Homework Answers
NiCl2.6H2O upon heating we get anhydrous NiCl2
balanced reaction given below
NiCl2.6H2O +heat ----> NiCl2 + 6H2O
HCl with Na2CO3 is an example of neutralization reaction.
2 HCl(aq) + Na2CO3 --> 2 NaCl (aq) + CO2(g) + H2O (l)
**********
Add Answer to:
1 U UIO 1. Write the balanced equation for the reaction of nickel(II) chloride hexahydrate when...
write the balanced equation for this reaction and calculate the percentage yield. Iron (I) Chloride hexahydrate...
write the balanced equation for this reaction and
calculate the percentage yield.
Iron (I) Chloride hexahydrate 5mL Methanol 1.64g 7 A 2.56g &nh of H₂O sodium acetate 7 B gives Veild of 1.579 ol Fe (Cs H₂O₂) (FeCl 3.6H2O) Iron (II) Chloride hexahydrate lisng} A 8 mL H2O add solution to A 2.56g of sodium acetate 5 mL methonal gives Veild of 1.579 of Fe (Cs H₂O2)
Please write a word equation for this reaction and briefly describe the reactant and products. Write...
Please write a word equation for this reaction and briefly describe the reactant and products. Write the balanced chemical equation for all of the reactions. D. Double Displacement Reactions Reaction of sodium bicarbonate and hydrochloric acid Reaction of sodium carbonate and calcium chloride Reaction of potassium hydroxide and nickel chloride Reaction of silver nitrate and potassium chloride
Postlab Questions 1. Write a balanced equation for the gas evolution reaction between aqueous solutions of...
Postlab Questions 1. Write a balanced equation for the gas evolution reaction between aqueous solutions of sodium carbonate and hydrochloric acid. 2. What is the molar ratio of sodium chloride to sodium carbonate from the above balanced equation? Describe how your results (Calculation 1j.) compare to this ratio. 3. Write a balanced equation for the gas evolution reaction between aqueous solutions of sodium bicarbonate and hydrochloric acid. 4. What is the molar ratio of sodium chloride to sodium bicarbonate from...
(also specify states aq or s) 1.Write a net ionic equation* for the reaction that occurs...
(also specify states aq or s) 1.Write a net ionic equation* for the reaction that occurs when excess hydrochloric acid (aq) and iron(II) carbonate are combined. 2.Write a net ionic equation* for the reaction that occurs when excess hydrochloric acid (aq) and chromium(II) sulfide are combined. 3.Write a net ionic equation* for the reaction that occurs when aqueous solutions of sodium hydroxide and hydroiodic acid are combined 4.Write a net ionic equation* for the reaction that occurs when aqueous solutions...
Complete and balance the molecular equation for the reaction of aqueous sodium carbonate and aqueous nickel Chloride In...
Complete and balance the molecular equation for the reaction
of aqueous sodium carbonate and aqueous nickel Chloride Include
physical states
Complete and balance the molecular equation for the reaction of aqueous sodium carbonate, Na, Co,, and aqueous nickel(II) chloride, NiCl. Include physical states. molecular equation: Na, CO, (aq) + NiCI, (aq) + Enter the balanced net ionic equation for this reaction. Include physical states. net ionic equation:
18. For each of the following, write a balanced equation and a net ionic equation, if...
18. For each of the following, write a balanced equation and a net ionic equation, if possible. howing, write a balanced molecular equation, a balanced total ionic a. sodium carbonate + copper(II) chloride -----> b. potassium chloride + calcium nitrate ------> C. sodium sulfide + hydroiodic acid -------> d. ammonium phosphate + magnesium hydroxide -----> e. hydrochloric acid + silver nitrate ------->
Write a balanced equation for the reaction of anhydrous sodium carbonate and hydrochloric acid, and a...
Write a balanced equation for the reaction of anhydrous sodium carbonate and hydrochloric acid, and a balanced equation for the dehydration of sodium carbonate.
Practice Problem 7. Write a balanced chemical reaction for each of the following double replacement reactions....
Practice Problem 7. Write a balanced chemical reaction for each of the following double replacement reactions. (a) Silver Nitrate and Hydrochloric Acid (b) Sodium Carbonate and Hydrochloric Acid (c) Sodium Hydroxide and Nitric Acid (d) Calcium Chloride and Sulfuric Acid (e) Sodium Carbonate and Barium Chloride (f) Copper (II) Sulfate and Barium Chloride (8) Iron (III) Chloride and Sodium Hydroxide Write the formula of the following double replacement reactions.
S8 equation for the reaction. If precipitation is expected, write a balanced net ionic equation for...
S8 equation for the reaction. If precipitation is expected, write a balanced net ionic equation for the reaction. Otherwise, responds with "no precipitate". (Use the lowest possible coefficients. Omit states-of-matter in your answer.) chemPad XoXº = Greek (a) silver nitrate and hydrochloric acid Help chemPad X.X°C Orek (b) sodium chloride and potassium bromide chemPad X.X° Help Greek (c) sodium carbonate and barium chloride
Part A Write a balanced chemical equation for the reaction of aqueous sodium carbonate with aqueous copper(II) chlo...
Part A Write a balanced chemical equation for the reaction of aqueous sodium carbonate with aqueous copper(II) chloride to form solid copper (II) carbonate and aqueous sodium chloride. Express your answer as a chemical equation. Identify all of the phases in your answer. Submit Request Answer
write the balanced equation for this reaction and
calculate the percentage yield.
Iron (I) Chloride hexahydrate 5mL Methanol 1.64g 7 A 2.56g &nh of H₂O sodium acetate 7 B gives Veild of 1.579 ol Fe (Cs H₂O₂) (FeCl 3.6H2O) Iron (II) Chloride hexahydrate lisng} A 8 mL H2O add solution to A 2.56g of sodium acetate 5 mL methonal gives Veild of 1.579 of Fe (Cs H₂O2)
Postlab Questions 1. Write a balanced equation for the gas evolution reaction between aqueous solutions of sodium carbonate and hydrochloric acid. 2. What is the molar ratio of sodium chloride to sodium carbonate from the above balanced equation? Describe how your results (Calculation 1j.) compare to this ratio. 3. Write a balanced equation for the gas evolution reaction between aqueous solutions of sodium bicarbonate and hydrochloric acid. 4. What is the molar ratio of sodium chloride to sodium bicarbonate from...
Complete and balance the molecular equation for the reaction
of aqueous sodium carbonate and aqueous nickel Chloride Include
physical states
Complete and balance the molecular equation for the reaction of aqueous sodium carbonate, Na, Co,, and aqueous nickel(II) chloride, NiCl. Include physical states. molecular equation: Na, CO, (aq) + NiCI, (aq) + Enter the balanced net ionic equation for this reaction. Include physical states. net ionic equation:
18. For each of the following, write a balanced equation and a net ionic equation, if possible. howing, write a balanced molecular equation, a balanced total ionic a. sodium carbonate + copper(II) chloride -----> b. potassium chloride + calcium nitrate ------> C. sodium sulfide + hydroiodic acid -------> d. ammonium phosphate + magnesium hydroxide -----> e. hydrochloric acid + silver nitrate ------->
Practice Problem 7. Write a balanced chemical reaction for each of the following double replacement reactions. (a) Silver Nitrate and Hydrochloric Acid (b) Sodium Carbonate and Hydrochloric Acid (c) Sodium Hydroxide and Nitric Acid (d) Calcium Chloride and Sulfuric Acid (e) Sodium Carbonate and Barium Chloride (f) Copper (II) Sulfate and Barium Chloride (8) Iron (III) Chloride and Sodium Hydroxide Write the formula of the following double replacement reactions.
S8 equation for the reaction. If precipitation is expected, write a balanced net ionic equation for the reaction. Otherwise, responds with "no precipitate". (Use the lowest possible coefficients. Omit states-of-matter in your answer.) chemPad XoXº = Greek (a) silver nitrate and hydrochloric acid Help chemPad X.X°C Orek (b) sodium chloride and potassium bromide chemPad X.X° Help Greek (c) sodium carbonate and barium chloride
Part A Write a balanced chemical equation for the reaction of aqueous sodium carbonate with aqueous copper(II) chloride to form solid copper (II) carbonate and aqueous sodium chloride. Express your answer as a chemical equation. Identify all of the phases in your answer. Submit Request Answer
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 42 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago