Homework Answers
Add Answer to:
need help
6. (1 pts) Which of the following charged compounds is most stable AB.C.D or...
For each pair of species, predict which is the stronger base? 5. Он or 1. 2. or В в NH NH (a) (b) 6. Rank the follo...
For each pair of species, predict which is the stronger base? 5. Он or 1. 2. or В в NH NH (a) (b) 6. Rank the following from most stable to least stable. 2. 3. 4. Нас Н-с O H -н CH H CH,сH, сн,сн CH,CH 7. Which cation would be the most stable? А. В. C. D. What is the order of increasing contribution to the resonance hybrid? 8. CF3 ÇF3 CF3 I II III
For each pair of species, predict which is the stronger base? 5. Он or 2. or HH 1. NH NH (b) 6. Rank the following...
For each pair of species, predict which is the stronger base? 5. Он or 2. or HH 1. NH NH (b) 6. Rank the following from most stable to least stable. 4. 1. 2. 3. Н-с H H Н.с H -H H CH3 CH,сн, CH,сH CH,CH H 7. Which cation would be the most stable? А. В. C. D. What is the order of increasing contribution to the resonance hybrid? 8. CF3 Lnkentn CF3 CF3 Ш II I
6. Which of the four carbocations shown is the most stable (will not rearrange) and which one(s) will undergo carbo...
6. Which of the four carbocations shown is the most stable (will not rearrange) and which one(s) will undergo carbocation rearrangement(s)? Indicate the correct structures of the products of the carbocation rearrangements. To practice for the exam: use resonance structures to explain why you selected specific a carbocation as the most stable. Where applicable, use the curved arrow(s) to clearly draw the mechanism of the carbocation rearrangement. HO UW A. carbocation B is most stable and will not rearrange, and...
Need help understanding. Thanks! 15. Which of the following structures is the most important contributor to...
Need help understanding. Thanks!
15. Which of the following structures is the most important contributor to the resonance hybrid formed as intermediate when aniline undergoes para-bromination? NH2 NH2 NH2 Br D 16. Select the product of the following reaction H2 Pd/C NO2 Он Он NH2 NO2 NO2 NH2 A. В. C. D. 17. What is the starting material in the reaction below? 1. Mg cон 2. CO2 then acid A. Bromobenzene B. Benzyl bromide C. Benzoic acid D. Lithium benzoate...
2) (5 pts) For the molecular formula shown belo, a) Draw THREE stable structural isomers b) For t...
2) (5 pts) For the molecular formula shown belo, a) Draw THREE stable structural isomers b) For the third isomer, draw TWO reasonable resonance structures and ONE "bad" resonance structure that contributes almost nothing to the resonance hybrid (NOTE: the "mor" resonance structure can be equal to the major one if your isomer has twp equivalent resonance forms) EXAMPLE C4H CIO CI CI он но Major resonance structure Minor resonance structure Non-contributing resonance structure CI Cl Major resonance structure Minor...
chem help, please all questions 8. Estimate the average total charge on the following amino acid...
chem help, please all questions
8. Estimate the average total charge on the following amino acid at pH 7.0 pKaR = 12.48 NH pKal = 2.17 H2N ОН NH2 pKa2. 9.04 А. +2 В. +1 с. о D. -1 Е. -2 9. Which one of the following compounds is a non-reducing sugar? ОН ОН OCH3 НО- НО. НО ОН ОН ОН ОН || ОН ОН он CH2OH ОН ОНІ ОН OCH3 ОН CH2OH ОН IV — А. В. С. D....
Can someone please explain this! 15. Circle one of the following charged compounds which is most stable. (3 Points) Sle...
Can someone please explain this!
15. Circle one of the following charged compounds which is most stable. (3 Points) Sleast acidic +2 Which is the stronger influence for your choice? a) Resonance or b) Induction hyperconjugation)? (2 Points)
1. (6 pts.) Rank the following compounds in order of increasing acidity. Each series should be co...
Please solve and explain
1. (6 pts.) Rank the following compounds in order of increasing acidity. Each series should be considered separately. Use resonance and/or inductive effects to explain acidity. For full credit you will need to draw any resonance forms or indicate dipole if it is relevant. Also for each compound draw its conjugate base. Series 1: OH он OH O Series 2: CN 2. (4 pts.) Fill the reactions with the products and circle the favorite side: OH+...
order the following carbon radicals from most stable to least stable (1&2) 1. Order the following...
order the following carbon radicals from most stable to least
stable
(1&2)
1. Order the following carbon radicals from most stable to least stable. 5 3 2 2. Complete the following reaction scheme. "What goes over the arrow?" Write your answers in the spaces provided below. MgBr Br E Br ОН MgCl CI F G В Н Br Reagents required for the above reactions: F. А. G. В. Н. С. I. D. J. E. (
please explain/walkthrough! Problem 1 (30 pts) a) Circle the radical that is most stable. b) Order...
please explain/walkthrough!
Problem 1 (30 pts) a) Circle the radical that is most stable. b) Order the compounds in terms of increasing oxidation state (1 highest, 3- lowest) он c) The reaction below is an example of.... heat 2 b) substitution a) addition d) heterolytic cleavage c) homolytic cleavage d) Circle the compound with the most acidic protons. H H c=C CHз CH3CH2CH3 Нас-СЕС-н H
For each pair of species, predict which is the stronger base? 5. Он or 1. 2. or В в NH NH (a) (b) 6. Rank the following from most stable to least stable. 2. 3. 4. Нас Н-с O H -н CH H CH,сH, сн,сн CH,CH 7. Which cation would be the most stable? А. В. C. D. What is the order of increasing contribution to the resonance hybrid? 8. CF3 ÇF3 CF3 I II III
For each pair of species, predict which is the stronger base? 5. Он or 2. or HH 1. NH NH (b) 6. Rank the following from most stable to least stable. 4. 1. 2. 3. Н-с H H Н.с H -H H CH3 CH,сн, CH,сH CH,CH H 7. Which cation would be the most stable? А. В. C. D. What is the order of increasing contribution to the resonance hybrid? 8. CF3 Lnkentn CF3 CF3 Ш II I
6. Which of the four carbocations shown is the most stable (will not rearrange) and which one(s) will undergo carbocation rearrangement(s)? Indicate the correct structures of the products of the carbocation rearrangements. To practice for the exam: use resonance structures to explain why you selected specific a carbocation as the most stable. Where applicable, use the curved arrow(s) to clearly draw the mechanism of the carbocation rearrangement. HO UW A. carbocation B is most stable and will not rearrange, and...
Need help understanding. Thanks!
15. Which of the following structures is the most important contributor to the resonance hybrid formed as intermediate when aniline undergoes para-bromination? NH2 NH2 NH2 Br D 16. Select the product of the following reaction H2 Pd/C NO2 Он Он NH2 NO2 NO2 NH2 A. В. C. D. 17. What is the starting material in the reaction below? 1. Mg cон 2. CO2 then acid A. Bromobenzene B. Benzyl bromide C. Benzoic acid D. Lithium benzoate...
2) (5 pts) For the molecular formula shown belo, a) Draw THREE stable structural isomers b) For the third isomer, draw TWO reasonable resonance structures and ONE "bad" resonance structure that contributes almost nothing to the resonance hybrid (NOTE: the "mor" resonance structure can be equal to the major one if your isomer has twp equivalent resonance forms) EXAMPLE C4H CIO CI CI он но Major resonance structure Minor resonance structure Non-contributing resonance structure CI Cl Major resonance structure Minor...
chem help, please all questions
8. Estimate the average total charge on the following amino acid at pH 7.0 pKaR = 12.48 NH pKal = 2.17 H2N ОН NH2 pKa2. 9.04 А. +2 В. +1 с. о D. -1 Е. -2 9. Which one of the following compounds is a non-reducing sugar? ОН ОН OCH3 НО- НО. НО ОН ОН ОН ОН || ОН ОН он CH2OH ОН ОНІ ОН OCH3 ОН CH2OH ОН IV — А. В. С. D....
Can someone please explain this!
15. Circle one of the following charged compounds which is most stable. (3 Points) Sleast acidic +2 Which is the stronger influence for your choice? a) Resonance or b) Induction hyperconjugation)? (2 Points)
Please solve and explain
1. (6 pts.) Rank the following compounds in order of increasing acidity. Each series should be considered separately. Use resonance and/or inductive effects to explain acidity. For full credit you will need to draw any resonance forms or indicate dipole if it is relevant. Also for each compound draw its conjugate base. Series 1: OH он OH O Series 2: CN 2. (4 pts.) Fill the reactions with the products and circle the favorite side: OH+...
order the following carbon radicals from most stable to least
stable
(1&2)
1. Order the following carbon radicals from most stable to least stable. 5 3 2 2. Complete the following reaction scheme. "What goes over the arrow?" Write your answers in the spaces provided below. MgBr Br E Br ОН MgCl CI F G В Н Br Reagents required for the above reactions: F. А. G. В. Н. С. I. D. J. E. (
please explain/walkthrough!
Problem 1 (30 pts) a) Circle the radical that is most stable. b) Order the compounds in terms of increasing oxidation state (1 highest, 3- lowest) он c) The reaction below is an example of.... heat 2 b) substitution a) addition d) heterolytic cleavage c) homolytic cleavage d) Circle the compound with the most acidic protons. H H c=C CHз CH3CH2CH3 Нас-СЕС-н H
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago