Here is the Solution:
Thanks! :)
DATE: b) Decomposition reaction is the opposite of combination reaction (True/ False) Formation of a precipitate,...
- Part A Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction: Sort these reactions into the proper categories. CuO(s) + 2HCl(aq) → CuCl2(aq) + H2O(l) C6H12O6(aq) + 2C2H6O(aq) + 2CO2(g) Fe3O4(s) + 4C(s) + 3Fe(s) + 4CO(g) 2C2H2(g) + 502 (9) 4 4C02(g) + 2H2O(g) 2Fe(s) + 3Cl2(g) + 2FeCl3(s) Combination Decomposition Single replacement Double replacement Combustion
Classify each reaction as either a combination, decomposition, single-displacement, double-displacement, or combustion reaction. a.) [Select] 3CO2(g) C3H2(g) + 5O2(g) + 4H2O(1) [ Select) b.) Cus(s) + Na2SO4(aq) CuSO4(aq) + Na2S(aq)
Part A Classily each of the following as a combination, decomposition, single replacement, double roplacement, or combustion reaction. Sort these reactions into the proper categories. Reset Help 2C,H,(9) +50,(9) 400(g) + 2H2O() BaCl(aq) + KCO,(aq) Pb(8) + O2(9) - BaCO3() + 2Cl(aq)| -P50,() 2Cu(NO3), 2CuO() + 4NO,(0) +0,0) Bra (9) + Bal(s) BaBr (8)+1(9) combustion combination double replacement decomposition single replacement Submit Request Answer Provide Feedback
Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion reaction: Part A 4Fe(s)+3O2(g)→2Fe2O3(s) combination, decomposition, single replacement, double replacement, or combustion Part B 2Al(s)+3CuCl2(aq)→2AlCl3(aq)+3Cu(s) combination decomposition single replacement double replacement combustion Part C ZnCO3(s)⟶ΔCO2(g)+ZnO(s) combination decomposition single replacement double replacement combustion Part D CuCl2(aq)+2KOH(aq)→Cu(OH)2(s)+2KCl(aq) combination decomposition single replacement double replacement combustion Part E C3H8(g)+5O2(g)⟶Δ3CO2(g)+4H2O(g) combination decomposition single replacement double replacement combustion
5. Identify the following 4 reaction equations as decomposition, combustion, double displacement, combination, or single displacement. (4pts) a) Fe2O3(s) + 2Al(s) - 2Fe(s) + Al2O3(s) b) 2H20(1) → 2H2(g) + O2(g) c) C3H3(g) + 502(g) → 3C02(g) + 4H2O(g) d) LiOH(aq) + HNO3(aq) → LINO3(aq) + H2O(1)
Your Name Extra credit of example is 1. The following reaction: Mg+FeO- Mgo+Fe. a) combination. b) decomposition. c) single-displacement. d) double-displacement. an example of 2. The following reaction: NaOH + HC1+ NaC1+ HO. a) combination. b) decomposition. c) single-displacement. d) double-displacement. 3. The following reaction: NaCOs + CaCh 2Nacl+ a) combination. b) decomposition. c) single-displacement. d) double-displacement. 4. The following reaction: F2 + 2KBr-> 2KF + Bra, is an example o a) combination. b) decomposition. c) single-displacement. d) double-displacement. 5....
2. Classify each of the following reactions as precipitation, gas forming, redox, acid/base, combination, decomposition, double displacement or single displacement. Each reaction will have at least two classifications. a. Zn(s) + CuSO4(aq) → ZnSO4(aq) + Cu(s) b. H2SO3(aq) → SO2(g) + H2O(1) C. N2(g) + H2(g) → NH3(g) d. AgNO3(aq) + NaCl(aq) → AgCl(s) + NaNO3(aq) ii. e. HCl(aq) + Ba(OH)2(aq) + H2O(l) + BaCl2(aq)
15) 15) What type of reaction is the generic equation AB+CD-AD+CB? A) synthesis/combination B) decomposition C) single displacement D) double-displacement E) none of the above 16) 16) Identify the double displacement reactions among the following: 1. KCl(aq) + AgNO3(aq) - AgCl(s) + KNO3(aq) 2. Na2SO4(aq) + BaCl2(aq) →BaSO4(s) + 2NaCl(aq) 3. H2SO4((aq) + 2NaOH(aq) Na2SO4((aq) + 2H2O(1) A) 1 and 3 only B) 2 and 3 only C) 1 and 2 only D) All of 1, 2, and 3 E)...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
Classify each of the following redox reaction as a combination, decomposition, or displacement reaction. Give a blanaced molecular equation for each, as well as total and net ionic equations for parts (b) and (c), and identify the oxidizing and reducing agents. A) S8(s)+F2(g)=SF4 Reaction? Molecular Equation- ? Reducing agent-? Oxidizing agent-? B)Fe(s)+HCl(aq)=FeCl3(aq)+H2(g) Reaction-? Molecular Formula-? Reducing agent-? Oxidizing agent-? Total Ionic Equation-? Total Net Equation-? C) Cu(s)+AgNO3(aq)=Cu(No3)2(aq)+Ag(s) Reaction-? Molecular Formula-? Reducing agent-? Oxidizing agent-? Total Ionic Equation-? Total Net Equation-?