Homework Answers
Add Answer to:
17. From the following heats of reaction, 2C (graphite) + H2 (g) → C2H2 (g) AH...
From the following heats of reaction, 2C (graphite) + H2(g) → CH) 6C (graphite) + 3H2(g)...
From the following heats of reaction, 2C (graphite) + H2(g) → CH) 6C (graphite) + 3H2(g) + CH) AH - 227 kJ/mole AH-49 kJ/mole calculate the heat for the reaction 3C2H2(g) →CH (1) -178 kl/mole 632 kJ/mole -632 kJ/mole 178 kJ/mole « Previous
Given the following data for heats of reaction N2(g) + 3H2(g) ----> 2NH3(g) H = -91.8 kJ...
Given the following data for heats of reaction
N2(g) + 3H2(g) ---->
2NH3(g) H
= -91.8 kJ
C(graphite) + 2H2(g) ------->
CH4(g)H
= -74.9kJ
H2(g) + 2C(graphite) + N2(g)
--------> 2HCN(g) H
= 270.3 kJ
Calculate
H for the reaction used to make HCN
CH4(g) + NH3(g) --------> HCN(g) +
3H2(g)
Find AHrxn for: C2H2(g) → 2C(s) + H2(g) given the following information: C2H2(g) + 5/2 O2(g)...
Find AHrxn for: C2H2(g) → 2C(s) + H2(g) given the following information: C2H2(g) + 5/2 O2(g) → 2002(g) + H2O (1) AH° = -1291 kJ C(s) + O2(g) + CO2(g) AH° = -391 kJ H2(g) + 1/2O2(g) + H2O(1) AH° = -280 kJ kJ
81. Given the following data Ca(s) + 2C(graphite) → CaC2(s) AH-62.8 kJ Ca(s) + cao(s) +...
81. Given the following data Ca(s) + 2C(graphite) → CaC2(s) AH-62.8 kJ Ca(s) + cao(s) + H2O(l)-→ Ca(OH)2(aq) C2H2(g) +022CO2(8)+ H200) 2(g)-→ CaO(s) ΔH =-635.5 kJ ΔH =-653.1 kJ C(graphite) + 02(g)-→ CO2(g) ΔH =-393.5 kJ calculate ΔH for the reaction CaC2(s) + 2H20() → Ca(OH)2(aq) + C2H2(g)
From the following data, C(graphite) + O2(g) → CO2(g) AHrxn = -393.5 kJ/mol H2(g) + O2(g)...
From the following data, C(graphite) + O2(g) → CO2(g) AHrxn = -393.5 kJ/mol H2(g) + O2(g) → H200) AH"rxn = -285.8 kJ/mol 2C2H6(g) + 702(g) -> 4CO2(g) + 6H2O(l) Arxn=-3119.6 kJ/mol Calculate the enthalpy change for the reaction: 2 C(graphite) + 3H2(g) + C2H668)
Calculate the value of AH° for the reaction 2 C2H2 () + 502 () 4002) + 2 H20 (1) given the following thermochemical...
Calculate the value of AH° for the reaction 2 C2H2 () + 502 () 4002) + 2 H20 (1) given the following thermochemical equations: AH° = - 242 kJ AH° = - 394 kJ H2(g) + 4202) → H20 (8) C(s) + O2(%) + CO2(8) 2 C(s) + H2(g) → C2H2 (6) H20 () → H30Ⓡ AH° = +227 kJ AH° = +44 kJ TO - 907 kJ 0 - 2602 kJ 0 - 2514 kJ - 1694 kJ
Hess's Law Given the following data: C2H2(g) + 5/202(9) + 2002/9) + H20(1) AH' = -1300.0...
Hess's Law Given the following data: C2H2(g) + 5/202(9) + 2002/9) + H20(1) AH' = -1300.0 kJ CO2(g) + C(s) + O2(g) AH° = 393.5 kJ 2C(s) + H2(g) C2H2(g) AH° = 227.0 kJ Calculate AH for the reaction H2(g) + 1/202(9) — H20(1) Submit Answer Tries 0/5
For the reaction 2C(s) + H2(g) + C2H2(g); AG° = 209.2 kJ/mol at 25 °C. If...
For the reaction 2C(s) + H2(g) + C2H2(g); AG° = 209.2 kJ/mol at 25 °C. If the initial conditions of the reaction are: P(H2) = 128 atm and P(C2H2) = 0.0023 atm, determine the value of AG for the reaction.
a Using the heats of formation below, calculate the heat of reaction for the following reaction:...
a Using the heats of formation below, calculate the heat of reaction for the following reaction: C2H2(g) + 5/202(2)→ 2C02() +H20() AH® (kJ/mol) C2H2(g) 226.7 O2(g) 0 CO2(g) -393.5 H20(-285.8 kJ Submit b Using the heats of formation below. calculate the heat of reaction for the following reaction: PC13(2) + Cl2(2)→ PC15(e) AH(kJ/mol) PC13(g) -306.4 Cl2(E) 0 PC1s() -398.9
loab beboo 2CO2 + H2O. 7. Calculate AH for C2H2 +5/202 Given C(s) +O2(g) CO2(g) AH...
loab beboo 2CO2 + H2O. 7. Calculate AH for C2H2 +5/202 Given C(s) +O2(g) CO2(g) AH = -393.5 kJ H2+½ O2 H2O AH= -285.8 kJ 2C+H2 C2H2 AH = 226.8 kJ 008700000 08.0 Lon Qoe cOeEo.O60
From the following heats of reaction, 2C (graphite) + H2(g) → CH) 6C (graphite) + 3H2(g) + CH) AH - 227 kJ/mole AH-49 kJ/mole calculate the heat for the reaction 3C2H2(g) →CH (1) -178 kl/mole 632 kJ/mole -632 kJ/mole 178 kJ/mole « Previous
Given the following data for heats of reaction
N2(g) + 3H2(g) ---->
2NH3(g) H
= -91.8 kJ
C(graphite) + 2H2(g) ------->
CH4(g)H
= -74.9kJ
H2(g) + 2C(graphite) + N2(g)
--------> 2HCN(g) H
= 270.3 kJ
Calculate
H for the reaction used to make HCN
CH4(g) + NH3(g) --------> HCN(g) +
3H2(g)
Find AHrxn for: C2H2(g) → 2C(s) + H2(g) given the following information: C2H2(g) + 5/2 O2(g) → 2002(g) + H2O (1) AH° = -1291 kJ C(s) + O2(g) + CO2(g) AH° = -391 kJ H2(g) + 1/2O2(g) + H2O(1) AH° = -280 kJ kJ
81. Given the following data Ca(s) + 2C(graphite) → CaC2(s) AH-62.8 kJ Ca(s) + cao(s) + H2O(l)-→ Ca(OH)2(aq) C2H2(g) +022CO2(8)+ H200) 2(g)-→ CaO(s) ΔH =-635.5 kJ ΔH =-653.1 kJ C(graphite) + 02(g)-→ CO2(g) ΔH =-393.5 kJ calculate ΔH for the reaction CaC2(s) + 2H20() → Ca(OH)2(aq) + C2H2(g)
From the following data, C(graphite) + O2(g) → CO2(g) AHrxn = -393.5 kJ/mol H2(g) + O2(g) → H200) AH"rxn = -285.8 kJ/mol 2C2H6(g) + 702(g) -> 4CO2(g) + 6H2O(l) Arxn=-3119.6 kJ/mol Calculate the enthalpy change for the reaction: 2 C(graphite) + 3H2(g) + C2H668)
Calculate the value of AH° for the reaction 2 C2H2 () + 502 () 4002) + 2 H20 (1) given the following thermochemical equations: AH° = - 242 kJ AH° = - 394 kJ H2(g) + 4202) → H20 (8) C(s) + O2(%) + CO2(8) 2 C(s) + H2(g) → C2H2 (6) H20 () → H30Ⓡ AH° = +227 kJ AH° = +44 kJ TO - 907 kJ 0 - 2602 kJ 0 - 2514 kJ - 1694 kJ
Hess's Law Given the following data: C2H2(g) + 5/202(9) + 2002/9) + H20(1) AH' = -1300.0 kJ CO2(g) + C(s) + O2(g) AH° = 393.5 kJ 2C(s) + H2(g) C2H2(g) AH° = 227.0 kJ Calculate AH for the reaction H2(g) + 1/202(9) — H20(1) Submit Answer Tries 0/5
For the reaction 2C(s) + H2(g) + C2H2(g); AG° = 209.2 kJ/mol at 25 °C. If the initial conditions of the reaction are: P(H2) = 128 atm and P(C2H2) = 0.0023 atm, determine the value of AG for the reaction.
a Using the heats of formation below, calculate the heat of reaction for the following reaction: C2H2(g) + 5/202(2)→ 2C02() +H20() AH® (kJ/mol) C2H2(g) 226.7 O2(g) 0 CO2(g) -393.5 H20(-285.8 kJ Submit b Using the heats of formation below. calculate the heat of reaction for the following reaction: PC13(2) + Cl2(2)→ PC15(e) AH(kJ/mol) PC13(g) -306.4 Cl2(E) 0 PC1s() -398.9
loab beboo 2CO2 + H2O. 7. Calculate AH for C2H2 +5/202 Given C(s) +O2(g) CO2(g) AH = -393.5 kJ H2+½ O2 H2O AH= -285.8 kJ 2C+H2 C2H2 AH = 226.8 kJ 008700000 08.0 Lon Qoe cOeEo.O60
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago