In the US there is an increase in the prevalence of cardiovascular diseases. This is a...
In the US there is an increase in the prevalence of cardiovascular diseases. This is a consequence of?
1. Deterioration of the food pattern?
2. Increase in hypertension?
3. Improved treatment?
4. Increase in Obesity?
Homework Answers
Ans: Increase in hypetension
In US hypertension is most common condition increases risk for heart disease and stroke,two of the leading cause of death for Americans.About 1in every 4 adults have high blood pressure.
High blood pressure is called as silent killer because it often has no warning signs or symptoms and many people do not know they have it.Hypertension causes the heart to work harder than normal which eventually leads to an enlarged and weakened heart.
Add Answer to:
In the US there is an increase in the prevalence of
cardiovascular diseases. This is a...
blockers (sometimes written B-blockers), a class of drugs used primarily in cardiovascular diseases, Introduced in 1976,...
blockers (sometimes written B-blockers), a class of drugs used primarily in cardiovascular diseases, Introduced in 1976, atenolol was developed as a replacement for propranolol in the treatment of hypert atenolol was developed as a replacement for propranolol in the treatment of hypertension. a) Circle and identify the functional groups in atenolol b) How many stereocenters are in atenolol? 1 NH он 11) (5 points) Cirele and identify the functional groups in the compound below OCH2CH3
The data indicate that 10.5% of people with a Cardiovascular Disease who were diagnosed with COVID-19...
The data indicate that 10.5% of people with a Cardiovascular Disease who were diagnosed with COVID-19 died. The data also indicate that this percentage for Diabetes is 7.3%, for Chronic Respiratory Disease is 6.3%, Hypertension is 6%, Cancer is 5.6% and No health conditions is 0.9%. Of patients in a certain COVID-19 treatment center, 35% have cardiovascular diseases, 15% have diabetes, 20% have chronic respiratory diseases, 15% have hypertension, 4% have cancer and the other 11% have no health conditions....
The data indicate that 10.5% of people with a Cardiovascular Disease who were diagnosed with COVID-19...
The data indicate that 10.5% of people with a Cardiovascular Disease who were diagnosed with COVID-19 died. The data also indicate that this percentage for Diabetes is 7.3%, for Chronic Respiratory Disease is 6.3%, Hypertension is 6%, Cancer is 5.6% and No health conditions is 0.9%. Of patients in a certain COVID-19 treatment center, 35% have cardiovascular diseases, 15% have diabetes, 20% have chronic respiratory diseases, 15% have hypertension, 4% have cancer and the other 11% have no health conditions....
cardiovascular chart Create a table of the following Cardiovascular and Systemic Diseases: 1. Malaria 2. Tularemia...
cardiovascular chart
Create a table of the following Cardiovascular and Systemic Diseases: 1. Malaria 2. Tularemia 3. Plague 4. Lyme disease 5. Cytomegalovirus Disease Create columns as shown below: Name Causative Virulence. of Pathogenesis Sequelae Disease Agent(s) factors
2: Complexities of the Contributors to Obesity K15 of 18 cardiovascular disease, is known as obesity...
2: Complexities of the Contributors to Obesity K15 of 18 cardiovascular disease, is known as obesity food consumption obesity, it is known as a mu sizes, nutrient density, and energy density all faill under the theme of ome ek 5 us Figure 2: Complexities of the Contributors to Obesity 15 of 16 bariatric surgery food consumption adipokines 3. Since a variety of influences, including biological, lifestyle choices, and environmental factors, contribute to obesity, it is known as a 4. Researchers...
A total of 150 participants are selected for a study of risk factors for cardiovascular disease....
A total of 150 participants are selected for a study of risk factors for cardiovascular disease. At baseline (study start), 24 are classified as hypertensive. At 1 year, an additional 12 have developed hypertension, and at 2 years another 8 have developed hypertension. What is the prevalence of hypertension at 2 years in the study?
A total of 150 participants are selected for a study of risk factors for cardiovascular disease....
A total of 150 participants are selected for a study of risk factors for cardiovascular disease. At baseline (study start), 24 are classified as hypertensive. At 1 year, an additional 12 have developed hypertension, and at 2 years another 8 have developed hypertension. What is the prevalence of hypertension at 2 years in the study? What is the 2 year cumulative incidence of hypertensions?
1. Describe in your own words how obesity can increase the risk of diabetes and cardiovascular...
1. Describe in your own words how obesity can increase the risk of diabetes and cardiovascular disease. b. How can diabetes increase the risk of cardiovascular disease? c. How does high blood pressure increase the risk of stroke?
Create a table of the following Cardiovascular and Systemic Diseases: 1. Malaria 2. Tularemia 3. Plague...
Create a table of the following Cardiovascular and Systemic Diseases: 1. Malaria 2. Tularemia 3. Plague 4. Lyme disease 5. Cytomegalovirus Disease Create columns as shown below: Name of Disease Causative Agent(s) Virulence factors Pathogenesis Sequelae
Pleas only step 5 1) Please calculate the point prevalence of hypertension at the end of...
Pleas only step 5
1) Please calculate the point prevalence of hypertension at the end of 2nd year (1 point)? 2) Please calculate the point prevalence of hypertension at the end of 8th year (1 point)? 3) Please calculate the period prevalence of hypertension for the total 8 years(I point)? 4) Please calculate the cumulative incidence of hypertension at the end of 5th year(1 point) 5)Please calculate the incidence density of hypertension for the 8 years period(1 point)?
blockers (sometimes written B-blockers), a class of drugs used primarily in cardiovascular diseases, Introduced in 1976, atenolol was developed as a replacement for propranolol in the treatment of hypert atenolol was developed as a replacement for propranolol in the treatment of hypertension. a) Circle and identify the functional groups in atenolol b) How many stereocenters are in atenolol? 1 NH он 11) (5 points) Cirele and identify the functional groups in the compound below OCH2CH3
cardiovascular chart
Create a table of the following Cardiovascular and Systemic Diseases: 1. Malaria 2. Tularemia 3. Plague 4. Lyme disease 5. Cytomegalovirus Disease Create columns as shown below: Name Causative Virulence. of Pathogenesis Sequelae Disease Agent(s) factors
2: Complexities of the Contributors to Obesity K15 of 18 cardiovascular disease, is known as obesity food consumption obesity, it is known as a mu sizes, nutrient density, and energy density all faill under the theme of ome ek 5 us Figure 2: Complexities of the Contributors to Obesity 15 of 16 bariatric surgery food consumption adipokines 3. Since a variety of influences, including biological, lifestyle choices, and environmental factors, contribute to obesity, it is known as a 4. Researchers...
Create a table of the following Cardiovascular and Systemic Diseases: 1. Malaria 2. Tularemia 3. Plague 4. Lyme disease 5. Cytomegalovirus Disease Create columns as shown below: Name of Disease Causative Agent(s) Virulence factors Pathogenesis Sequelae
Pleas only step 5
1) Please calculate the point prevalence of hypertension at the end of 2nd year (1 point)? 2) Please calculate the point prevalence of hypertension at the end of 8th year (1 point)? 3) Please calculate the period prevalence of hypertension for the total 8 years(I point)? 4) Please calculate the cumulative incidence of hypertension at the end of 5th year(1 point) 5)Please calculate the incidence density of hypertension for the 8 years period(1 point)?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 24 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 55 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago