Homework Answers
Add Answer to:
what is the structure for 1 and 2. using the IR and NMR
corresponding
Problem Set...
deduce the structure that corresponds to the following data CH₂O IR 5 'H NMR 7.5 8.0...
deduce the structure that corresponds to the following
data
CH₂O IR 5 'H NMR 7.5 8.0 ppm (multiplet; integral = 2.5), 3.0 ppm (triplet, integral = 1). 18 ppm (sextet integral = 1), and 1.0 ppm (triplet integral = 15)
help! what is the structure deduced from the IR and NMR? please help! 3. MF: CeH11BrO2 IR: 30- 25- 20- 15- 10- 3000...
help! what is the structure deduced from the IR and NMR?
please help!
3. MF: CeH11BrO2 IR: 30- 25- 20- 15- 10- 3000 3500 2500 2000 1500 1000 Wavenumber (cm-1) H-NMR: 11.5 ppm (singlet; integral 1), 2.5 ppm (triplet; integral = 2), 1.5 ppm (singlet; integral 3), 1.3 ppm (sextet; integral 2), and 1.0 ppm (triplet; integral = 3) 4. MF: C10H15N IR: 4800 as00 sevENu 'H-NMR: 7.0-7.5 ppm (multiplet; integral 1.25), 3.6 ppm (quartet; integral 1.0), and 1.4 ppm...
2. Use the 'H NMR and IR data to determine the structure of the following compounds...
2. Use the 'H NMR and IR data to determine the structure of the following compounds and name them. Compound A Molecular formula: CroH IR absorptions at N/A H NMR data: 1.3 (singlet, 9H), 7.0 to 7.5 (multiplet, 5H) ppm Compound B Molecular formula: CHO IR absorptions at 1H NMR data: 1735-1745, 1050 cm 0.93 (doublet, 6H), 1.52 (multiplet, 2H), 1.69 (multiplet, 1H), 2.04 (singlet, 3H), and 4.10 (triplet,2H) ppm Compound C Molecular ion: IR absorptions at 1710 cm 1H...
deduce the structure that corresponds to the following data 3. TUU Transmittance 1265 1717 3500 3000...
deduce the structure that corresponds to the following
data
3. TUU Transmittance 1265 1717 3500 3000 2500 2000 1500 1000 Wavenumber(cm-1) 'H-NMR: 11.5 ppm (singlet; integral = 1), 2.5 ppm (triplet; integral = 2). 1.5 ppm (singlet, integral = 3). 1.3 ppm (sextet; integral = 2), and 1.0 ppm (triplet, integral 3).
deduce the structure that corresponds to the following data 5. MF: C10H14O2 IR 10 oo 4000...
deduce the structure that corresponds to the following
data
5. MF: C10H14O2 IR 10 oo 4000 'H NMR: 6.9 ppm (doublet; integral 2), 6.8 ppm (doublet; integral 2), 3.6 ppm (doublet; integral 4), 3.2 ppm (singlet; integral 2), 2.9 ppm (pentet; integral 1) and 2.4 ppm (singlet; integral 3).
deduce the structure that corresponds to the following data CioHis N 100 IR AS00 5 00 L000 2000 3000 4D00 MAVENUMBER...
deduce the structure that corresponds to the following
data
CioHis N 100 IR AS00 5 00 L000 2000 3000 4D00 MAVENUMBERI 'H-NMR: 7.0-7.5 ppm (multiplet; integral and 1.4 ppm (triplet; integral 1.5). 1.25), 3.6 ppm (quartet; integral 1.0),
Provide the most likely chemical structure that corresponds to each set of spectral data 2. Formula:...
Provide the most likely chemical structure that corresponds to
each set of spectral data
2. Formula: C6H120 IR: 2960 cm-- (strong), 2874 cm 2 (medium), 1716 cm2 (strong, sharp) "H NMR: 2H, doublet (2.312 ppm); 1H, multiplet (2.133 ppm); 3H, singlet (2.123 ppm); 6H, doublet (0.926 ppm) 13C NMR: 208 ppm, 53 ppm, 30 ppm, 24 ppm, 22 ppm 3. Formula: C4H100 IR: 3339 cm (broad, strong), 2957 cm (strong), 2874 cm (medium) "H NMR: 6H, doublet (0.9 ppm); 1H,...
21. Propose a structure for compound HALLOWEEN with a formula CsH1002 with the following 'H NMR...
21. Propose a structure for compound HALLOWEEN with a formula CsH1002 with the following 'H NMR spectrum and IR spectrum. NAVENTER Area Chem Shift Splitting singlet multiplet multiplet doublet triplet Ppm
just the circled ones only 8.10 Suggest structures consistent with the following 'H NMR data: a....
just the circled ones only
8.10 Suggest structures consistent with the following 'H NMR data: a. Сно triplet (1.0 ppm, 3H) singlet (2.1 ppm, 3H) quartet (2.4 ppm, 2H) b. С Н.о, triplet (1.2 ppm, 3H) singlet (2.1 ppm, 3H) quartet (4.1 ppm, 2H) усно singlet (2.4 ppm, 3H) multiplet (7.5 ppm, 5H) singlet (1.6 ppm, 6H) singlet (3.1 ppm, 2H) multiplet (7.3 ppm, 5H) 1. Сно, triplet (1.2 ppm, 3H) singlet (2.4 ppm, 3H quartet (4.2 ppm, 2H) ....
Provide the most likely chemical structure that corresponds to each set of spectral data (2.5 pts...
Provide the most likely chemical structure that corresponds to each set of spectral data (2.5 pts each). Please show your work, though: even if you do not arrive at the correct answer, you can earn partial credit. Formula: C6H12 IR: 2965 cm-1(strong), 3028 cm-1(medium) 1H NMR: 6H, triplet (1.0 ppm); 4H, quintet (1.8 ppm); 2H, triplet (5.4 ppm) 13C NMR: 22 ppm, 39 ppm, 125 ppm Formula: C6H12O IR: 2960 cm-1(strong), 2874 cm-1(medium), 1716 cm-1(strong, sharp) 1H NMR: 2H, doublet...
deduce the structure that corresponds to the following
data
CH₂O IR 5 'H NMR 7.5 8.0 ppm (multiplet; integral = 2.5), 3.0 ppm (triplet, integral = 1). 18 ppm (sextet integral = 1), and 1.0 ppm (triplet integral = 15)
help! what is the structure deduced from the IR and NMR?
please help!
3. MF: CeH11BrO2 IR: 30- 25- 20- 15- 10- 3000 3500 2500 2000 1500 1000 Wavenumber (cm-1) H-NMR: 11.5 ppm (singlet; integral 1), 2.5 ppm (triplet; integral = 2), 1.5 ppm (singlet; integral 3), 1.3 ppm (sextet; integral 2), and 1.0 ppm (triplet; integral = 3) 4. MF: C10H15N IR: 4800 as00 sevENu 'H-NMR: 7.0-7.5 ppm (multiplet; integral 1.25), 3.6 ppm (quartet; integral 1.0), and 1.4 ppm...
2. Use the 'H NMR and IR data to determine the structure of the following compounds and name them. Compound A Molecular formula: CroH IR absorptions at N/A H NMR data: 1.3 (singlet, 9H), 7.0 to 7.5 (multiplet, 5H) ppm Compound B Molecular formula: CHO IR absorptions at 1H NMR data: 1735-1745, 1050 cm 0.93 (doublet, 6H), 1.52 (multiplet, 2H), 1.69 (multiplet, 1H), 2.04 (singlet, 3H), and 4.10 (triplet,2H) ppm Compound C Molecular ion: IR absorptions at 1710 cm 1H...
deduce the structure that corresponds to the following
data
3. TUU Transmittance 1265 1717 3500 3000 2500 2000 1500 1000 Wavenumber(cm-1) 'H-NMR: 11.5 ppm (singlet; integral = 1), 2.5 ppm (triplet; integral = 2). 1.5 ppm (singlet, integral = 3). 1.3 ppm (sextet; integral = 2), and 1.0 ppm (triplet, integral 3).
deduce the structure that corresponds to the following
data
5. MF: C10H14O2 IR 10 oo 4000 'H NMR: 6.9 ppm (doublet; integral 2), 6.8 ppm (doublet; integral 2), 3.6 ppm (doublet; integral 4), 3.2 ppm (singlet; integral 2), 2.9 ppm (pentet; integral 1) and 2.4 ppm (singlet; integral 3).
deduce the structure that corresponds to the following
data
CioHis N 100 IR AS00 5 00 L000 2000 3000 4D00 MAVENUMBERI 'H-NMR: 7.0-7.5 ppm (multiplet; integral and 1.4 ppm (triplet; integral 1.5). 1.25), 3.6 ppm (quartet; integral 1.0),
Provide the most likely chemical structure that corresponds to
each set of spectral data
2. Formula: C6H120 IR: 2960 cm-- (strong), 2874 cm 2 (medium), 1716 cm2 (strong, sharp) "H NMR: 2H, doublet (2.312 ppm); 1H, multiplet (2.133 ppm); 3H, singlet (2.123 ppm); 6H, doublet (0.926 ppm) 13C NMR: 208 ppm, 53 ppm, 30 ppm, 24 ppm, 22 ppm 3. Formula: C4H100 IR: 3339 cm (broad, strong), 2957 cm (strong), 2874 cm (medium) "H NMR: 6H, doublet (0.9 ppm); 1H,...
21. Propose a structure for compound HALLOWEEN with a formula CsH1002 with the following 'H NMR spectrum and IR spectrum. NAVENTER Area Chem Shift Splitting singlet multiplet multiplet doublet triplet Ppm
just the circled ones only
8.10 Suggest structures consistent with the following 'H NMR data: a. Сно triplet (1.0 ppm, 3H) singlet (2.1 ppm, 3H) quartet (2.4 ppm, 2H) b. С Н.о, triplet (1.2 ppm, 3H) singlet (2.1 ppm, 3H) quartet (4.1 ppm, 2H) усно singlet (2.4 ppm, 3H) multiplet (7.5 ppm, 5H) singlet (1.6 ppm, 6H) singlet (3.1 ppm, 2H) multiplet (7.3 ppm, 5H) 1. Сно, triplet (1.2 ppm, 3H) singlet (2.4 ppm, 3H quartet (4.2 ppm, 2H) ....
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 minute ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 32 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago