Consider a condition that results in too many amino acids being in blood. Let’s call it...
Consider a condition that results in too many amino acids being in blood. Let’s call it hyperaminoacidemia. Describe how the symptoms would be different or
similar to diabetes. Describe how blood test results would be similar and different to diabetes.
Homework Answers
Hyperaminoacidemia is defined as excess of aminoacids in blood stream resulted from impairment in protein synthesis secondary to Diabetes, obesity, metabolism disorders. Glucagon secreted from alpha cells of pancreas plays an important role in protein synthesis. Any disruption in glucagon receptors will lead to excess of aminoacids accumulation in plasma. The circulating levels of ketones, glucose and aminoacids increased in diabetes due to insulin deficiency. In diabetes aminoacidemia is manifested by emaciation, increase levels of ketones bodies in blood, polydipsia,Polyuria, fruity breath, excessive toredness.
Add Answer to:
Consider a condition that results in too many amino acids being
in blood. Let’s call it...
Consider a recently-synthesized human polypeptide that is 51 amino acids long. How many different amino acid...
Consider a recently-synthesized human polypeptide that is 51 amino acids long. How many different amino acid sequences are possible in this polypeptide
How many amino acids are being linked in the following polypeptide? Label the N-Terminal and C-Terminal...
How many amino acids are being
linked in the following polypeptide? Label the N-Terminal and
C-Terminal ends of the peptide. Identify the individual amino
acids.
5. How many amino acids are being linked in the following polypeptide? Label the N-Terminal and C-Terminal ends of the peptide. Identify the individual amino acids. H2N— C— C— N— C— C— N — — HN NHA
Consider a bacterial gene that is approximately 2100 nucleotides long. Approximately how many amino acids would...
Consider a bacterial gene that is approximately 2100 nucleotides long. Approximately how many amino acids would this gene code for? How many mRNA molecules will probably be transcribed from this gene? How many proteins will probably be made from this gene?
1. Amino acids are often broken down into two groups, essential and nonessential. Essential amino acids...
1. Amino acids are often broken down into two groups, essential and nonessential. Essential amino acids must be eaten in order to survive as we don’t make them. This is why intaking a certain amount of protein is so important to the body. In one of the greatest scientific finds of the 21st century, amino acids were discovered inside meteorites that had impacted the earth. Interestly, the amino acids contained different side chains and configurations than those found on earth....
Glomerular Filtration 1. Blood entering the glomerulus contains blood cells, proteins, glucose, amino acids, salts, urea....
Glomerular Filtration 1. Blood entering the glomerulus contains blood cells, proteins, glucose, amino acids, salts, urea. wall and enter the filtrate. acids, salts, urea, and water to exit the blood and 2. Blood pressure causes small molecules of glucose, amino enter the glomerular capsule. The fluid in the glomerular capsule is called the filtrate. become part of the filtrate. 3. In the list that follows, draw an arrow from left to right for the small molecules that leave the glomerulus...
1. Identify the chemical elements of protein. How many amino acids are there that build body...
1. Identify the chemical elements of protein. How many amino acids are there that build body proteins. How many essential amino acids are there. 2. What is the difference between indispensable (essential), dispensable (nonessential), and conditionally indispensable (essential) amino acids. 3. What are the major functions of proteins in the body. 3. Describe nitrogen balance and the conditions that may result in positive and negative nitrogen balance. 4. What are complete and incomplete proteins. Identify food items that contain complete...
1. How many different erent groups comprise the common amino acids (ie those incorporated into most...
1. How many different erent groups comprise the common amino acids (ie those incorporated into most groups comprise the com proteins)? A 2 B 10 C. 20 D 25 2. When two separate cysteine A. a sulfu r ate cysteine SH groups form a bridge with each other, SS, the bridge is called SH B. a disulfide link. C. a disulfur bridge. D. a sulfate link The pH at which a witterion has exactly a zero charge is called the...
Polymerization of amino acids into a polypeptide requires energy. In terms of chemical thermodynamics, the chemical...
Polymerization of amino acids into a polypeptide requires energy. In terms of chemical thermodynamics, the chemical energy for peptide bond formation in translation technically comes from: hydrolysis of GTP hydrolysis of ATP translocation of the ribosome as it moves along the mRNA ribosomal RNA (rRNA) secondary structure transcription of the mRNA that is being translated Transfer RNA (tRNA) is a ribonucleic acid about 50-60 nucleotides long. When a tRNA gets "charged" by covalent addition of its cognate amino acid, to...
61. How many different test results can you get from 1 SIM test? a. 1 b....
61. How many different test results can you get from 1 SIM test? a. 1 b. 2 c. 3 d. 4 62. How can SIM medium be used to assess motility? a. Growth radiates outward in all directions from the stab line and on the surface b. Media turns black c. Formation of a pink color on the surface of the agar d. More than 1 of the above 63. What type of respiration results in the production of H2S...
How many amino acids are being
linked in the following polypeptide? Label the N-Terminal and
C-Terminal ends of the peptide. Identify the individual amino
acids.
5. How many amino acids are being linked in the following polypeptide? Label the N-Terminal and C-Terminal ends of the peptide. Identify the individual amino acids. H2N— C— C— N— C— C— N — — HN NHA
Glomerular Filtration 1. Blood entering the glomerulus contains blood cells, proteins, glucose, amino acids, salts, urea. wall and enter the filtrate. acids, salts, urea, and water to exit the blood and 2. Blood pressure causes small molecules of glucose, amino enter the glomerular capsule. The fluid in the glomerular capsule is called the filtrate. become part of the filtrate. 3. In the list that follows, draw an arrow from left to right for the small molecules that leave the glomerulus...
1. How many different erent groups comprise the common amino acids (ie those incorporated into most groups comprise the com proteins)? A 2 B 10 C. 20 D 25 2. When two separate cysteine A. a sulfu r ate cysteine SH groups form a bridge with each other, SS, the bridge is called SH B. a disulfide link. C. a disulfur bridge. D. a sulfate link The pH at which a witterion has exactly a zero charge is called the...
Polymerization of amino acids into a polypeptide requires energy. In terms of chemical thermodynamics, the chemical energy for peptide bond formation in translation technically comes from: hydrolysis of GTP hydrolysis of ATP translocation of the ribosome as it moves along the mRNA ribosomal RNA (rRNA) secondary structure transcription of the mRNA that is being translated Transfer RNA (tRNA) is a ribonucleic acid about 50-60 nucleotides long. When a tRNA gets "charged" by covalent addition of its cognate amino acid, to...
61. How many different test results can you get from 1 SIM test? a. 1 b. 2 c. 3 d. 4 62. How can SIM medium be used to assess motility? a. Growth radiates outward in all directions from the stab line and on the surface b. Media turns black c. Formation of a pink color on the surface of the agar d. More than 1 of the above 63. What type of respiration results in the production of H2S...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 9 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 59 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago