Homework Answers
Add Answer to:
8.44 Draw a beaker that shows the result of dissolving methanol, CH3OH, in water and a...
noinizdle dn Draw a flow sheet to describe the separation procedure. (10 pts) doprleoudenagne aded 6....
noinizdle dn Draw a flow sheet to describe the separation procedure. (10 pts) doprleoudenagne aded 6. Are several small-scale extractions more efficient than one large-scale extraction? Why? (10 pts) 7. Why the upper layer should be poured out from the top of the separatory funnel but not be drained from the stopcock? (10 pts) Extraction: Separation of a Neutral and Basic Substances 1 Dissolve 2 g of a mixture of naphthalene and 4-chloroaniline in 20 mL of ethyl ether and...
A solution is prepared by dissolving 0.23 mol of formic acid and 0.27 mol of sodium...
A solution is prepared by dissolving 0.23 mol of formic acid and 0.27 mol of sodium formate in water sufficient to yield 1.00 L of solution. The addition of 0.05 mol of NaOH to this buffer solution causes the pH to increase slightly. The pH does not increase drastically because the NaOH reacts with the present in the buffer solution. The K, of formic acid is 1.8 x 10+ A formic acid B. sodium formate C water D. sodium E....
1. When sodium metal is dropped into liquid water, the mixture releases gaseous hydrogen. leaving behind...
1. When sodium metal is dropped into liquid water, the mixture releases gaseous hydrogen. leaving behind a colorless solution of sodium hydroxide. Balance the equation that represents this reaction. 2. Liquid butane is often used as a fuel in cigarette ligthers. When the pressure is released, butane evaporates and can burn with oxygen. Balance the following skeletal equation for the reaction of butane with oxygen gas. O p +Os c Op+H:0 3. Balance the following equation: Zn + HNO- Zn(NO...
1 & 6-10 6. When sodium metal is dropped into liquid water, the mixture releases gaseous...
1 & 6-10
6. When sodium metal is dropped into liquid water, the mixture releases gaseous hydrogen leaving behind a colorless solution of sodium hydroxide, Balance the equation that represents this reaction 2: Liquid butane is often used as a fuel in cigarette ligthers. When the pressure is released, butane evaporates and can burn with oxygen. Balance the following skeletal equation for the reaction of butane with oxygen gas et +O CO HO 3 Balance the following equation; Zn HNO...
Experiment 1: Neutralization of Acids and Bases In this experiment, you will learn how to properly...
Experiment 1: Neutralization of Acids and Bases In this experiment, you will learn how to properly neutralize and dispose of acidic and base solutions. Remember, when a solution has a pH of 7, it is considered neutralized. Experiment 1: Neutralization of Acids and Bases In this experiment, you will learn how to properly neutralize and dispose of acidic and base solutions. Remember, when a solution has a pH of 7, it is considered neutralized. Materials 5 mL 4.5% Acetic Acid...
9. Some diseases result from defective transport across the membrane. For example, cystic fibrosis results when...
9. Some diseases result from defective transport across the membrane. For example, cystic fibrosis results when a chloride ion transporter does not function. Which of the following is affected when this transporter does NOT function? the electrical gradient of the cell neither the chloride gradient nor the electrical gradient of the cell the chloride concentration gradient both the chloride concentration gradient and the electrical gradient of the cell 10. Which way does the water move if the cell is in...
G of sodium nitrate (NaNO,) dissolves in 100 g of water at 20°C. Is this solution saturated or un...
g of sodium nitrate (NaNO,) dissolves in 100 g of water at 20°C. Is this solution saturated or unsaturated? Wha t would happen if you added ten more grams of sodium nitrate to the solution? What would if you added the ten grams and raised the temperature to 40 C? lution is unsaturated. Adding ten additional grams of solute (NaNO,) would result in a homo geneous solution. Raising the temperature of the solution by 20°C would not affect the solution...
9. Then add slowly while mixing 1 mL of saturated sodium bicarbonate solution (NaHCO3) -IT WILL...
9. Then add slowly while mixing 1 mL of saturated sodium bicarbonate solution (NaHCO3) -IT WILL BUBBLE! Add additional drops of saturated sodium bicarbonate solution with mixing until no additional bubbling occurs Congratulations! You have just made your first ester. Now you want to separate your ester product from the other stuff in the reaction mixture. CTQ3 Sodium bicarbonate is a base. How will it interact with any carboxylic acid molecules still present in your reaction mixture? 10. Add 1mL...
Question 11 pts Match the definition with it's correct word. A mixture composed of a solute...
Question 11 pts Match the definition with it's correct word. A mixture composed of a solute dissolved in a solvent. [ Choose ] Solute Solution Soluble Miscible Insoluble Solvent Immiscible The greater substance that does the dissolving in a solution. [ Choose ] Solute Solution ...
This is from a Study of Buffer Solutions and pH of Salt Solutions Lab. I calculated...
This is from a Study of Buffer Solutions and pH of Salt
Solutions Lab. I calculated Ka to be 3.2*10^-5. Why is my value
larger than the standard value?
Procedure:
10. How does your calculated value of Ka compare with the standard value of Ka for acetic acid? Discuss why your value may be larger or smaller than the standard value. Caleutats Ka 3.2x 10-5) Cyato-s Learning Objectives: 1. To test the acidic and basic properties of ionic compounds 2....
noinizdle dn Draw a flow sheet to describe the separation procedure. (10 pts) doprleoudenagne aded 6. Are several small-scale extractions more efficient than one large-scale extraction? Why? (10 pts) 7. Why the upper layer should be poured out from the top of the separatory funnel but not be drained from the stopcock? (10 pts) Extraction: Separation of a Neutral and Basic Substances 1 Dissolve 2 g of a mixture of naphthalene and 4-chloroaniline in 20 mL of ethyl ether and...
A solution is prepared by dissolving 0.23 mol of formic acid and 0.27 mol of sodium formate in water sufficient to yield 1.00 L of solution. The addition of 0.05 mol of NaOH to this buffer solution causes the pH to increase slightly. The pH does not increase drastically because the NaOH reacts with the present in the buffer solution. The K, of formic acid is 1.8 x 10+ A formic acid B. sodium formate C water D. sodium E....
1. When sodium metal is dropped into liquid water, the mixture releases gaseous hydrogen. leaving behind a colorless solution of sodium hydroxide. Balance the equation that represents this reaction. 2. Liquid butane is often used as a fuel in cigarette ligthers. When the pressure is released, butane evaporates and can burn with oxygen. Balance the following skeletal equation for the reaction of butane with oxygen gas. O p +Os c Op+H:0 3. Balance the following equation: Zn + HNO- Zn(NO...
1 & 6-10
6. When sodium metal is dropped into liquid water, the mixture releases gaseous hydrogen leaving behind a colorless solution of sodium hydroxide, Balance the equation that represents this reaction 2: Liquid butane is often used as a fuel in cigarette ligthers. When the pressure is released, butane evaporates and can burn with oxygen. Balance the following skeletal equation for the reaction of butane with oxygen gas et +O CO HO 3 Balance the following equation; Zn HNO...
g of sodium nitrate (NaNO,) dissolves in 100 g of water at 20°C. Is this solution saturated or unsaturated? Wha t would happen if you added ten more grams of sodium nitrate to the solution? What would if you added the ten grams and raised the temperature to 40 C? lution is unsaturated. Adding ten additional grams of solute (NaNO,) would result in a homo geneous solution. Raising the temperature of the solution by 20°C would not affect the solution...
9. Then add slowly while mixing 1 mL of saturated sodium bicarbonate solution (NaHCO3) -IT WILL BUBBLE! Add additional drops of saturated sodium bicarbonate solution with mixing until no additional bubbling occurs Congratulations! You have just made your first ester. Now you want to separate your ester product from the other stuff in the reaction mixture. CTQ3 Sodium bicarbonate is a base. How will it interact with any carboxylic acid molecules still present in your reaction mixture? 10. Add 1mL...
This is from a Study of Buffer Solutions and pH of Salt
Solutions Lab. I calculated Ka to be 3.2*10^-5. Why is my value
larger than the standard value?
Procedure:
10. How does your calculated value of Ka compare with the standard value of Ka for acetic acid? Discuss why your value may be larger or smaller than the standard value. Caleutats Ka 3.2x 10-5) Cyato-s Learning Objectives: 1. To test the acidic and basic properties of ionic compounds 2....
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 29 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago