Homework Answers
Add Answer to:
Would equilateral trianglar H3 be expected to be a stable ion? Begin your answer by considering...
The H3+ ion is unstable under ambient terrestrial conditions, but because of the abundance of H...
The H3+ ion is unstable under ambient terrestrial conditions, but because of the abundance of H in the universe and the cold vacuous nature of space between celestial bodies, it is, in fact, quite abundant in the universe and important in the chemistry of outer space. Actual H3+ ions are cyclic, but we will consider instead the simpler possibility of a linear H3+ molecule. Draw a molecular orbital diagram for linear H3+. Include both the atomic orbitals that combine and...
Part C they probably mean silicon not sulfur. Our homeworks are always covered in typos :(...
Part C they probably mean silicon not sulfur. Our homeworks are
always covered in typos :(
Consider a planar SiH4 molecule. (a) What is its point group symmetry? (b) How many ligand group orbitals (LGOs) are there for this molecule? Determine the symmetry of each LGO. (c) What are the symmetries of the valence orbitals on sulfur? (d) Construct a molecular orbital energy diagram for planar SiH4. Place the valence electrons in the diagram. (e) Do you expect planar SiH4...
Could you explain this question with more details? a. [Co(en) ClhlCl, which you made in lab, has an optical spectrum wi...
Could you explain this question with more details?
a. [Co(en) ClhlCl, which you made in lab, has an optical spectrum with 2max-625 nm with an extinction coefficient of 37 M1 cm. What kind of transition gives rise to this band? Circle your answer and briefly explain by drawing the d orbital splitting diagram for the ground state and optically excited state of this molecule. Note - a charge transfer transition is from the metal d orbitals to empty ligand orbitals...
5. Consider an hypothetical six-coordinate complex SH6 with the sulfur atom located at the center of...
5. Consider an hypothetical six-coordinate complex SH6 with the sulfur atom located at the center of a trigonal prism as shown below. (a) What is the point group symmetry of this complex? (b) What are the symmetries of the ligand group orbitals of a trigonal prismatic SHE? (c) Construct a molecular orbital energy diagram for trigonal prismatic SH6. Please include the valence electrons in your diagram. (d) Will the molecule be expected to be stable?
Consider an hypothetical six-coordinate complex SHe with the sulfur atom located at the center of a...
Consider an hypothetical six-coordinate complex SHe with the sulfur atom located at the center of a trigonal prism as shown below. 5. (a) |(b) prismatic SHg? (c) Please include the valence electrons in your diagram. (d) What is the point group symmetry of this complex? What are the symmetries of the ligand group orbitals of a trigonal Construct a molecular orbital energy diagram for trigonal prismatic SHs. Will the molecule be expected to be stable?
4. Consider the hypothetical linear Hg ion (a) Draw the crude shapes of the molecular orbitals...
4. Consider the hypothetical linear Hg ion (a) Draw the crude shapes of the molecular orbitals for the linear H ion. Pay particular attention to locating the nodes. Identfy the orbitals as g or u as appropriate (b) Draw a molecular orbital diagram for the linear H ion and fill it in with electrons. Is the linear Ha ion expected to be stable? Why or why not How many bands are predicted in the photoelectron spectrum of linear He (c)...
in fact there is no more information. this is how the question is 4. Consider the...
in fact there is no more information. this is how the question
is
4. Consider the hypothetical linear Hs ion. (a) Draw the crude shapes of the molecular orbitals for the linear H5 ion. Pay particular attention to locating the nodes. Identfy the orbitals as g or u as appropriate. (b) Draw a molecular orbital diagram for the linear Hs ion and fill it in with electrons (c) Is the linear Hs ion expected to be stable? Why or why...
please answer following question. (d) Cah 2. The molecule NO2 is a reactive gas with a...
please answer
following question.
(d) Cah 2. The molecule NO2 is a reactive gas with a bond angle of 134.3º. (a) Draw the most stable possible Lewis structure(s) of NO2. (b) Determine the correct point group for NO2 and determine the sand p orbital symmetry Mulliken symbols for the central nitrogen from the character table. Make sure your molecule is in the xz plane with the z-axis as the main rotation axis. (©) Find the reducible representations for SALCs formed...
1. Construct a molecular orbital diagram that describes the cyanide ion, CN Your diagram should be...
1. Construct a molecular orbital diagram that describes the cyanide ion, CN Your diagram should be labeled to show the individual σ and π molecular orbitals, and the HOMO and the LUMO
3. Indicate the expected hybridization of the following steric numbers: SN = 2 SN = 3...
3. Indicate the expected hybridization of the following steric numbers: SN = 2 SN = 3 SN = 4 SN = 5 SN = 6 4. Construct the framework of the molecule acrylonitrile (H2CCHCN) and assign o and/or it bond(s) to each bond placement. 5. According to Molecular Orbital Theory, when does the order of the itp and op orbitals change from 7p, Op to Op, p (give the two reasons relating to the atoms in the molecule)? 6. For...
Part C they probably mean silicon not sulfur. Our homeworks are
always covered in typos :(
Consider a planar SiH4 molecule. (a) What is its point group symmetry? (b) How many ligand group orbitals (LGOs) are there for this molecule? Determine the symmetry of each LGO. (c) What are the symmetries of the valence orbitals on sulfur? (d) Construct a molecular orbital energy diagram for planar SiH4. Place the valence electrons in the diagram. (e) Do you expect planar SiH4...
Could you explain this question with more details?
a. [Co(en) ClhlCl, which you made in lab, has an optical spectrum with 2max-625 nm with an extinction coefficient of 37 M1 cm. What kind of transition gives rise to this band? Circle your answer and briefly explain by drawing the d orbital splitting diagram for the ground state and optically excited state of this molecule. Note - a charge transfer transition is from the metal d orbitals to empty ligand orbitals...
5. Consider an hypothetical six-coordinate complex SH6 with the sulfur atom located at the center of a trigonal prism as shown below. (a) What is the point group symmetry of this complex? (b) What are the symmetries of the ligand group orbitals of a trigonal prismatic SHE? (c) Construct a molecular orbital energy diagram for trigonal prismatic SH6. Please include the valence electrons in your diagram. (d) Will the molecule be expected to be stable?
Consider an hypothetical six-coordinate complex SHe with the sulfur atom located at the center of a trigonal prism as shown below. 5. (a) |(b) prismatic SHg? (c) Please include the valence electrons in your diagram. (d) What is the point group symmetry of this complex? What are the symmetries of the ligand group orbitals of a trigonal Construct a molecular orbital energy diagram for trigonal prismatic SHs. Will the molecule be expected to be stable?
4. Consider the hypothetical linear Hg ion (a) Draw the crude shapes of the molecular orbitals for the linear H ion. Pay particular attention to locating the nodes. Identfy the orbitals as g or u as appropriate (b) Draw a molecular orbital diagram for the linear H ion and fill it in with electrons. Is the linear Ha ion expected to be stable? Why or why not How many bands are predicted in the photoelectron spectrum of linear He (c)...
in fact there is no more information. this is how the question
is
4. Consider the hypothetical linear Hs ion. (a) Draw the crude shapes of the molecular orbitals for the linear H5 ion. Pay particular attention to locating the nodes. Identfy the orbitals as g or u as appropriate. (b) Draw a molecular orbital diagram for the linear Hs ion and fill it in with electrons (c) Is the linear Hs ion expected to be stable? Why or why...
please answer
following question.
(d) Cah 2. The molecule NO2 is a reactive gas with a bond angle of 134.3º. (a) Draw the most stable possible Lewis structure(s) of NO2. (b) Determine the correct point group for NO2 and determine the sand p orbital symmetry Mulliken symbols for the central nitrogen from the character table. Make sure your molecule is in the xz plane with the z-axis as the main rotation axis. (©) Find the reducible representations for SALCs formed...
1. Construct a molecular orbital diagram that describes the cyanide ion, CN Your diagram should be labeled to show the individual σ and π molecular orbitals, and the HOMO and the LUMO
3. Indicate the expected hybridization of the following steric numbers: SN = 2 SN = 3 SN = 4 SN = 5 SN = 6 4. Construct the framework of the molecule acrylonitrile (H2CCHCN) and assign o and/or it bond(s) to each bond placement. 5. According to Molecular Orbital Theory, when does the order of the itp and op orbitals change from 7p, Op to Op, p (give the two reasons relating to the atoms in the molecule)? 6. For...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 46 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago