Can you please explain how to solve only 7.62 and 7.64? As well
as 6.28 a and b. 
Homework Answers
Add Answer to:
Can you please explain how to solve only 7.62 and 7.64? As well
as 6.28 a...
Provide an explanation (with drawings) why the reaction on the below yields the Hofmann product exclusively...
Provide an explanation (with drawings) why the reaction on the below yields the Hofmann product exclusively (no Zaitsev product at all) even though the base is not sterically hindered (bulky). Br NaOET in ELOH Predict the possible products of the following reactions and identify which product(s) will be the major product(s). You will need to evaluate to what extent substitution and elimination reactions occur. Pay close attention to stereochemistry when necessary. Br НО NatOEt (a) BuOK Na Ome (b) aa...
need help with these practice problems please :) if can help with all would greatly appreciate....
need help with these practice problems please :) if can help with
all would greatly appreciate.
A. Predict how reaction conditions (substrate, nucleophile, leaving group, solvent) effect the rate of Swi and S2 reactions. Circle the faster substitution reaction among the following pairs. If the rate is not affected, circle both OH OH in acetone ta NaBr DMSO in H2O NaBr CH, OH V CI Br- na ro ChOH CHCI Bra CHCI ? © CN acetone CI- in H20 in...
3. Given what you now know, what product(s) would you expect to isolate from this reaction?...
3. Given what you now know, what product(s) would you expect to isolate from this reaction? • Ngô – Br (NaOt-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. Identify the major product for each. Y ahoo Br NaOCH heat
Please answer all 3 and explain if you can! Thank you!! *This one isn't option 2...
Please answer all 3 and explain if you can! Thank you!!
*This one isn't option 2 or 4*
Draw the major organic products of the following reaction. Include lone pairs of electrons and stereochemistry 1.CH,MgBr, Et,o 2. H,O What is the major product in the following series of reactions? 1) 03 then DMS 2) LiAIH4 (excess) then H20 3) NaH (1 equiv.) 4) TsCl (1 equiv.) 5) NaOH (dilute) Products OTS a) b) HO HO OTS он OH c) d)...
please help asap in all sections!! Question 5 Methyl 4-methylpentanoate is one of 120 volatile compournds...
please help asap in all sections!!
Question 5 Methyl 4-methylpentanoate is one of 120 volatile compournds identified in a study of metabolites from Streptomyces bacteria (Actinomycetologica 2009, 23, 27-33) Mathy 4-methylpentanoate The synthesis of Methyl 4-methylpentanoate using 2-methylbutane involves several steps. Part-1 of the reaction scheme (2-methylbutane to 3-methyl-1-butene) is illustrated below. Identity the reagent involved in each step and arange them accordingly Br A by NaOH; Os and H20; HBr/ROOR; NaOEt/EtOH NaOH; O and HyO; NaDE/EROH; HBr/RDOR Br: NaOE/EOH;...
Can you explain these 2 especially how you will know the leaving groups... please only answer...
Can you explain these 2 especially how you will know the leaving
groups... please only answer if you know the correct answer. I will
rate
3. Predict the major product for the following elimination reaction. Make sure that you draw any relevant Newman projections (looking down the C3-C4 bond) to support your answer. КО-Bu Hас" ён, t-BuOH 1 Draw a dibromide with molecular formula Ci4H12Br2 that would give exclusively the following alkene 4. under E2 reaction conditions. Use wedges and/or...
can questions 7.74 A and B be answered please and question 7.75. numbered questions please 7.74...
can questions 7.74 A and B be answered please and question
7.75. numbered questions please
7.74 (9)-1-Bromo-1,2-diphenylethane reacts with a strong base to produce cis-stilbene and trans-stilbene: Br NaOET cis-Stilbene trans-Stilbene (major product) (a) This reaction is stereoselective, and the major product is trans- stilbene. Explain why the trans isomer is the predominant product. To do so, draw the Newman projections that lead to formation of each product and compare their stability. (b) When (R)-1-bromo-1,2-diphenylethane is used as the starting...
3. Given what you now know, what product(s) would you expect to isolate from this reaction?...
3. Given what you now know, what product(s) would you expect to isolate from this reaction? Y +Na + Nao + - Br (NaOf-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. major product for each. heat Br NaOCH3 heat
please explain the work 1. Predict the major organic product for each of the following elimination...
please explain the work
1. Predict the major organic product for each of the following elimination reactions, and indicate whether each one occurs via the E1 or the E2 mechanism. Be sure to clearly indicate the proper stereochemical relationships between groups (if appropriate), and write the word "racemic" under any compound that is formed as a racemic mixture. Br H3CY CH3 NaOCH3. CH3OH OH يلي H2SO4 ما H3c OTS KOt-Bu t-BuOH AgNO3 H20 Ph HC, NaOH H2O OH H2SO4
1. Consider the SN2 reaction shown below and answer the following questions.nobl 8 acetone no t...
1. Consider the SN2 reaction shown below and answer the following questions.nobl 8 acetone no t iNaSCH SCH, + NaBr worl s1918. A. Write the rate law for the reaction. ebiler vil ar to nollurunoonoo oli nison. B. Identify the nucleophile and the electrophile in the reaction. HOCH lo noiden nog orgnismanl.d C. State how each of the following factors would affect the rate of the reaction. CHOW CHOOH glasa a. Increasing the concentration of 1-bromopropane. b. Decreasing the concentration...
Provide an explanation (with drawings) why the reaction on the below yields the Hofmann product exclusively (no Zaitsev product at all) even though the base is not sterically hindered (bulky). Br NaOET in ELOH Predict the possible products of the following reactions and identify which product(s) will be the major product(s). You will need to evaluate to what extent substitution and elimination reactions occur. Pay close attention to stereochemistry when necessary. Br НО NatOEt (a) BuOK Na Ome (b) aa...
need help with these practice problems please :) if can help with
all would greatly appreciate.
A. Predict how reaction conditions (substrate, nucleophile, leaving group, solvent) effect the rate of Swi and S2 reactions. Circle the faster substitution reaction among the following pairs. If the rate is not affected, circle both OH OH in acetone ta NaBr DMSO in H2O NaBr CH, OH V CI Br- na ro ChOH CHCI Bra CHCI ? © CN acetone CI- in H20 in...
3. Given what you now know, what product(s) would you expect to isolate from this reaction? • Ngô – Br (NaOt-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. Identify the major product for each. Y ahoo Br NaOCH heat
Please answer all 3 and explain if you can! Thank you!!
*This one isn't option 2 or 4*
Draw the major organic products of the following reaction. Include lone pairs of electrons and stereochemistry 1.CH,MgBr, Et,o 2. H,O What is the major product in the following series of reactions? 1) 03 then DMS 2) LiAIH4 (excess) then H20 3) NaH (1 equiv.) 4) TsCl (1 equiv.) 5) NaOH (dilute) Products OTS a) b) HO HO OTS он OH c) d)...
please help asap in all sections!!
Question 5 Methyl 4-methylpentanoate is one of 120 volatile compournds identified in a study of metabolites from Streptomyces bacteria (Actinomycetologica 2009, 23, 27-33) Mathy 4-methylpentanoate The synthesis of Methyl 4-methylpentanoate using 2-methylbutane involves several steps. Part-1 of the reaction scheme (2-methylbutane to 3-methyl-1-butene) is illustrated below. Identity the reagent involved in each step and arange them accordingly Br A by NaOH; Os and H20; HBr/ROOR; NaOEt/EtOH NaOH; O and HyO; NaDE/EROH; HBr/RDOR Br: NaOE/EOH;...
Can you explain these 2 especially how you will know the leaving
groups... please only answer if you know the correct answer. I will
rate
3. Predict the major product for the following elimination reaction. Make sure that you draw any relevant Newman projections (looking down the C3-C4 bond) to support your answer. КО-Bu Hас" ён, t-BuOH 1 Draw a dibromide with molecular formula Ci4H12Br2 that would give exclusively the following alkene 4. under E2 reaction conditions. Use wedges and/or...
can questions 7.74 A and B be answered please and question
7.75. numbered questions please
7.74 (9)-1-Bromo-1,2-diphenylethane reacts with a strong base to produce cis-stilbene and trans-stilbene: Br NaOET cis-Stilbene trans-Stilbene (major product) (a) This reaction is stereoselective, and the major product is trans- stilbene. Explain why the trans isomer is the predominant product. To do so, draw the Newman projections that lead to formation of each product and compare their stability. (b) When (R)-1-bromo-1,2-diphenylethane is used as the starting...
3. Given what you now know, what product(s) would you expect to isolate from this reaction? Y +Na + Nao + - Br (NaOf-Bu) Specify how each of the following would affect the rate of the reaction. a. Increase the concentration of the base. b. Decreasing the concentration of alkyl halide. 3. Predict the product(s) for each of the E2 elimination reactions below. major product for each. heat Br NaOCH3 heat
please explain the work
1. Predict the major organic product for each of the following elimination reactions, and indicate whether each one occurs via the E1 or the E2 mechanism. Be sure to clearly indicate the proper stereochemical relationships between groups (if appropriate), and write the word "racemic" under any compound that is formed as a racemic mixture. Br H3CY CH3 NaOCH3. CH3OH OH يلي H2SO4 ما H3c OTS KOt-Bu t-BuOH AgNO3 H20 Ph HC, NaOH H2O OH H2SO4
1. Consider the SN2 reaction shown below and answer the following questions.nobl 8 acetone no t iNaSCH SCH, + NaBr worl s1918. A. Write the rate law for the reaction. ebiler vil ar to nollurunoonoo oli nison. B. Identify the nucleophile and the electrophile in the reaction. HOCH lo noiden nog orgnismanl.d C. State how each of the following factors would affect the rate of the reaction. CHOW CHOOH glasa a. Increasing the concentration of 1-bromopropane. b. Decreasing the concentration...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 3 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 53 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago