Homework Answers
Add Answer to:
Hess's Law, what is net reaction energy?
Enter all AH values in kJ/mol aHu497kIm AM:-- 756K3mal...
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below:...
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below: Table 1. Change in Enthalpy for Reactions Reactions Change in Enthalpy (AH) AH = -393.5 kJ/mol (1) C() (2) Hz((g) + + O2(g) O2(g) → CO2(8) → H2O(l) AH2 = -285.8 kJ/mol (3) 2CH.(g) + 702(g) → 4 CO2(g)+ 6H2O(1) AH = -283.0 kJ/mol Calculate the enthalpy change for the reaction: 2 C(s) + 3H2(g) → CzH6(g) AH = kJ/mol
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below:...
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below: Table 1. Change in Enthalpy for Reactions Reactions Change in Enthalpy (AH) AH = -393.5 kJ/mol (1) C() (2) Hz((g) + + O2(g) O2(g) → CO2(8) → H2O(l) AH2 = -285.8 kJ/mol (3) 2CH.(g) + 702(g) → 4 CO2(g)+ 6H2O(1) AH = -283.0 kJ/mol Calculate the enthalpy change for the reaction: 2 C(s) + 3H2(g) → CzH6(g) AH = kJ/mol
Practice with Hess's Law and Standard Heats of Formation 1. (Example) The reaction C2H4 (g) +...
Practice with Hess's Law and Standard Heats of Formation 1. (Example) The reaction C2H4 (g) + 6 F2 (g) → 2 CF4(g) + 4 HF (g) can be written as the sum of: C2H4 (9) ► 2 C(s) + 2 H2 (g) AH = -52.3 kJ/mol 2 C(s) + 4 F2 (9) ► 2 CF4(9) AH = -1360 kJ/mol 2 H2(g) + 2 F2 (g) → 4 HF (a) AH = -1074 kJ/mol C2H4(g) + 6 F2(g) → 2 CF4(g)...
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g)...
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g) Using the following equations: Si(s) + O2(g) → SiO2(s) Si(s) + 2F2(g) → SiF4(g) H2(g) + F2(g) → 2HF(g) H2(g) + 4202(g) → H2O(g) AH = -910.9 kJ/mol rxn AH = -1651 kJ/mol rxn AH = -542 kJ/mol rxn AH = -241.8 kJ/mol rxn
Part III. Use of Hess's Law to Determine the Heat of Formation of Magnesium Oxide Write...
Part III. Use of Hess's Law to Determine the Heat of Formation of Magnesium Oxide Write in the average molar heats of reaction for the reaction of magnesium with hydrochloric acid and the reaction of magnesium oxide with hydrochloric acid. Make a Hess's Law calculation in the space provided below, using the heats of reaction of magnesium and magnesium oxide and the heat of formation of water, to calculate the heat of reaction for the reaction Mg(s) + 1/2 O2...
Practice with Hess's Law and Standard Heats of Formation 1. (Example) The reaction C He(g) +...
Practice with Hess's Law and Standard Heats of Formation 1. (Example) The reaction C He(g) + 6 F2 (g) → 2 CF4(g) + 4 HF (9) can be written as the sum of: CH4 (9) ► 2 C(s) + 2 Ha(o) AH = -52.3 kJ/mol 2 C(s) + 4 Faq) → 2 CF4g) SH -1380 kJ/mol 2 Haq) + 2 Fala) > 4 HF HE.1074 kJimol CsHe(g) + 6 F2 (g) → 2 CF.(g) + 4 HF (g) AH =...
Use Hess's law and the following data CH4(g) + 2O2(g) → CO2(g) + 2 H2O(g) AH°...
Use Hess's law and the following data CH4(g) + 2O2(g) → CO2(g) + 2 H2O(g) AH° = -802 kJ mol-1 CH4(8) + CO2(g) —> 2CO(g) + 2 H2(g) AFH° = +247 kJ mol-1 CH4(g) + H2O(g) –> CO(g) + 3H2(g) AFH° = +206 kJ mol-1 to determine A.Hº for the following reaction, an important source of hydrogen gas CH4(8) + +02(8) — CO(g) + 2 H2(8)
PROBLEM-SOLVING CLASS ACTIVITY 11 Use Hess's Law to calculate the enthalpy of formation of CH2OH: C(graphite)...
PROBLEM-SOLVING CLASS ACTIVITY 11 Use Hess's Law to calculate the enthalpy of formation of CH2OH: C(graphite) + 2 H2(g) + 1026) → CH2OH(1) Given the following data: CH2OH() • 02(9) + CO2(g) + 2H2O(1) AH°: -726.4 kJ/mol C(graphite). O2(g) → CO2(9) AH' = -393.5 kJ/mol H2(g) + 40269) → H2O(1) AH = -285.8 kJ/mol
One application of Hess's Law (which works for AH, AS, and AG) is calculating the overall...
One application of Hess's Law (which works for AH, AS, and AG) is calculating the overall energy of a reaction using standard energies of formation of products and reactants. What is the standard change in free energy for the reaction: 4 KCIO3(s) → 3 KCIO4(s) + KCl(s)? Use the following standard gibbs energies of formation: AGF(KCIO3(s)) = -295.6 kJ/mol; AGF(KCIO4(s)) = -301.8 kJ/mol; AG (KCl(s)) = -414.1 kJ/mol Enter your answer in kJ.
Using Hess's Law, determine the enthalpy change of the following reaction. CS2(1) + 3 O2(g) -->...
Using Hess's Law, determine the enthalpy change of the following reaction. CS2(1) + 3 O2(g) --> CO2(g) + 2 SO2(g) C(s) + O2(g) --> CO2(g) AH = -393.5 kJ/mol S(s) + O2(g) --> SO2(g) AH = -296.8 kJ/mol C(s) + 25(s) --> CS2(8) AH = +87.9 kJ/mol -899.2 kJ O-778.2 kJ -602.4 kJ - 1075.0 kJ
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below: Table 1. Change in Enthalpy for Reactions Reactions Change in Enthalpy (AH) AH = -393.5 kJ/mol (1) C() (2) Hz((g) + + O2(g) O2(g) → CO2(8) → H2O(l) AH2 = -285.8 kJ/mol (3) 2CH.(g) + 702(g) → 4 CO2(g)+ 6H2O(1) AH = -283.0 kJ/mol Calculate the enthalpy change for the reaction: 2 C(s) + 3H2(g) → CzH6(g) AH = kJ/mol
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below: Table 1. Change in Enthalpy for Reactions Reactions Change in Enthalpy (AH) AH = -393.5 kJ/mol (1) C() (2) Hz((g) + + O2(g) O2(g) → CO2(8) → H2O(l) AH2 = -285.8 kJ/mol (3) 2CH.(g) + 702(g) → 4 CO2(g)+ 6H2O(1) AH = -283.0 kJ/mol Calculate the enthalpy change for the reaction: 2 C(s) + 3H2(g) → CzH6(g) AH = kJ/mol
Practice with Hess's Law and Standard Heats of Formation 1. (Example) The reaction C2H4 (g) + 6 F2 (g) → 2 CF4(g) + 4 HF (g) can be written as the sum of: C2H4 (9) ► 2 C(s) + 2 H2 (g) AH = -52.3 kJ/mol 2 C(s) + 4 F2 (9) ► 2 CF4(9) AH = -1360 kJ/mol 2 H2(g) + 2 F2 (g) → 4 HF (a) AH = -1074 kJ/mol C2H4(g) + 6 F2(g) → 2 CF4(g)...
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g) Using the following equations: Si(s) + O2(g) → SiO2(s) Si(s) + 2F2(g) → SiF4(g) H2(g) + F2(g) → 2HF(g) H2(g) + 4202(g) → H2O(g) AH = -910.9 kJ/mol rxn AH = -1651 kJ/mol rxn AH = -542 kJ/mol rxn AH = -241.8 kJ/mol rxn
Part III. Use of Hess's Law to Determine the Heat of Formation of Magnesium Oxide Write in the average molar heats of reaction for the reaction of magnesium with hydrochloric acid and the reaction of magnesium oxide with hydrochloric acid. Make a Hess's Law calculation in the space provided below, using the heats of reaction of magnesium and magnesium oxide and the heat of formation of water, to calculate the heat of reaction for the reaction Mg(s) + 1/2 O2...
Practice with Hess's Law and Standard Heats of Formation 1. (Example) The reaction C He(g) + 6 F2 (g) → 2 CF4(g) + 4 HF (9) can be written as the sum of: CH4 (9) ► 2 C(s) + 2 Ha(o) AH = -52.3 kJ/mol 2 C(s) + 4 Faq) → 2 CF4g) SH -1380 kJ/mol 2 Haq) + 2 Fala) > 4 HF HE.1074 kJimol CsHe(g) + 6 F2 (g) → 2 CF.(g) + 4 HF (g) AH =...
Use Hess's law and the following data CH4(g) + 2O2(g) → CO2(g) + 2 H2O(g) AH° = -802 kJ mol-1 CH4(8) + CO2(g) —> 2CO(g) + 2 H2(g) AFH° = +247 kJ mol-1 CH4(g) + H2O(g) –> CO(g) + 3H2(g) AFH° = +206 kJ mol-1 to determine A.Hº for the following reaction, an important source of hydrogen gas CH4(8) + +02(8) — CO(g) + 2 H2(8)
PROBLEM-SOLVING CLASS ACTIVITY 11 Use Hess's Law to calculate the enthalpy of formation of CH2OH: C(graphite) + 2 H2(g) + 1026) → CH2OH(1) Given the following data: CH2OH() • 02(9) + CO2(g) + 2H2O(1) AH°: -726.4 kJ/mol C(graphite). O2(g) → CO2(9) AH' = -393.5 kJ/mol H2(g) + 40269) → H2O(1) AH = -285.8 kJ/mol
One application of Hess's Law (which works for AH, AS, and AG) is calculating the overall energy of a reaction using standard energies of formation of products and reactants. What is the standard change in free energy for the reaction: 4 KCIO3(s) → 3 KCIO4(s) + KCl(s)? Use the following standard gibbs energies of formation: AGF(KCIO3(s)) = -295.6 kJ/mol; AGF(KCIO4(s)) = -301.8 kJ/mol; AG (KCl(s)) = -414.1 kJ/mol Enter your answer in kJ.
Using Hess's Law, determine the enthalpy change of the following reaction. CS2(1) + 3 O2(g) --> CO2(g) + 2 SO2(g) C(s) + O2(g) --> CO2(g) AH = -393.5 kJ/mol S(s) + O2(g) --> SO2(g) AH = -296.8 kJ/mol C(s) + 25(s) --> CS2(8) AH = +87.9 kJ/mol -899.2 kJ O-778.2 kJ -602.4 kJ - 1075.0 kJ
Most questions answered within 3 hours.
-
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 49 minutes ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 46 minutes ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 1 hour ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 3 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 3 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 3 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 3 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 3 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 3 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 3 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 3 hours ago -
Explain an understanding of services and protocols.
Explain the job of DNS.
Explain the three email...
asked 4 hours ago