction?
(alkene organic reaction with NBS/ CCl4)
What product(s) would you expect from the following reaction? You do not have to consider stereochemistry. If more than one structure fits the description, draw them all. Draw one structure per sketcher. Add additional sketchers using the dropdown Separate structures with + signs from the dropdown menu.
K.Gunner Stoichiometry, Balance equations, Types of reaction An aqueous solution of Potassium chlorate reacts with an aqueous solution of Iron Ill Carbonate to produce an aqueous salt solution and a precipitated salt containing the Iron Iillon, as products. 1) Predict the products that will be produced and Write the correct formulas for each. 2) Write the entire Chemical equation both products and reactants, include in your equation the correct formulas for each and the proper phases associated with each formula....
Draw the organic product(s) of the following reaction. CH3 CH3 NBS monosubstitution products CCI You do not have to consider stereochemistry. Draw one structure per sketcher. Add additional sketchers using the drop-down menu in the bottom right corner. Separate multiple products using the + sign from the drop-down menu. opy aste
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 35 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago