Which of the following statements is TRUE about how enzyme’s achieve rate enhancement for a chemical...
Homework Answers
Add Answer to:
Which of the following statements is TRUE about how enzyme’s
achieve rate enhancement for a chemical...
8. Indicate whether the following statements are true or false: a. If the free energy,AG,ofareaction is...
8. Indicate whether the following statements are true or false: a. If the free energy,AG,ofareaction is negative, then the entropy,AS,must be positive b. Anendergonicreactionisone forwhichAGispositive. c. Increasing the temperature usually increases the rate of a chemical reaction because it increases rate of movement of molecules d. A reaction that releases heat (ΔH) is termed exothermic, while a reaction that releases free energy, Δ G, is termed exergonic e. The transition state of a reaction is always at a higher (unfavorable)...
BIOCHEMISTRY please answers the both questions Q1: Which of the following statements about enzymes are true?...
BIOCHEMISTRY please answers the both questions Q1: Which of the following statements about enzymes are true? (Check all that apply) A) Enzymes affect the activation energy of the reaction. b) Enzymes affect the equilibrium position of a chemical reaction. c) Enzymes affect the Gibbs Free Energy change of a chemical reaction. d) Enzymes decrease the time needed for a reaction to reach equilibrium. Q2: What best describes the nature of the active site. a) It is a rigid pocket that...
Which of the following enhance reaction rate? Which of the following statements on the strategies enzymes...
Which of the following enhance reaction rate?
Which of the following statements on the strategies enzymes employ to enhance the rate of a reaction are true? Enzymes may cause the substrate to transiently become more protonated or deprotonated than normally. Enzymes may change the equilibrium of the reaction transiently. Enzymes may improve the likelihood that two substrates encounter each other in the necessary direction. Enzymes may form a transient covalent bond with the substrate. Enzymes may cause the pH to...
Which of the following statements is true about chemical equilibrium? Select all that apply. At chemical...
Which of the following statements is true about chemical equilibrium? Select all that apply. At chemical equilibrium, the reactants have been completely consumed. At chemical equilibrium, both reactions stop completely. At chemical equilibrium, the concentrations of the species involved in the reaction stay constant (in the absence of an external perturbation). At chemical equilibrium the rate of the forward reaction is equal to the rate of the reverse reaction.
9. Which of the following statements about enzyme catalyzed reactions is NOT true? a. Enzymes form...
9. Which of the following statements about enzyme catalyzed reactions is NOT true? a. Enzymes form complexes with their substrates b. Enzymes lower the activation energy for chemical reactions c. Enzymes change the Key for chemical reactions d. Many enzymes change shapes slightly when substrate binds 10. To overcome an energy barrier between reactants and products, energy must be provided to get the reaction started. This energy, which is recovered as the reaction proceeds, is called: a. Activation energy b....
Identify correct statements pertaining to reaction energies. Group of answer choices The rate of a reaction...
Identify correct statements pertaining to reaction energies. Group of answer choices The rate of a reaction depends on the energy change between reactants and products. If Keq < 1, the equilibrium will favor the reactants. If ∆G° < 0, Keq will be greater than 1. The reaction step with the highest energy transition state is called the rate determining step.
QUESTION 5 Which of the following statements about a catalyst is true? O Catalysts increase the...
QUESTION 5 Which of the following statements about a catalyst is true? O Catalysts increase the rate of the reaction. Catalysts cause a system at equilibrium to shift towards the reactants. o Catalysts cause a system at equilibrium to shift towards the products. Catalysts increase the activation energy of a reaction. Catalysts decrease the rate of the reaction.
29 (6 pts) How do concentration of reactants, temperature and catalysts affect the rate of a chemical reaction? Exp...
29 (6 pts) How do concentration of reactants, temperature and catalysts affect the rate of a chemical reaction? Explain. Concentration of reactants: mcreases more collisions within the reactants. collisions Temperature: Increase in temperature causes increase in more and more energy in collisions. (increases rate? Catalyst: Lowens energy of activation of reactants cate? (increases rutes
Question 2 Which of the following statements is true concerning the rate of a chemical reaction?...
Question 2 Which of the following statements is true concerning the rate of a chemical reaction? The initial rate is higher than the final rate The rate of reactant use and product synthesis are equal The rate of reactant usage remains constant The rate of product synthesis increases with time
Which of the following statements is TRUE?
Which of the following statements is TRUE? ● The rate constant is constant only when the temperature remains constant. ● The rate constant does not depend on the temperature. ● The rate constant is always equal to one at room temperature. ● A decrease in temperature will increase the rate constant. ● An increase in temperature will decrease the rate constant.
8. Indicate whether the following statements are true or false: a. If the free energy,AG,ofareaction is negative, then the entropy,AS,must be positive b. Anendergonicreactionisone forwhichAGispositive. c. Increasing the temperature usually increases the rate of a chemical reaction because it increases rate of movement of molecules d. A reaction that releases heat (ΔH) is termed exothermic, while a reaction that releases free energy, Δ G, is termed exergonic e. The transition state of a reaction is always at a higher (unfavorable)...
Which of the following enhance reaction rate?
Which of the following statements on the strategies enzymes employ to enhance the rate of a reaction are true? Enzymes may cause the substrate to transiently become more protonated or deprotonated than normally. Enzymes may change the equilibrium of the reaction transiently. Enzymes may improve the likelihood that two substrates encounter each other in the necessary direction. Enzymes may form a transient covalent bond with the substrate. Enzymes may cause the pH to...
9. Which of the following statements about enzyme catalyzed reactions is NOT true? a. Enzymes form complexes with their substrates b. Enzymes lower the activation energy for chemical reactions c. Enzymes change the Key for chemical reactions d. Many enzymes change shapes slightly when substrate binds 10. To overcome an energy barrier between reactants and products, energy must be provided to get the reaction started. This energy, which is recovered as the reaction proceeds, is called: a. Activation energy b....
QUESTION 5 Which of the following statements about a catalyst is true? O Catalysts increase the rate of the reaction. Catalysts cause a system at equilibrium to shift towards the reactants. o Catalysts cause a system at equilibrium to shift towards the products. Catalysts increase the activation energy of a reaction. Catalysts decrease the rate of the reaction.
29 (6 pts) How do concentration of reactants, temperature and catalysts affect the rate of a chemical reaction? Explain. Concentration of reactants: mcreases more collisions within the reactants. collisions Temperature: Increase in temperature causes increase in more and more energy in collisions. (increases rate? Catalyst: Lowens energy of activation of reactants cate? (increases rutes
Question 2 Which of the following statements is true concerning the rate of a chemical reaction? The initial rate is higher than the final rate The rate of reactant use and product synthesis are equal The rate of reactant usage remains constant The rate of product synthesis increases with time
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 3 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 34 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago