find the volume of KOH used to reach equivalence point
M(ClCH2CH2COOH)*V(ClCH2CH2COOH) =M(KOH)*V(KOH)
1.79 M *24.9 mL = 0.3M *V(KOH)
V(KOH) = 148.57 mL
Given:
M(ClCH2CH2COOH) = 1.79 M
V(ClCH2CH2COOH) = 24.9 mL
M(KOH) = 0.3 M
V(KOH) = 148.57 mL
mol(ClCH2CH2COOH) = M(ClCH2CH2COOH) * V(ClCH2CH2COOH)
mol(ClCH2CH2COOH) = 1.79 M * 24.9 mL = 44.571 mmol
mol(KOH) = M(KOH) * V(KOH)
mol(KOH) = 0.3 M * 148.57 mL = 44.571 mmol
We have:
mol(ClCH2CH2COOH) = 44.571 mmol
mol(KOH) = 44.571 mmol
44.571 mmol of both will react to form ClCH2CH2COO- and H2O
ClCH2CH2COO- here is strong base
ClCH2CH2COO- formed = 44.571 mmol
Volume of Solution = 24.9 + 148.57 = 173.47 mL
Kb of ClCH2CH2COO- = Kw/Ka = 1*10^-14/7.94*10^-5 = 1.259*10^-10
concentration ofClCH2CH2COO-,c = 44.571 mmol/173.47 mL = 0.2569M
ClCH2CH2COO- dissociates as
ClCH2CH2COO- + H2O -----> ClCH2CH2COOH + OH-
0.2569 0 0
0.2569-x x x
Kb = [ClCH2CH2COOH][OH-]/[ClCH2CH2COO-]
Kb = x*x/(c-x)
Assuming x can be ignored as compared to c
So, above expression becomes
Kb = x*x/(c)
so, x = sqrt (Kb*c)
x = sqrt ((1.259*10^-10)*0.2569) = 5.689*10^-6
since c is much greater than x, our assumption is correct
so, x = 5.689*10^-6 M
[OH-] = x = 5.689*10^-6 M
use:
pOH = -log [OH-]
= -log (5.689*10^-6)
= 5.245
use:
PH = 14 - pOH
= 14 - 5.245
= 8.755
Answer: 8.76
Chloropropionic acid, CICH2CH2COOH is a weak monoprotic acid with K, 7.94 x 105 M. Calculate the...
Chloropropionic acid, ClCH2CH2COOH is a weak monoprotic acid with Ka = 7.94 x 10-5M. Calculate the pH at the equivalence point in a titration 24.1 mL of 1.33 M chloropropionic acid with 0.3 M KOH.
1) Chloropropionic acid, ClCH2CH2COOH is a weak monoprotic acid with Ka = 7.94 x 10-5 M. Calculate the pH at the equivalence point in a titration 40.4 mL of 0.49 M chloropropionic acid with 0.9 M KOH. 2) What is the pH after 22.90 mL of NaOH are added?
Chloropropionic acid, CICH_2 CH_2 COOH is a weak monoprotic acid with K_a = 7.94 times 10^-5 M. Calculate the pH at the equivalence point in a titration 32.4 mL of 0.45 M chloropropionic acid with 0.4 M KOH.
Chloropropionic acid, CICH2CH2COOH is a weak monoprotic acid with Ka = 7.94 x 10-5 M. Calculate the pH at the equivalence point in a titration 48.7 mL of 0.39 M chloropropionic acid with 0.7 M KOH. Answer: Indicators of Phenolphthalein is a commonly used indicator that is colorless in the acidic form (pH < 8.3) and pink in the basic form (pH > 10.0). It is a weak acid with a pka of 8.7. What is the ratio of the...
Solve a, b and 2 1. Calculate the pH during the titration of 10.00 mL of 0.400 M hypochlorous acid with 0.500 M NaOH. First what is the initial pH (before any NaOH is added)? The Ka for HOCl is 3.0 x 10-8 M. Answer is 3.96 a. What is the pH after 10.60 mL of NaOH are added? b. What is the pH after 15.30 mL of NaOH are added? 2. Chloropropionic acid, ClCH2CH2COOH is a weak monoprotic acid...
A student peforms a titration, titrating 25.00 mL of a weak monoprotic acid, HA, with a 1.24 M solution of NaOH. They collect data, plot a titration curve and determine the values given in the below table. ml NaOH added pH Half-way Point 18.73 3.60 Equivalence point 37.45 8.59 How many moles of NaOH have been added at the equivalence point? mol What is the total volume of the solution at the equivalence point? mL During the titration the following...
A student peforms a titration, titrating 25.00 mL of a weak monoprotic acid, HA, with a 1.18 M solution of NaOH. They collect data, plot a titration curve and determine the values given in the below table. ml NaOH added pH Half-way Point 18.77 3.83 Equivalence point 37.54 8.73 How many moles of NaOH have been added at the equivalence point? mol What is the total volume of the solution at the equivalence point? mL During the titration the following...
A student peforms a titration, titrating 25.00 mL of a weak monoprotic acid, HA, with a 1.18 M solution of NaOH. They collect data, plot a titration curve and determine the values given in the below table. ml NaOH added PH Half-way Point 19.03 3.54 Equivalence point 38.05 8.57 How many moles of NaOH have been added at the equivalence point? mol incorrect 0/1 What is the total volume of the solution at the equivalence point? ImL incorrect 0/1 During...
In the titration of a solution of weak monoprotic acid with a 0.1275 M solution of NaOH, the pH half way to the equivalence point was 4.48. In the titration of a second solution of the same acid, exactly twice as much of a 0.1275 M solution of NaOH was needed to reach the equivalence point. What was the pH half way to the equivalence point in this titration? In the titration of a solution of weak monoprotic acid with...
Calculate pH for a weak acid/strong base titration. Determine the pH during the titration of 59.3 mlL of 0.335 M nitrous acid (K-4.5x104) by 0.335 M KOH at the following points. (a) Before the addition of any KOH (b) After the addition of 15.0 mL of KOH (c) At the half-equivalence point (the titration midpoint) (d) At the equivalence point (e) After the addition of 89.0 mL of KOH