What is the name of this compound? CH3N-CH2CH3 CH3 o trimethylamine 2. Ф O diethylamine o...
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
Give the IUPAC name for the following compound
H H₃G CH3 도 H CH2CH3 CH(CH3)2 I
Please Help!!
QUESTION 1 What is the IUPAC name for this compound? CH3 CH3CH2 QUESTION 2 What is the IUPAC name for this compound? CH2CH3 QUESTION 3 What is the IUPAC name for this compound? снэ HE
12. What is the correct IUPAC name of the following compound? CH2CH3 CH3 B. cis-1-ethyl-2-methylcyclohexane trans-1-ethyl-2-methylcyclohexane cis-1-ethyl-6-methylcyclohexane trans-1-ethyl-6-methylcyclohexane
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
What is the IUPAC name for CH3CH2CHC(CH3)CH2CH3 isopentene 3-methyl-2-pentene O 3-methyl-3-hexene 2-methyl-3-hexene O 1,1-dimethyl-2-hexene
Question 12 2 pts What is the name of the compound below? CH3 Br O o-bromotoluene O o-bromophenol o-bromoxylene
Give the IUPAC name for each compound
11.39 Give the IUPAC name for each compound. CH3 CH3 (CH3CH2)2C-CHCHCH2CHCH b. CH2 CCH2CH3 CH2CH2CH2CH2CH3 CH3 CH3 с. Cн,сс-Сн,— СH—С—сH,CH, CH2CH3