Homework Answers
These muscles are responsible for shoulder positioning, abduction, adduction, flexion, extension and shoulder rotation. Asymmetrical sports such as tennis, base ball and golf are especially likely to cause unequal development and postural imbalance. Movements like golf swing (back swing and follow-through) can increase the symptoms.
Add Answer to:
1. Why is it essential that both anterior and posterior muscles of the shoulder joint be...
ul the shoulder joint be pre U Lause unequal development? What movements are inve 8. 9....
ul the shoulder joint be pre U Lause unequal development? What movements are inve 8. 9. nsport to produce unequal development? Shoulder girdle movements is equal to movements Wherever the scapula goes, the follows 10. Shoulder girdle movement is not dependent on the shoulder joint and its muscles 11. List the 5 muscles involved in shoulder girdle movements. 12. Which nerves primarily innervate the shoulder girdle muscles? 13. List 2 instability problems associated with the shoulder joint. it is. 14....
A 36-year-old woman has a tumor removed from the hypothalamus. As a 1 point result both...
A 36-year-old woman has a tumor removed from the hypothalamus. As a 1 point result both the supraoptic and paraventricular nuclei are ablated, but the remaining hypothalamus is intact. What is the major effect thatthis would have on pituitary histology? It will produce hypertrophy of cells in the anterior pituitary. It will eliminate the ability to detect Herring bodies in the posterior pituitary. It will produce degeneration of anterior pituitary cells. It will not affect pituitary histology It will cause...
1. When attempting to develop power and strength for a dynamic movement (throwing. kicking. punch...
1. When attempting to develop power and strength for a dynamic movement (throwing. kicking. punching), the preferred method of training would be to perform strength development exercises isotonic isokinetic isometric isolateral 2. Which of the following muscles will contract to produce the trunk rotation to the right that is necessary for a left hand throw? 1) right external oblique 2) left external oblique 3) right internal oblique 4) left internal oblique a.1, 3 b.2, 4 c.2, 3 d.1, 4 3....
1. Explain why identical twins actually still look different (distinguishable from each other) 2. Explain the...
1. Explain why identical twins actually still look different (distinguishable from each other) 2. Explain the mechanisms involved in mediating epigenetic events. What is the evidence that epigenetic events are essential to development, differentiation and aging? Please answer both questions. Thank you
1. True or False: The kidneys are retroperitoneal organs? 2...In both sexes, the relative position of...
1. True or False: The kidneys are retroperitoneal organs? 2...In both sexes, the relative position of the urinary bladder to other abdominopelvic organs can best be viewed in what type of section of the female and male pelvic cavities? (choose one) Anterior Posterior Medial Mid-sagittal 3.. True or false: the urethra in the female is longer than the urethra in the male? 4.. The renal sinus includes all the following structures except: (a) Renal Pelvis (b) Renal Papillae (c) MinornRenal...
answer in pov of skeleton NOT joint answer Clinical Case study questions CLINICAL CASE STUDY e...
answer in pov of skeleton NOT joint
answer Clinical Case study questions
CLINICAL CASE STUDY e cranium and face of a skull? us and nucleus pulposus ability and strength? Which olved in a "slipped disc? che anatomy class, picked old-fashioned telephone. up to his car and said, llo, obturator, obturator wure he was helping the s plant where his job was ut their visceral organs. his computer keyboard, lant. Soon, his wrist exed it, and he began to on the...
1. What are the 2 main ways that hormones can interact with their target cells? Which...
1. What are the 2 main ways that hormones can interact with their target cells? Which chemical classes of hormones use each of the different mechanisms? Give an example of each type of hormone. 2. Hormones may interact with each other in one of 3 ways to alter body function. Describe each type of interaction and give an example of hormones involved in each one. 3. How do circulating hormones differ from paracrines & autocrines? 4. How does a portal...
SKILLS AND CONCEPTS 1. List five general functions of the musculoskeletal system. 2. In the following figure...
SKILLS AND CONCEPTS 1. List five general functions of the musculoskeletal system. 2. In the following figure, label the bones of the extremities. Copyright 2017 Eleverne Altre 696 Chapter 33 Assisting in Orthopedic Medicine the following drawin ne drawing with the parts of a long be 4. Label the three types of muscles shown in the following figure 2017 Identify the correct pes of joints in the following descriptions permit the skull to grow with the child but have limited...
1. Which of the following is NOT a membrane? a. skin b. serosa c. mucosa d....
1. Which of the following is NOT a membrane? a. skin b. serosa c. mucosa d. pericardium e. All are membranes. 2. Which of the following statements about the mucosa are TRUE? a. Mucosa refers to the fact that this membrane is always wet. b. Mucosa line the cavities of all hollow organs that open to the exterior. C. Mucosa of the mouth and esophagus contain stratified columnar epithelial cells. d. All mucosa produce large amounts of lubricating mucus. 3....
Case Study #1 CHIEF COMPLAINT: Cough and fever for four days HISTORY: Mr. Alcot is a 68 year old man who developed a har...
Case Study
#1
CHIEF
COMPLAINT: Cough and fever for four days
HISTORY: Mr. Alcot is
a 68 year old man who developed a harsh, productive cough four days
prior to being seen by a physician. The sputum is thick and
yellow. He developed a fever, shaking, chills and
malaise along with the cough. One day ago he developed pain in his
right chest that intensifies with inspiration. He lost 15 lbs. over
the past few months but claims he did not...
ul the shoulder joint be pre U Lause unequal development? What movements are inve 8. 9. nsport to produce unequal development? Shoulder girdle movements is equal to movements Wherever the scapula goes, the follows 10. Shoulder girdle movement is not dependent on the shoulder joint and its muscles 11. List the 5 muscles involved in shoulder girdle movements. 12. Which nerves primarily innervate the shoulder girdle muscles? 13. List 2 instability problems associated with the shoulder joint. it is. 14....
A 36-year-old woman has a tumor removed from the hypothalamus. As a 1 point result both the supraoptic and paraventricular nuclei are ablated, but the remaining hypothalamus is intact. What is the major effect thatthis would have on pituitary histology? It will produce hypertrophy of cells in the anterior pituitary. It will eliminate the ability to detect Herring bodies in the posterior pituitary. It will produce degeneration of anterior pituitary cells. It will not affect pituitary histology It will cause...
1. When attempting to develop power and strength for a dynamic movement (throwing. kicking. punching), the preferred method of training would be to perform strength development exercises isotonic isokinetic isometric isolateral 2. Which of the following muscles will contract to produce the trunk rotation to the right that is necessary for a left hand throw? 1) right external oblique 2) left external oblique 3) right internal oblique 4) left internal oblique a.1, 3 b.2, 4 c.2, 3 d.1, 4 3....
1. True or False: The kidneys are retroperitoneal organs? 2...In both sexes, the relative position of the urinary bladder to other abdominopelvic organs can best be viewed in what type of section of the female and male pelvic cavities? (choose one) Anterior Posterior Medial Mid-sagittal 3.. True or false: the urethra in the female is longer than the urethra in the male? 4.. The renal sinus includes all the following structures except: (a) Renal Pelvis (b) Renal Papillae (c) MinornRenal...
answer in pov of skeleton NOT joint
answer Clinical Case study questions
CLINICAL CASE STUDY e cranium and face of a skull? us and nucleus pulposus ability and strength? Which olved in a "slipped disc? che anatomy class, picked old-fashioned telephone. up to his car and said, llo, obturator, obturator wure he was helping the s plant where his job was ut their visceral organs. his computer keyboard, lant. Soon, his wrist exed it, and he began to on the...
SKILLS AND CONCEPTS 1. List five general functions of the musculoskeletal system. 2. In the following figure, label the bones of the extremities. Copyright 2017 Eleverne Altre 696 Chapter 33 Assisting in Orthopedic Medicine the following drawin ne drawing with the parts of a long be 4. Label the three types of muscles shown in the following figure 2017 Identify the correct pes of joints in the following descriptions permit the skull to grow with the child but have limited...
1. Which of the following is NOT a membrane? a. skin b. serosa c. mucosa d. pericardium e. All are membranes. 2. Which of the following statements about the mucosa are TRUE? a. Mucosa refers to the fact that this membrane is always wet. b. Mucosa line the cavities of all hollow organs that open to the exterior. C. Mucosa of the mouth and esophagus contain stratified columnar epithelial cells. d. All mucosa produce large amounts of lubricating mucus. 3....
Case Study
#1
CHIEF
COMPLAINT: Cough and fever for four days
HISTORY: Mr. Alcot is
a 68 year old man who developed a harsh, productive cough four days
prior to being seen by a physician. The sputum is thick and
yellow. He developed a fever, shaking, chills and
malaise along with the cough. One day ago he developed pain in his
right chest that intensifies with inspiration. He lost 15 lbs. over
the past few months but claims he did not...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 52 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago