Who is FDA and what role does this organization have with regards to medications? Phases of...
Who is FDA and what role does this organization have with regards to medications?
Phases of drug development
|
Phase 1 |
|
|
Phase 2 |
|
|
Phase 3 |
|
|
Post Phase 3 |
|
|
Phase 4 |
Homework Answers
Ans) FDA Mission
The Food and Drug Administration is responsible for protecting the
public health by ensuring the safety, efficacy, and security of
human and veterinary drugs, biological products, and medical
devices; and by ensuring the safety of our nation's food supply,
cosmetics, and products that emit radiation.
Phases of drug development:
Phase 1: Discovery and Development.
Phase 2: Preclinical Research.
Phase 3: Clinical Research.
Phase 4: FDA Review.
Phase 5: FDA Post-Market Safety Monitoring.
Add Answer to:
Who is FDA and what role does this organization have with
regards to medications?
Phases of...
Who is the DEA and what role does this organization have with regards to medications? DEA...
Who is the DEA and what role does this organization have with regards to medications? DEA scheduled drugs Schedule I Schedule II Schedule III Schedule IV Schedule V Pregnancy Categories Category A Category B Category C Category D Category X The nurse needs a legal prescription from the healthcare provider before delivery of medication to a client; however, nurses are responsible for their actions even when there is prescription. Nurses need to be aware of incorrect prescriptions i.e. dosages interactions...
What incentives does the FDA have regarding drug approvals, according to some FDA critics? The FDA...
What incentives does the FDA have regarding drug approvals, according to some FDA critics? The FDA is more concerned with preventing approval of a drug that results in people dying than it is with approving a drug that benefits unidentifiable patients whose lives might be saved if the drug is approved earlier. The FDA is more concerned with preventing statistical deaths than with “visible” or “identifiable” lives. The FDA is too quick to approve new drugs because of pressure from...
Match the following phases of the FDA process of assessing safety and effectiveness of drugs and...
Match the following phases of the FDA process of assessing safety and effectiveness of drugs and the phases' objectives. Establish efficacy for one indication among a homogeneous group of patients compared to conventional treatment. Choone... Choose... Establish that there is enough evidence of efficacy to warrant Preclinical testing randomized controlled trials. Phase 4 Phase 2 Detect rare but serious side effects as well as increased frequency of known side effects. Phase 3 Assess carcinogenic, teratogenicity, and fertility effects in Phase...
1. What is the role of the CISO in an organization? 2. What types of knowledge,...
1. What is the role of the CISO in an organization? 2. What types of knowledge, skills, abilities are most important for a successful CISO to have? 3. How can a CISO contribute to making security a priority during the system development life cycle (SDLC)?
What recommendation does the FDA make regarding consuming raw fish? Group of answer choices The FDA...
What recommendation does the FDA make regarding consuming raw fish? Group of answer choices The FDA recommends avoiding raw and undercooked fish. T he FDA recommends for those who consume raw and undercooked fish to eat fish that has been previously frozen. The FDA recommends combining raw fish with a lemon juice to reduce bacteria. T he FDA recommends combining raw fish with tomatoes to reduce bacteria. 1 and 2
Explain the role of phase equilibria in microstructural development. Based on the process you have described,...
Explain the role of phase equilibria in microstructural development. Based on the process you have described, explain what is happening to the structure of the C 26000 Brass( Copper alloy 260) a. Which phases are present and how were they affected/formed by the processing? Are these equilibrium phases? Metastable phases? Microconstituents? b. What are the crystal structures of the phases present? Please write as particular as possible, thanks
Quality Management questions Please answer all 3 questions 1-What does an organization need to know about...
Quality Management questions Please answer all 3 questions 1-What does an organization need to know about itself before creating a strategic plan? Why is this information important? 2-Describe the phases of team development 3-Describe an example where directing leadership is appropriate.
Chapter 1 What is FDA's role and what legislation authorized it? What are OTC medications? What...
Chapter 1 What is FDA's role and what legislation authorized it? What are OTC medications? What are control substance schedules and what is true about each schedule? What is parenteral route? How soon a nurse needs to check on a patient receiving parenteral pain medication? Chapter 2 What are common signs and symptoms of allergic reactions and what are nursing actions? What are peak and trough and what are they measured for? What is drug compatibility? What diseases affect metabolism?...
Describe play in early childhood. What role does play have in socioemotional development during this stage...
Describe play in early childhood. What role does play have in socioemotional development during this stage of development? Grammar and spelling does matter. Your answer should be 4 paragraphs in length.
1. Which vitamin does the FDA set limits on for its supplement form? 2. Which vitamin...
1. Which vitamin does the FDA set limits on for its supplement form? 2. Which vitamin does the FDA set limits on for its supplement form? 3. Which vitamin is important with the neural tube development of a fetus during pregnancy? 4. Describe the process of digestion and absorption of vitamin B-12. Include R factor and intrinsic factor in your description.
Match the following phases of the FDA process of assessing safety and effectiveness of drugs and the phases' objectives. Establish efficacy for one indication among a homogeneous group of patients compared to conventional treatment. Choone... Choose... Establish that there is enough evidence of efficacy to warrant Preclinical testing randomized controlled trials. Phase 4 Phase 2 Detect rare but serious side effects as well as increased frequency of known side effects. Phase 3 Assess carcinogenic, teratogenicity, and fertility effects in Phase...
Chapter 1 What is FDA's role and what legislation authorized it? What are OTC medications? What are control substance schedules and what is true about each schedule? What is parenteral route? How soon a nurse needs to check on a patient receiving parenteral pain medication? Chapter 2 What are common signs and symptoms of allergic reactions and what are nursing actions? What are peak and trough and what are they measured for? What is drug compatibility? What diseases affect metabolism?...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 29 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago