What is a tumor marker? Give an example of at least one, and what it is...
What is a tumor marker? Give an example of at least one, and what it is specific for?
Homework Answers
Tumor markers are the type of chemicals released by the by tumor cells which are released in the blood and detected in the blood by the enzymatic assay or analytical studies. These are the potential indicator for the diagnosing of cancer. It is reported that some tumor markers are very specific for the type cancer. Eg: alpha-fetoprotein and prostate-specific antigen.
Alpha-fetoprotein is the marker for liver cancer
Add Answer to:
What is a tumor marker? Give an example of at least one, and
what it is...
what gene abnormality cause cystic fibrosis? Definition of carcinoma in situ? what are tumor cell marker?...
what gene abnormality cause cystic fibrosis? Definition of carcinoma in situ? what are tumor cell marker? hypersensitivity reactions and the dermis what happens?
what is evidence based practice. give at least one example of an evidence- based pratice in...
what is evidence based practice. give at least one example of an evidence- based pratice in the health care environment.
1. What is Scope creep? Give at least one example from your experience and/or from a...
1. What is Scope creep? Give at least one example from your experience and/or from a article that you have read.
Give an example of how budgeting is important for businesses, using at least one example. minimum 200 words
Give an example of how budgeting is important for businesses, using at least one example. minimum 200 words
I need really examples 1. What is Scope creep? Give at least one example from your...
I need really examples
1. What is Scope creep? Give at least one example from your experience and/or from a article that you have read.
list 4 attributes of critical thinking and give at least one example of each, then select...
list 4 attributes of critical thinking and give at
least one example of each, then select one of the attributes and
relay a professional instance when either you(or have seen a
co-worker)use critical thinking related to that
attribute.
List at least 4 attributes of critical thinking and give at least one example of each, then select one of the attributes and relay a professional instance when either you (or have seen a co-worker) use critical thinking related to that attribute.
1. What is Scope creep? Give at least one example from your experience and/or from a...
1. What is Scope creep? Give at least one example from your experience and/or from a article that you have read 2. Why is scope creep bad? How does it impact a project? 3. What are the causes of scope creep 4. Discuss how you can avoid scope creep.
What are at least five observable properties of stars? In each case, give at least one...
What are at least five observable properties of stars? In each case, give at least one way we can measure these properties using starlight. What are the extremes for these observable properties of main-sequence stars (for example, what is the lowest mass a main-sequence star is observed to have)?
Please describe one well-studied example of a tumor suppressor gene
Please describe one well-studied example of a tumor suppressor gene, and highlight its normal function and how it might play a role in cancer.
Explain the difference between sensation and perception, then give at least one example from your life...
Explain the difference between sensation and perception, then give at least one example from your life experience of this difference? the answer must be at least half a page .
1. What is Scope creep? Give at least one example from your experience and/or from a article that you have read.
I need really examples
1. What is Scope creep? Give at least one example from your experience and/or from a article that you have read.
list 4 attributes of critical thinking and give at
least one example of each, then select one of the attributes and
relay a professional instance when either you(or have seen a
co-worker)use critical thinking related to that
attribute.
List at least 4 attributes of critical thinking and give at least one example of each, then select one of the attributes and relay a professional instance when either you (or have seen a co-worker) use critical thinking related to that attribute.
1. What is Scope creep? Give at least one example from your experience and/or from a article that you have read 2. Why is scope creep bad? How does it impact a project? 3. What are the causes of scope creep 4. Discuss how you can avoid scope creep.
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago