![19. A First Order reaction is linear in respect to which variables? a. [A) and t b. 1/[A) and t c. InA] and t d. k and t 20.](http://img.homeworklib.com/questions/218beb10-7324-11ea-adc9-d182301c1d7f.png?x-oss-process=image/resize,w_560)
Homework Answers
Add Answer to:
please explain question 22.
why b is the correct choice. show work please.
19. A First...
URGENT please show work and write clearly. Thank you. Use the data above to answer the...
URGENT please show work and write clearly. Thank you.
Use the data above to answer the questions.
The original Absorbance vs. Time graph
Absorbance vs. Time (min) 035 Ln(Absorbance) vs. Time (min) y = 1.174681-0.0733 R'9.990 Absoba Ice I absorbat) Time in Time (MI) 1/Absorbance vs. Time Y 0.62518x1.79428 R'-0.987 12Absotele ad Ln Time Absorbance 1/Absorbance Absorbance 0 0.3397 -1.07969 2.943774 1.5366 0.2806 -1.27083 3.563792 2.6937 0.255 -1.36649 3.921569 3.7872 0.2271 -1.48236 4.403347 5.0772 0.2105 -1.55827 4.750594 6.6 0.1809 -1.70981...
please help with question 22 and 23. showing all work 22. (Apts) A given reaction has...
please help with question 22 and 23. showing all work
22. (Apts) A given reaction has rate constant k =3.45 x 102M'sat T-283K. IFE 145kJ/mol, calculate the value of kyat T-303K. 23. (6pts) Given the following reactions: HOOH + HOI+OH HOI + → Iz + OH 20H+ + 2H30* → 4H:0 a. Are there any intermediates? If so, it is/they are: b. Is there a catalyst? If so, it is: c. Write the equation for the overall reaction. 24. (10pts)...
Please show work and explain: The reaction A + B → C is studied similarly to...
Please show work and explain: The reaction A + B → C is studied similarly to our study of phenolphthalein fading kinetics. The corresponding rate law is Rate = k[A]m[B]m In this particular experiment, the concentration of A is sufficiently high that the pseudo-order rate law: Rate = k1[B]n can be written, where k1 = k[A]m. If the study establishes that the reaction is first order in B (n = 1) and that the pseudo rate constant k1 has the...
QUESTION 10 Given the data below for the reaction, 2 A + 2 B + 4...
QUESTION 10 Given the data below for the reaction, 2 A + 2 B + 4 C-> D + E + 3 F the reaction is order in A, order in B order in C and order overall. USE WORDS TO FILL IN THE BLANKS NOT NUMBERS(i.e., zero, first, second etc) Initial conc of A, ial conc of B, mol/L For Blank 3 Initial conc of C, Initial rate, mol/L.s 0.2 0.3 0.4 mol/L 0.2 0.2 0.4 0.6 mol/L 0.4...
I need the answers in details with explanation thanks in advance! first question: second question: 7)...
I need the answers in details with explanation
thanks in advance!
first question:
second question:
7) The reaction (CH3)3CBr + OH → (CH3)3COH + Br in a certain solvent is first order with respect to (CH3)3CBr and zero order with respect to OH-. In several experiments, the rate constant k was determined at different temperatures. A plot of In(k) versus 1/T was constructed resulting in a straight line with a slope of -1.10 X 104 K and y-intercept of 33.5....
1.) If a random reaction A + B Products is first order with respect to A...
1.) If a random reaction A + B Products is first order with respect to A and second with respect to B, how is the rate impacted when the concentration of A and B are doubled? A) It increases by a factor of 2 B) It increases by a factor of 4 C) It increases by a factor of 8 D) It decreases by a factor of 4 E) Not enough information to determine 2.) You have the following reaction:...
please show all work 1. Consider the following kinetic data, collected at 25.0°C, for the reaction...
please show all work
1. Consider the following kinetic data, collected at 25.0°C, for the reaction 2 NO(g+ Cl2 → 2NOCI Experiment INOJ (M) 0.0300 0.0150 0.0150 ICI (M) 0.0100 0.0100 0.0400 Rate (M/s) 3.4 x 10 8.5 x 10 3.4 x 10 a. What is the reaction order with respect to NO? b. What is the reaction order with respect to CIZ? c. What is the overall reaction order? d. Determine the value of the rate constant, k (round...
can you please show steps for the first question and explain the answers for the other...
can you please show steps for the first question and explain
the answers for the other two questions?
1A. A solution of a 6.0 M solution of a weak acid is 0.16% ionized. What is the K, of the acid? (4 points) 13. Which of the following is a Lewis acid-base reaction? a. CH3Br + CH3Cl → CH3Cl + HBO b. •CH3 + .CI → CH3CI C. NaCl + AgNO3 → AgCl + NaNO3 d. Cl2 + PCl3 → PCI...
Question 18 2 pts Consider the following hypothetical reaction: A (aq) B (aq) At the beginning...
Question 18 2 pts Consider the following hypothetical reaction: A (aq) B (aq) At the beginning of the reaction, 0.850 mol of A are added to the reaction flask containing 1.0 L of solution. The reaction is then monitored and the following data is collected: Time (minutes) 0 10 20 Moles of A 0.850 mol 0.550 mol 0.420 Calculate the average rate of disappearance of A between t = 0 minutes and t = 20 minutes. 0.0215 mol/min -0.0215 mol/min...
Question 1. For a hypothetical chemical reaction: 2 A ( g ) + 2 B (...
Question 1. For a hypothetical chemical reaction: 2 A ( g ) + 2 B ( g ) ⟶ p r o d u c t s the rate law is first order with respect to [A] and second order with respect to [B]. If the rate of this reaction at a specific temperature was 4.1 x 10-2 M/s when the [A] = 1.2 M and [B] = 1.5 x 10-2 M, what is the rate constant (k) with the...
URGENT please show work and write clearly. Thank you.
Use the data above to answer the questions.
The original Absorbance vs. Time graph
Absorbance vs. Time (min) 035 Ln(Absorbance) vs. Time (min) y = 1.174681-0.0733 R'9.990 Absoba Ice I absorbat) Time in Time (MI) 1/Absorbance vs. Time Y 0.62518x1.79428 R'-0.987 12Absotele ad Ln Time Absorbance 1/Absorbance Absorbance 0 0.3397 -1.07969 2.943774 1.5366 0.2806 -1.27083 3.563792 2.6937 0.255 -1.36649 3.921569 3.7872 0.2271 -1.48236 4.403347 5.0772 0.2105 -1.55827 4.750594 6.6 0.1809 -1.70981...
please help with question 22 and 23. showing all work
22. (Apts) A given reaction has rate constant k =3.45 x 102M'sat T-283K. IFE 145kJ/mol, calculate the value of kyat T-303K. 23. (6pts) Given the following reactions: HOOH + HOI+OH HOI + → Iz + OH 20H+ + 2H30* → 4H:0 a. Are there any intermediates? If so, it is/they are: b. Is there a catalyst? If so, it is: c. Write the equation for the overall reaction. 24. (10pts)...
QUESTION 10 Given the data below for the reaction, 2 A + 2 B + 4 C-> D + E + 3 F the reaction is order in A, order in B order in C and order overall. USE WORDS TO FILL IN THE BLANKS NOT NUMBERS(i.e., zero, first, second etc) Initial conc of A, ial conc of B, mol/L For Blank 3 Initial conc of C, Initial rate, mol/L.s 0.2 0.3 0.4 mol/L 0.2 0.2 0.4 0.6 mol/L 0.4...
I need the answers in details with explanation
thanks in advance!
first question:
second question:
7) The reaction (CH3)3CBr + OH → (CH3)3COH + Br in a certain solvent is first order with respect to (CH3)3CBr and zero order with respect to OH-. In several experiments, the rate constant k was determined at different temperatures. A plot of In(k) versus 1/T was constructed resulting in a straight line with a slope of -1.10 X 104 K and y-intercept of 33.5....
please show all work
1. Consider the following kinetic data, collected at 25.0°C, for the reaction 2 NO(g+ Cl2 → 2NOCI Experiment INOJ (M) 0.0300 0.0150 0.0150 ICI (M) 0.0100 0.0100 0.0400 Rate (M/s) 3.4 x 10 8.5 x 10 3.4 x 10 a. What is the reaction order with respect to NO? b. What is the reaction order with respect to CIZ? c. What is the overall reaction order? d. Determine the value of the rate constant, k (round...
can you please show steps for the first question and explain
the answers for the other two questions?
1A. A solution of a 6.0 M solution of a weak acid is 0.16% ionized. What is the K, of the acid? (4 points) 13. Which of the following is a Lewis acid-base reaction? a. CH3Br + CH3Cl → CH3Cl + HBO b. •CH3 + .CI → CH3CI C. NaCl + AgNO3 → AgCl + NaNO3 d. Cl2 + PCl3 → PCI...
Question 18 2 pts Consider the following hypothetical reaction: A (aq) B (aq) At the beginning of the reaction, 0.850 mol of A are added to the reaction flask containing 1.0 L of solution. The reaction is then monitored and the following data is collected: Time (minutes) 0 10 20 Moles of A 0.850 mol 0.550 mol 0.420 Calculate the average rate of disappearance of A between t = 0 minutes and t = 20 minutes. 0.0215 mol/min -0.0215 mol/min...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 52 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago