Homework Answers
Add Answer to:
2. What group of metals react with sulfur to form M.S, sulfides, reacts with fluorine to...
12. Fluorine atoms tend to..... .when they form chemical compounds with metals. a) lose electrons b)...
12. Fluorine atoms tend to..... .when they form chemical compounds with metals. a) lose electrons b) gain electrons (e) neither lose nor gain electrons..they usually share electrons equally with metals. Fluorine atoms do not form compounds with other atoms... .luorine is an inert gas. (d 13. The process in changing a solid to gas A. freezing B. condensation C. sublimation D. Deposition 14. What is the outermost orbital, electron and energy level for C. 7d1 Lu? A. 6D B. 6f4...
2. a) Define the meaning of the term "activity series" of metals b) How does it...
2. a) Define the meaning of the term "activity series" of metals b) How does it relate to oxidation? 3. Define "chemical periodicity" and use metallic properties as an example, 141 Relative Reactivity of Metals and we 4. List the changes that you will observe to indicate that a reaction all observe to indicate that a reaction has occurred. Peranapan 5. Write the equation for each of the following renctions. Construct a minature activity series listing lead, zinc, hydrogen, potassium...
The ionization energy of Group 2 elements decrease and the radii decrease down the group. Therefore a. The metals a...
The ionization energy of Group 2 elements decrease and the radii decrease down the group. Therefore a. The metals are less easily oxidized down the group b. The metals are more easily oxidized down the group c. Redox properties do not change systematically down the group Which Group 2 element DOES NOT form ionic hydrides? a. Ca b. Sr e. Be What is the pH of a saturated solution of Ca(OH)? The solubility of Ca(OH) is 2.1x10-3M a. 11.02 b....
1-Each of the following metals reacts with nitric acid to form the metal chloride and hydrogen gas. Complete and bal- an...
1-Each of the following metals reacts with nitric acid to form the metal chloride and hydrogen gas. Complete and bal- ance the reactions to show the formation of these products. a. Zn (s) +HNO, (aq)-> b. Pb (s) +HNO3 (aq) - c. Na (s) HNO3 (aq)- d. Al (s) HNO, (aq)- 2- Complete and balance these acid-base neutralization reactions: a. CSOH (aq) HBr (aq) b. HBr (aq) Fe(OH)2 (s) c. H,PO4 (aq) +KOH (aq)- 3-In a titration experiment, two drops...
pppppplllleeeaaassseee help 1. a. Compound 1 reacts with A under acid conditions to form an imine. What could Z be in this reaction? b. Compound 2 reacts with A (same A as previous reaction) unde...
pppppplllleeeaaassseee help
1. a. Compound 1 reacts with A under acid conditions to form an imine. What could Z be in this reaction? b. Compound 2 reacts with A (same A as previous reaction) under acid conditions to form an amide. What is Z in this reaction? Draw the structure of A Use curved arrows to show how Compound 2 forms the amide. c. Both reactions involve a leaving group. What is the leaving group in each reaction? O A...
5) How many moles of hydrogen gas are needed to react with oxygen to form one...
5) How many moles of hydrogen gas are needed to react with oxygen to form one mole of 5) water? 2H2(8) + O268) - 2H20(1) A) 4 mol B) 1 mol C) 2 mol D) 0.5 mol E) 6 mol 6) Incomplete combustion occurs when there is insufficient oxygen to react with a compound. The suffocating gas carbon monoxide is a product of incomplete combustion. How many moles of oxygen gas are required for the complete combustion of 11.0 moles...
Chemistry CHE 140, 170, 180 о Goal: With reference only to the periodic table, to write...
Chemistry CHE 140, 170, 180 о Goal: With reference only to the periodic table, to write the electron configuration of the ground state (lowest energy), gaseous, atoms. Tools: (1) A list of the electronic sublevels within the atom in order of their increasing energy. (Write the list, 1s 2s 2p <6s, in the boxes below as indicated, by inspection of the "Aufbau" diagram or of the periodic table, where the order is explicit) (ii) Fill in the box below each...
Why wouldnt a weak base, such as NH3, work just as well as KOH in (1)?...
Why wouldnt a weak base, such as NH3, work just as well as KOH
in (1)?
2.2 Is the question I have. I figured out
2.1 already.
Below is relevant info. Thanks!
2. (1) Describe how adding a solution of KOH to the original sulfide precipitate results in the separa- tion of Sn4+ ion from the other Group W cations. (2) Why wouldn't a weak base, such as aque- ous NH3, work just as well as aqueous KOH in (1)?...
3.2 Periodic trends 1. (0620-5 2012-Paper 1/2-Q21) Which properties of the element titanium, Ti, can be...
3.2 Periodic trends 1. (0620-5 2012-Paper 1/2-Q21) Which properties of the element titanium, Ti, can be predicted from its position in the Periodic Table? forms coloured compounds conducts electricity when solid can be used has low density as a catalyst X A X X Xx 2. (0620-W 2012-Paper 1/1-Q20) The diagram shows an outline of the Periodic Table. U V W X Y Which of the elements U, V, W, X and Y would react together in the ratio of...
2. A piece of sodium metal reacts completely with water as follows: 2Na(s) + 2H2O(l) à...
2. A piece of sodium metal reacts completely with water as follows: 2Na(s) + 2H2O(l) à 2NaOH(aq) + H2(g). The hydrogen gas generated is collected over water at 25.0oC. The volume of the gas is 252mL measured at 1.00atm. Calculate the number of grams of sodium used in the reaction. (Vapor pressure of water at 25oC = 0.0313atm). a. 0.23g b.0.25g c. 0.474g d. 0.459g 3. Write the ground state electron configuration for Iron. a. [Kr]5s24d105p5 b. [Rn]7s1 c. 1s22s22p5...
12. Fluorine atoms tend to..... .when they form chemical compounds with metals. a) lose electrons b) gain electrons (e) neither lose nor gain electrons..they usually share electrons equally with metals. Fluorine atoms do not form compounds with other atoms... .luorine is an inert gas. (d 13. The process in changing a solid to gas A. freezing B. condensation C. sublimation D. Deposition 14. What is the outermost orbital, electron and energy level for C. 7d1 Lu? A. 6D B. 6f4...
2. a) Define the meaning of the term "activity series" of metals b) How does it relate to oxidation? 3. Define "chemical periodicity" and use metallic properties as an example, 141 Relative Reactivity of Metals and we 4. List the changes that you will observe to indicate that a reaction all observe to indicate that a reaction has occurred. Peranapan 5. Write the equation for each of the following renctions. Construct a minature activity series listing lead, zinc, hydrogen, potassium...
The ionization energy of Group 2 elements decrease and the radii decrease down the group. Therefore a. The metals are less easily oxidized down the group b. The metals are more easily oxidized down the group c. Redox properties do not change systematically down the group Which Group 2 element DOES NOT form ionic hydrides? a. Ca b. Sr e. Be What is the pH of a saturated solution of Ca(OH)? The solubility of Ca(OH) is 2.1x10-3M a. 11.02 b....
pppppplllleeeaaassseee help
1. a. Compound 1 reacts with A under acid conditions to form an imine. What could Z be in this reaction? b. Compound 2 reacts with A (same A as previous reaction) under acid conditions to form an amide. What is Z in this reaction? Draw the structure of A Use curved arrows to show how Compound 2 forms the amide. c. Both reactions involve a leaving group. What is the leaving group in each reaction? O A...
5) How many moles of hydrogen gas are needed to react with oxygen to form one mole of 5) water? 2H2(8) + O268) - 2H20(1) A) 4 mol B) 1 mol C) 2 mol D) 0.5 mol E) 6 mol 6) Incomplete combustion occurs when there is insufficient oxygen to react with a compound. The suffocating gas carbon monoxide is a product of incomplete combustion. How many moles of oxygen gas are required for the complete combustion of 11.0 moles...
Chemistry CHE 140, 170, 180 о Goal: With reference only to the periodic table, to write the electron configuration of the ground state (lowest energy), gaseous, atoms. Tools: (1) A list of the electronic sublevels within the atom in order of their increasing energy. (Write the list, 1s 2s 2p <6s, in the boxes below as indicated, by inspection of the "Aufbau" diagram or of the periodic table, where the order is explicit) (ii) Fill in the box below each...
Why wouldnt a weak base, such as NH3, work just as well as KOH
in (1)?
2.2 Is the question I have. I figured out
2.1 already.
Below is relevant info. Thanks!
2. (1) Describe how adding a solution of KOH to the original sulfide precipitate results in the separa- tion of Sn4+ ion from the other Group W cations. (2) Why wouldn't a weak base, such as aque- ous NH3, work just as well as aqueous KOH in (1)?...
3.2 Periodic trends 1. (0620-5 2012-Paper 1/2-Q21) Which properties of the element titanium, Ti, can be predicted from its position in the Periodic Table? forms coloured compounds conducts electricity when solid can be used has low density as a catalyst X A X X Xx 2. (0620-W 2012-Paper 1/1-Q20) The diagram shows an outline of the Periodic Table. U V W X Y Which of the elements U, V, W, X and Y would react together in the ratio of...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago