Homework Answers
Add Answer to:
Question 2 1 pts Manganese(II) sulfate is produced in the following reaction: 5 H2C2O4 (aq) +...
Question 1 1 pts Fine wires of magnesium burn readily in oxygen to produce magnesium oxide....
Question 1 1 pts Fine wires of magnesium burn readily in oxygen to produce magnesium oxide. If 15.8 g of Mg are reacted with 9.69 g of Oz in a sealed reaction vessel, what is the mass of MgO produced? (Fill in only number, 3 sig figs) Question 2 1 pts Manganese(II) sulfate is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4(aq) + 3 H2SO4 (aq) → 10C026 + 2 MnSO4(09) + K3504 (aq) + 8 H20 10...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowe...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
Consider the equation: 2 KMnO4 + 5 H2C2O4 + 3 H2SO4 → 2 MnSO4 + 10...
Consider the equation: 2 KMnO4 + 5 H2C2O4 + 3 H2SO4 → 2 MnSO4 + 10 CO2 + 8 H2O + K2SO4 If the percent yield of the reaction is 42.8%, how many grams of sulfuric acid (F.W. 98.08) are needed to produce 7.9 g of manganese(II) sulfate (F.W. 151.0)? Enter your numerical result in grams without the unit to a precision of 0.01 g.
Five Questions, 10 pts each 50 pts total 1. Calcium oxide reacts with water in a...
Five Questions, 10 pts each 50 pts total 1. Calcium oxide reacts with water in a combination reaction to produce calcium hydroxide: CaO(s) + H2O(1) Ca(OH)2(s) A 5.00-g sample of CaO is reacted with 4.83 g of H20. Determine the limiting reagent and the excess reagent. How many grams of the excess reagent will remain after the reaction is complete? 2. If the percent yield for the following reaction is 75.0%, and 25.0 g of NO2 are consumed in the...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 ...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 and 10.00 g of HCl are reacted, how many grams of MnCl2 can be produced? Show all calculations 2. Consider the following unbalanced equation: NH4NOs(aq) + Na PO4(aq)(NH4)3PO4(aq NaNOs(aq) Assuming you start with 50.0 g of NHNOs and 50.0 g of NasPO4, which is the limiting reagent? What is the theoretical yield (g) of ammonium phosphate? a....
8) Consider the following reaction: 3NaHCO3(aq) + H3C6H5O7(aq) ® 3CO2(g) + 3H2O(l) + Na3C6H5O7(aq) If 1.00...
8) Consider the following reaction: 3NaHCO3(aq) + H3C6H5O7(aq) ® 3CO2(g) + 3H2O(l) + Na3C6H5O7(aq) If 1.00 grams of NaHCO3 reacts with 1.00 grams of H3C6H5O7, what is the limiting reagent? (4) b) What mass of water will be formed? (4) c) After the reaction has gone to completion, what mass of the excess reagent remains? (1)
1. Consider the following equation: Ca(OH)2(8) + 2HCl(aq) - CaCl(aq) + 2 H2001) Solve the following...
1. Consider the following equation: Ca(OH)2(8) + 2HCl(aq) - CaCl(aq) + 2 H2001) Solve the following questions based on the above questions a. What type of chemical reaction is taking place? b. How many liters of 0.100 M HC would be required to react completely with 5.00 grams of calcium hydroxide? (5 pts) Show the work. c. II combined 15.0 grams of calcium hydroxide with 75,0 mL of 0.500 M HCI, how many grams of calcium chloride would be formed?...
In an acidic solution, permanganate ion reacts with tin(II) ion to give manganese(II) lon and tin(IV)...
In an acidic solution, permanganate ion reacts with tin(II) ion to give manganese(II) lon and tin(IV) ion. (a) Enter a balanced net ionic equation for the reaction (include physical states in your answer). 2+ 2+ 4+ 2MnO& (aq) + 5Sn (aq)+16H (aq)-2Mn (aq) + 5Sn (ag)+8H O) Save & Close Undo Select Erase Help 7 8 (aq) (g) () (s) 4 5 6 e + E NONE 1 2 C F NR Na Mg Al Si P CI K Ca...
Chlorine can be prepared in the laboratory by the reaction of manganese dioxide with hydrochloric acid,...
Chlorine can be prepared in the laboratory by the reaction of manganese dioxide with hydrochloric acid, HCl(aq), as described by the chemical equation MnO,(s) + 4 HCl(aq) + MnCl2(aq) + 2 H,0(1) + Cl2(g) How much Mno,(s) should be added to excess HCl(aq) to obtain 275 mL CI,(e) at 25°C and 725 Torr? mass of Mno, Solid ammonium chloride, NH,CI, is formed by the reaction of gaseous ammonia, NH,, and hydrogen chloride, HCI. NH,() + HCI(g) →NH,Cl(s) A 4.70 g...
D Question 3 3 pts (This is the same reaction from #2.) You repeat the Diels-Alder...
D Question 3 3 pts (This is the same reaction from #2.) You repeat the Diels-Alder reaction from lab using 3.4 g of maleic anhydride (98.06 g/mol) and 2.5 g of cyclopentadiene (66.1 g/mol) to form the final solid product (164.16 g/mol). All compounds are in a 1:1 ratio in the balanced equation. Assuming all the limiting reagent reacts, how much of the other reagent is there in excess? 0.469 g 0 0.309 g O 1.71 g O 0.208 g...
Question 1 1 pts Fine wires of magnesium burn readily in oxygen to produce magnesium oxide. If 15.8 g of Mg are reacted with 9.69 g of Oz in a sealed reaction vessel, what is the mass of MgO produced? (Fill in only number, 3 sig figs) Question 2 1 pts Manganese(II) sulfate is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4(aq) + 3 H2SO4 (aq) → 10C026 + 2 MnSO4(09) + K3504 (aq) + 8 H20 10...
Question 1 1 pts Calculate the mass of potassium chloride, KCI, (in grams) formed when 7.00 g of chlorine gas is allowed to react with 5.00 g of potassium. (write the chemical reaction first) 7.36 7.38 14.7 4.77 9.53 Question 2 1 pts Carbon dioxide is produced in the following reaction: 5 H2C204(aq) + 2 KMnO4 (aq) + 3 H2SO4 (aq) → 10 CO2(g) + 2 MnSO4 (aq) + K2SO4 (aq) + 8 H20 (1) What is the limiting reagent...
Five Questions, 10 pts each 50 pts total 1. Calcium oxide reacts with water in a combination reaction to produce calcium hydroxide: CaO(s) + H2O(1) Ca(OH)2(s) A 5.00-g sample of CaO is reacted with 4.83 g of H20. Determine the limiting reagent and the excess reagent. How many grams of the excess reagent will remain after the reaction is complete? 2. If the percent yield for the following reaction is 75.0%, and 25.0 g of NO2 are consumed in the...
1. Consider the reaction: MnO2 (s) + 4 HCl (g)MnCl2 (s) + Cl2 (g) + 2 H20 (g) If 10.00 g of MnO2 and 10.00 g of HCl are reacted, how many grams of MnCl2 can be produced? Show all calculations 2. Consider the following unbalanced equation: NH4NOs(aq) + Na PO4(aq)(NH4)3PO4(aq NaNOs(aq) Assuming you start with 50.0 g of NHNOs and 50.0 g of NasPO4, which is the limiting reagent? What is the theoretical yield (g) of ammonium phosphate? a....
1. Consider the following equation: Ca(OH)2(8) + 2HCl(aq) - CaCl(aq) + 2 H2001) Solve the following questions based on the above questions a. What type of chemical reaction is taking place? b. How many liters of 0.100 M HC would be required to react completely with 5.00 grams of calcium hydroxide? (5 pts) Show the work. c. II combined 15.0 grams of calcium hydroxide with 75,0 mL of 0.500 M HCI, how many grams of calcium chloride would be formed?...
In an acidic solution, permanganate ion reacts with tin(II) ion to give manganese(II) lon and tin(IV) ion. (a) Enter a balanced net ionic equation for the reaction (include physical states in your answer). 2+ 2+ 4+ 2MnO& (aq) + 5Sn (aq)+16H (aq)-2Mn (aq) + 5Sn (ag)+8H O) Save & Close Undo Select Erase Help 7 8 (aq) (g) () (s) 4 5 6 e + E NONE 1 2 C F NR Na Mg Al Si P CI K Ca...
Chlorine can be prepared in the laboratory by the reaction of manganese dioxide with hydrochloric acid, HCl(aq), as described by the chemical equation MnO,(s) + 4 HCl(aq) + MnCl2(aq) + 2 H,0(1) + Cl2(g) How much Mno,(s) should be added to excess HCl(aq) to obtain 275 mL CI,(e) at 25°C and 725 Torr? mass of Mno, Solid ammonium chloride, NH,CI, is formed by the reaction of gaseous ammonia, NH,, and hydrogen chloride, HCI. NH,() + HCI(g) →NH,Cl(s) A 4.70 g...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 8 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago