11. Which of the following antibiotics is bacteriostatic? A.Cephalosporin B. Aminoglycoside C. Chloramphenicol D. Penicillin
11. Which of the following antibiotics is bacteriostatic?
A.Cephalosporin B. Aminoglycoside C. Chloramphenicol D. Penicillin
Homework Answers
Option C is correct as Chloramphenicol is generally categorized in bacteriostatic antibiotics because it limits the groth of the bacterias by the interfering in th eprotein production requirted for the growth of the bacterias.
Add Answer to:
11. Which of the following antibiotics is bacteriostatic?
A.Cephalosporin B. Aminoglycoside C. Chloramphenicol D.
Penicillin
E. Superscription 7. Which of the following is not a bacteriostatic antibiotic? A. Sulfonamide B. Tetracycline...
E. Superscription 7. Which of the following is not a bacteriostatic antibiotic? A. Sulfonamide B. Tetracycline C. Penicillin D. Chloramphenicol E. Clindamycin 8. Which of the following is a main use of rifampin? A. Treatment of tuberculosis B. Prevention of meningococci outbreaks C. Elimination of type B influenzas D. Treatment of chlamydia E. Both A and B 9. Which of the following is a sedative? A. Phenothiazine B. Barbiturate C. Monoamine oxidase inhibitor D. Lithium E. Levodopa 10. Which of...
26. What type of antibiotic is Azithromycin? a. Tetracycline b. Penicillin c. Cephalosporin d. Macrolide 27....
26. What type of antibiotic is Azithromycin? a. Tetracycline b. Penicillin c. Cephalosporin d. Macrolide 27. Which of the following combination vaccines does not contain DTP? a Kinrix b. Pro Quad c. Pentacel d. Pediarix 28. What is the minimum age that a child must be before being administered DTP? a. 6 weeks b. 12 weeks c. 7 years d. Il years 29. What is the minimum age that a child must be before being administered Tdap? a 6 weeks...
The nurse determines that which of the following types of antibiotics being prescribed for one or...
The nurse determines that which of the following types of antibiotics being prescribed for one or more of a group of clients is least likely to cause nephrotoxicity? A cephalosporin An aminoglycoside A penicillin A sulfonamide
Which of the following antibiotics would be considered "broad spectrum?" A. erythromycin B. isoniazid C. penicillin...
Which of the following antibiotics would be considered "broad spectrum?" A. erythromycin B. isoniazid C. penicillin D. all of the above E. none of the above Which of the following is FALSE? A. The most dangerous pathogens would require BSL-1. B. Physical controls are the usual choice for disinfection, antisepsis, and preservation. C. There are many antibacterial drugs because there are so many differences between pro- and eukaryotic cells. D. Once viruses complete the Entry phase, they cannot be harmed...
3. The bacteriostatic drug sulfanilamide, which predates penicillin, used to be prepared from acetanilide in several...
3. The bacteriostatic drug sulfanilamide, which predates penicillin, used to be prepared from acetanilide in several steps. a) Suggest a synthesis. In contrast to most synthetic problems, this one will require you to make comparisons between functional groups and suggest extension of chemistry you've seen to new contexts. b) Why do you think acetanilide was used as a starting material rather than aniline? O=$=0 NH2
ch each term with its meaning. Match each a. antiseptic b. disinfectant c. bactericidal d. bacteriostatic...
ch each term with its meaning. Match each a. antiseptic b. disinfectant c. bactericidal d. bacteriostatic e. pathogen f. broad-spectrum 8 narrow-spectrum 32. chemical agent that kills vegetative forms of bacteria 3. disease-producing microorganism or substance 34. pertains to anything that inhibits growth of bacteria 35. antibiotics effective against a limited number of bacteria 36. substance that prevents or inhibits growth of microorganisms 37. antibiotics effective against a large number of bacteria 38. pertains to killing or destruction of bacteria
3. Which of these antibiotics would be classified as narrow-spectrum antibiotics? grampos sneg) 4. Which of...
3. Which of these antibiotics would be classified as narrow-spectrum antibiotics? grampos sneg) 4. Which of these antibiotics would be classified as broad-spectrum antibiotics? lics? (will kill both 5a. Ampicillin is a form of penicillin. If the zone of inhibition for a susceptible strain of E. coli is mm, and for a strain of S. aureus is 29 mm, which one is inhibited by the lower concentration or ampicillin? 5b. Would you need a higher dose of ampicillin to cure...
Which of the following antibiotics is a cell wall inhibitor but is not a beta-lactam? Vancomycin...
Which of the following antibiotics is a cell wall inhibitor but is not a beta-lactam? Vancomycin а b Penicillin Cephalosporin d Monobactams Carbapenems е au Joshua, a cancer patient, is placed on the chemotherapeutic docetaxel and an additional drug that causes immunosuppression to decrease the possibility of hypersensitivity to the chemotherapeutic. Which of the following would this drug be? Corticosteroid a b Mineralcorticoid Gonadocorticoid C Antibiotics that work as protein synthesis inhibitors generally disrupt translation by working at the Enzyme...
USING THE WORDS GIVEN, COMPLETE THE FOLLOWING SENTENCES bacteriostatic Leginin Lytic and lysogenic cycle mesophile Alexander...
USING THE WORDS GIVEN, COMPLETE THE FOLLOWING SENTENCES bacteriostatic Leginin Lytic and lysogenic cycle mesophile Alexander Flaming. bioremediation Lytic cycle bactericidal latent period Pathogens recombination Zoonotic infections staphylococcus aureus Vibrio cholera OUTR03MAY 1. Disease causing organisms are known as 2. Bacterial diseases that can be transmitted to humans. 3. Gram positive bacterla, 4. Gram negative bacteria 5. Virulent viruses undergo only 6. Temperate viruses undergo 7. Period of in activity in a typical virus life cycle 8. Environmental applications of...
12. Which of the following antimicrobial agents has the fewest side effects? a. Tetracycline b. Penicillin...
12. Which of the following antimicrobial agents has the fewest side effects? a. Tetracycline b. Penicillin c. Chloramphenicol d. Erythromycin 13. Which of the following antibodies does not interfere with cell wall synthesis? a. Cephalosporins b. Natural penicillins c. Semisynthetic penicillins d. Macrolides e. Vancomycin 14. Which of the following would be selective against tubercle bacillus? a. b. e. d. e. Vancomycin- inhibits peptidoglycan synthesis Bacitracin- inhibits peptidoglycan synthesis Streptomycin- inhibits protein synthesis Ethambutol- inhibits mycolic acid synthesis Streptogramin- inhibits...
E. Superscription 7. Which of the following is not a bacteriostatic antibiotic? A. Sulfonamide B. Tetracycline C. Penicillin D. Chloramphenicol E. Clindamycin 8. Which of the following is a main use of rifampin? A. Treatment of tuberculosis B. Prevention of meningococci outbreaks C. Elimination of type B influenzas D. Treatment of chlamydia E. Both A and B 9. Which of the following is a sedative? A. Phenothiazine B. Barbiturate C. Monoamine oxidase inhibitor D. Lithium E. Levodopa 10. Which of...
26. What type of antibiotic is Azithromycin? a. Tetracycline b. Penicillin c. Cephalosporin d. Macrolide 27. Which of the following combination vaccines does not contain DTP? a Kinrix b. Pro Quad c. Pentacel d. Pediarix 28. What is the minimum age that a child must be before being administered DTP? a. 6 weeks b. 12 weeks c. 7 years d. Il years 29. What is the minimum age that a child must be before being administered Tdap? a 6 weeks...
3. The bacteriostatic drug sulfanilamide, which predates penicillin, used to be prepared from acetanilide in several steps. a) Suggest a synthesis. In contrast to most synthetic problems, this one will require you to make comparisons between functional groups and suggest extension of chemistry you've seen to new contexts. b) Why do you think acetanilide was used as a starting material rather than aniline? O=$=0 NH2
ch each term with its meaning. Match each a. antiseptic b. disinfectant c. bactericidal d. bacteriostatic e. pathogen f. broad-spectrum 8 narrow-spectrum 32. chemical agent that kills vegetative forms of bacteria 3. disease-producing microorganism or substance 34. pertains to anything that inhibits growth of bacteria 35. antibiotics effective against a limited number of bacteria 36. substance that prevents or inhibits growth of microorganisms 37. antibiotics effective against a large number of bacteria 38. pertains to killing or destruction of bacteria
3. Which of these antibiotics would be classified as narrow-spectrum antibiotics? grampos sneg) 4. Which of these antibiotics would be classified as broad-spectrum antibiotics? lics? (will kill both 5a. Ampicillin is a form of penicillin. If the zone of inhibition for a susceptible strain of E. coli is mm, and for a strain of S. aureus is 29 mm, which one is inhibited by the lower concentration or ampicillin? 5b. Would you need a higher dose of ampicillin to cure...
Which of the following antibiotics is a cell wall inhibitor but is not a beta-lactam? Vancomycin а b Penicillin Cephalosporin d Monobactams Carbapenems е au Joshua, a cancer patient, is placed on the chemotherapeutic docetaxel and an additional drug that causes immunosuppression to decrease the possibility of hypersensitivity to the chemotherapeutic. Which of the following would this drug be? Corticosteroid a b Mineralcorticoid Gonadocorticoid C Antibiotics that work as protein synthesis inhibitors generally disrupt translation by working at the Enzyme...
USING THE WORDS GIVEN, COMPLETE THE FOLLOWING SENTENCES bacteriostatic Leginin Lytic and lysogenic cycle mesophile Alexander Flaming. bioremediation Lytic cycle bactericidal latent period Pathogens recombination Zoonotic infections staphylococcus aureus Vibrio cholera OUTR03MAY 1. Disease causing organisms are known as 2. Bacterial diseases that can be transmitted to humans. 3. Gram positive bacterla, 4. Gram negative bacteria 5. Virulent viruses undergo only 6. Temperate viruses undergo 7. Period of in activity in a typical virus life cycle 8. Environmental applications of...
12. Which of the following antimicrobial agents has the fewest side effects? a. Tetracycline b. Penicillin c. Chloramphenicol d. Erythromycin 13. Which of the following antibodies does not interfere with cell wall synthesis? a. Cephalosporins b. Natural penicillins c. Semisynthetic penicillins d. Macrolides e. Vancomycin 14. Which of the following would be selective against tubercle bacillus? a. b. e. d. e. Vancomycin- inhibits peptidoglycan synthesis Bacitracin- inhibits peptidoglycan synthesis Streptomycin- inhibits protein synthesis Ethambutol- inhibits mycolic acid synthesis Streptogramin- inhibits...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 13 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago