An enzyme catalyzed reaction is studied at substrate concentration that is equal to 8Km. What will...
An enzyme catalyzed reaction is studied at substrate concentration that is equal to 8Km. What will be the value of V0 in terms of fraction of Vmax?
Homework Answers
Add Answer to:
An enzyme catalyzed reaction is studied at substrate
concentration that is equal to 8Km. What will...
5. The Km of an enzyme of an enzyme-catalyzed reaction is 6.5 uM. What substrate concentration...
5. The Km of an enzyme of an enzyme-catalyzed reaction is 6.5 uM. What substrate concentration will be required to obtain 55% of Vmax for this enzyme? (10 pts)
The concentration of substrate X is low. What happens to the rate of the enzyme- catalyzed reaction if the concentr...
The concentration of substrate X is low. What happens to the rate of the enzyme- catalyzed reaction if the concentration of X is doubled? 15. What effect does an increase in the enzyme concentration have on the rate of an enzyme-catalyzed reaction? 16.
What is the rate of an enzyme catalyzed reaction if the Vmax is 100µmol S→P/min and...
What is the rate of an enzyme catalyzed reaction if the Vmax is 100µmol S→P/min and the Km is 7 mM and the substrate concentration is 11mM? Is the enzyme working at Vmax? What if the substrate concentration is raised to 25mM?
The initial rate, V, of an enzyme catalyzed reaction varies with substrate concentration as follows: 106 x Initial...
The initial rate, V, of an enzyme catalyzed reaction varies with substrate concentration as follows: 106 x Initial rate, Ms SJ, M 0.020 0.585 0.004 0.495 0.002 0.392 0.001 0.312 0.250 0.00066 Determine Vmax and Km for this reaction
The rate of an enzyme-catalyzed reaction initially increases with an increase in the substrate concentration, but...
The rate of an enzyme-catalyzed reaction initially increases with an increase in the substrate concentration, but eventually reaches a maximum value, even though the concentration of substrate continues to increase. Which of the following best explains why? O As substrate concentration increases, the substrates preferentially bind with each other instead of the active site of the enzyme, and no additional catalysis occurs. As substrate concentration increases, the active sites of all the enzyme molecules become occupied with substrate molecules, and...
At high (saturating) substrate concentrations, the rate of an enzyme-catalyzed reaction approaches Vmax. How close does...
At high (saturating) substrate concentrations, the rate of an enzyme-catalyzed reaction approaches Vmax. How close does the reaction rate actually get to Vmax? Determine how high (i.e. how many times Km) the substrate concentration must be for the reaction rate to be: a. 98% Vmax (show your work) (2) b. 99% Vmax (answer only) (1) c. 99.9% Vmax (answer only) (1)
At high (saturating) substrate concentrations, the rate of an enzyme-catalyzed reaction approaches Vmax. How close does...
At high (saturating) substrate concentrations, the rate of an enzyme-catalyzed reaction approaches Vmax. How close does the reaction rate actually get to Vmax? Determine how high (i.e. how many times Km) the substrate concentration must be for the reaction rate to be: a. 98% Vmax (show your work) (2) b. 99% Vmax (answer only) (1) c. 99.9% Vmax (answer only) (1)
Uncatalyzed Catalyzed Enzyme-substrate Complex In the above reaction, the lower curve is an enzyme-catalyzed reaction where...
Uncatalyzed Catalyzed Enzyme-substrate Complex In the above reaction, the lower curve is an enzyme-catalyzed reaction where the activation energy is notably lower than the uncatalyzed reaction. Suppose the enzyme in the diagram was mutated in such a way that its affinity for the substrate increased 100 fold, thereby affecting the enzyme-substrate complex portion of the curve. Assume that there was no other effect. Would you expect the reaction rate catalyzed by the altered enzyme to be faster, slower, or equal...
The following data were recorded for the enzyme-catalyzed reaction. Substrate concentration (M) 6.25 x 100 7.50...
The following data were recorded for the enzyme-catalyzed reaction. Substrate concentration (M) 6.25 x 100 7.50 x 10 1.00 x 10-4 1.00 x 10-3 Reaction velocity (nM/min) 15 56 60 75 (1) Estimate Km and Vmax- (2) What would V be at S=2.5 x 10-5 ?
An enzyme catalyzes the reaction A ⇌ B. The enzyme is present at a concentration of...
An enzyme catalyzes the reaction A ⇌ B. The enzyme is present at a concentration of 2 nM, and the Vmax is 1.2 μM s−1. The Km for substrate A is 10 μM. Calculate the initial velocity of the reaction, V0, when the substrate concentration is (a) 2 μM, (b) 10 μM, (c) 30 μM.
5. The Km of an enzyme of an enzyme-catalyzed reaction is 6.5 uM. What substrate concentration will be required to obtain 55% of Vmax for this enzyme? (10 pts)
The concentration of substrate X is low. What happens to the rate of the enzyme- catalyzed reaction if the concentration of X is doubled? 15. What effect does an increase in the enzyme concentration have on the rate of an enzyme-catalyzed reaction? 16.
The initial rate, V, of an enzyme catalyzed reaction varies with substrate concentration as follows: 106 x Initial rate, Ms SJ, M 0.020 0.585 0.004 0.495 0.002 0.392 0.001 0.312 0.250 0.00066 Determine Vmax and Km for this reaction
The rate of an enzyme-catalyzed reaction initially increases with an increase in the substrate concentration, but eventually reaches a maximum value, even though the concentration of substrate continues to increase. Which of the following best explains why? O As substrate concentration increases, the substrates preferentially bind with each other instead of the active site of the enzyme, and no additional catalysis occurs. As substrate concentration increases, the active sites of all the enzyme molecules become occupied with substrate molecules, and...
Uncatalyzed Catalyzed Enzyme-substrate Complex In the above reaction, the lower curve is an enzyme-catalyzed reaction where the activation energy is notably lower than the uncatalyzed reaction. Suppose the enzyme in the diagram was mutated in such a way that its affinity for the substrate increased 100 fold, thereby affecting the enzyme-substrate complex portion of the curve. Assume that there was no other effect. Would you expect the reaction rate catalyzed by the altered enzyme to be faster, slower, or equal...
The following data were recorded for the enzyme-catalyzed reaction. Substrate concentration (M) 6.25 x 100 7.50 x 10 1.00 x 10-4 1.00 x 10-3 Reaction velocity (nM/min) 15 56 60 75 (1) Estimate Km and Vmax- (2) What would V be at S=2.5 x 10-5 ?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 42 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago