19. Provide the starting material for the following reaction: 1. 03.(-78 °C) 2. (CH3) CH3-C-CH:--CH2-CH2-C-CH2-CH;
18. What is the expected product of the E2 elimination for the reaction? CH3 CH3 H NaOCH3 k Br 19. Provide the starting material for the following reaction: 1. 03. (-78 °C) 2.(CH3) CH;---2-CH2-CH-CH2-C-CH2-CHz
answer the problem show work thanks CH3 H2O + 1. H-C-CH-CH-CH2 CH3 CH C 2, CHy-CH2-CH-CHOHPCC 25°C 50-55°C + HNO H2SO4 он H2CrO4 CH,CHCH acetone, 35°c Et O 2150113H20 5. CH3(CH2)2MgBr+ CH3(CH2)sC(CH2)sCH3 Nall CH2-CHCH2l H2SO4 140°C 6. CH3CH2CH2OH 7. CHCH CHOH 1) LiAIH(O-t-Bu)3,-78°C 2) H20 8. CH,C-CI HBr 9. CH2 CH-CH-CH2 40°C 10. H3C CIH2 Benzene 100℃ H3C 1. LiAIH/Et2O 11. CH,CH2CH,COH 2. H,0 12. + CH,CH,cCI AIC Benzene, 80°C 13. Br2 heat CH3 AlcI 15. 25°C conc. H2SO4 NaBH4...
Provide configuration (R or S) of the following compounds. CH, CH2 ¢-CH: CH-CH2-C-CH3 CH CH2 - CH(CH3) OSRR S.S.S O R.S.R Ooo O S.SR ORRR
name the compounds b. CH3 CH3-CH2-CH-CH-CECH CH2-CH3 CH3 CH=C-C-CH3 CH2-CH2-CH3 1 CH3 - CH2 - CH = CH-CH3
Part A The product of this reaction is CH2-0-C-(CH2)7-CH=CH-(CH2)2-CHz Ni, CH-0C-(CH3)3-CH=CH-(CHỊ)-CH, + 3H, 10 CH2-0-C-(CH2)-CH=CH-(CH2)-CH glyceryl trioleate. e glyceryl tristearate. glyceryl tripalmitate glyceryl tricaprate. Submit Request Answer Provide Feedback
What is the correct product for the following addition reaction: CH3-C=CH2 + Brz CH₃ Br-CH2-CH-CH -Br CH; Br Br CH3-C=C
What is the major product of the following reaction? CH -CH₂-C- CH2-C-CH3 + KOH Br alcohol heat ? сні -CH2-C-CH OH IV. I CH3 -CH-CACH OHH CHE -CH=C-CH3 сн -CH2-C=CH2 II. V. CH3 -CH2-CH-CH2OH TIL A) B) 11 OC) IV D) v
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH 20 CH3-CH2-CH-CH CH,CH,COOH Ovo 17. What is the product of oxidation of butanal? 1-butanol D butanoic acid C. 2-butanol d. 2-butanal e. dibutylether 18). O CE, H-C-O - CHCH, is called: methyl isopropyl ester methyl isopropyl ether methylethyl ethanoate isopropyl formate 19. Reaction of CH3-CH-CH2-COOH with CH-CH,OH produces: a. butyl ethanoate ethyl butanoate ethyl propanoate d. propyl butanoate acetyl butanoate
Which of the following can exist in enantiomers? a. b. CH3 CH3-CH;-CH2-C-CH; CH3-CH2-CEC-CH, C. d. all of these choices CH3-CH-C-CHE -8-сон, CH,-8-3-CH, спесне: -он, 10. What type of compound is the second product in the reaction shown below? CH-0-2-CH, OCH & CHOCH, H,CH, +3 NaOH + CH-OH + CH-OH CH -0-C-(CH2)16CH, a, fatty acid salt b. ester CH-OH c. alcohol d. fatty acid
Part 1 Provide the name for the following compound. CH3-CH-NH-CH2-CH2-CH2-CH3 CH3 Spell out the full name of the compound. 2-methyl-2-hexanamine Submit Previous Answers Request Answer X Incorrect; Try Again; One attempt remaining