Homework Answers
Please find the answer in attached images. 1st for answer and
second for explanation
Add Answer to:
5a-b
5a. Complete the reaction scheme below to show the self-aldol addition product and the self-aldol...
Be sure to answer all parts. Can the aldol addition product of the aldehyde below undergo an aldol condensation reactio...
Be sure to answer all parts.
Can the aldol addition product of the aldehyde below undergo an
aldol condensation reaction? Why or why not?
If a reaction occurs, draw the structure of the aldol
condensation product. If not, write NR.
Be sure to answer all parts. Can the aldol addition product of the aldehyde below undergo an aldol condensation reaction? Why or why not? If a reaction occurs, draw the structure of the aldol condensation product. If not, write NR....
Match the starting ketone or aldehyde with appropriate product of either aldol addition or adol condensation...
Match the starting ketone or aldehyde with appropriate product
of either aldol addition or adol condensation reaction.
A ketone or an aldehyde from the list undergo either aldol addition (in a case aldol addition product can not undergo further elimination) or aldol condensation reaction in protic solvent under basic catalysis. Match the starting ketone or aldehyde with appropriate product of either aldol addition or aldol condensation reaction propanal acetaldehyde 2-ethyl-2-hydroxy-hexanal 2-methylbuta ethanal Please answer 2-ethyl-4-methyl 2-hexenal Choose 2-methyl-2-pentenal 2-ethyl-3-hydroxy-2,4-dimethyl hexanal...
СО cat. H + NH2CH3 + H2CO2C CO2CH3 CO CHE Cocaine has been prepared by a...
СО cat. H + NH2CH3 + H2CO2C CO2CH3 CO CHE Cocaine has been prepared by a sequence beginning with a Mannich reaction between dimethyl acetonedicarboxylate, methylamine, and butanedial. The mechanism involves the following steps: 1. Following initial protonation of the carbonyl oxygen, nucleophilic attack by the amine forms carbinolamine 1; 2. Proton transfer and elimination of water forms iminium ion 2; he enol form of the dicarboxylate ester attacks the iminium ion to form adduct 3; 4. Adduct 3 tautomerizes...
How many different aldol addition products can be formed in the reaction of equal amounts of...
How many different aldol addition products can be formed in the reaction of equal amounts of propanal and butanal with aqueous sodium hydroxide at OC? (Consider only constitutional isomer - not stereoisomers.) C1 OOO QUESTION 2 Which of the following is the aldol addition product of butanal in the presence of sodium hydroxide and water? 2-ethyl-3-hydroxyhexanal C2-methyl-2-hydroxyheptanal C 3-ethyl-2-hydroxyhexanal C2-ethyl-2-hydroxyhexanal QUESTION 3 The reaction of benzophenone in a Aldol self-condensation reaction with sodium hydroxide and water gives which product? C...
Experimental Outline In its simplest form, the aldol condensation is a self-addition involving tw...
Organic Chemistry 2
Experimental Outline In its simplest form, the aldol condensation is a self-addition involving two molecules of the same aldehyde or ketone, in the presence of a base, and results in the formation of a new carbon-carbon bond joining the carbonyl carbon of one molecule to the a-position of the second. In many cases - if the reaction conditions aren't sufficiently mild - the initially formed aldol product reacts further in an elimination reaction to give what is...
3. Draw all the aldol addition products that are formed when a mixture of acetaldehyde and...
3. Draw all the aldol addition products that are formed when a
mixture of acetaldehyde and pentanal is treated with aqueous sodium
hydroxide.
4. A reaction, such as described in question 3, which produces a
mixture of products is generally not useful for organic synthesis.
Suggest a change in the reaction starting materials for question 3
that would produce a single, similar product.
5. Draw a generic mechanism for aldol condensation.
6. The last step for an aldol condensation involves...
Determine the theoretical and percent yield for this lab Wednerdouy 13 CH 4521-8: Crossed Aldol Condensation:...
Determine the theoretical and percent yield for this lab
Wednerdouy 13 CH 4521-8: Crossed Aldol Condensation: Synthesls of trans-p-anisalacetophenone Ketones that contain an a-hydrogen (a hydrogen on the C right next door to the carbonyl group) can be tabilized via keto-enol tautomerization, or through the loss of the a-hydrogen to form an enolate anion. enolate anion Enolate ions actas nudbophiles and are considerable more reactive than tois. The enolate on i the subject of today's experiment. The formation of an...
Draw the starting materials for the compound given below via directed aldol condensation reaction. Show the...
Draw the starting materials for the compound given below via directed aldol condensation reaction. Show the resonance structure for the following, α,β-unsaturated ketone. 1. Propose reagents or products as needed (you will need sets of reagents for arrows pointing left and 1 product for the right facing arrow). 2. H3C-SH HO
23.3 Give the aldehyde or ketone precursor of the aldol condensation product (a) (b) H (c)...
23.3 Give the aldehyde or ketone precursor of the aldol condensation product (a) (b) H (c) (d) (e) 23.3 Give the aldehyde or ketone precursor of the aldol condensation product. where was the OH in the aldol product before loss of H,0 to give the enone?
1. The aldol condensation reaction belongs to a group of reactions characterized by formation of an...
1. The aldol condensation reaction belongs to a group of reactions characterized by formation of an enolate. For each of the following aldehydes or ketones, draw the enolate ion that forms when treated with a strong base such as sodium hydroxide. If an enolate cannot form, put NR (no reaction). 2. The first step in the aldol addition of acetaldehyde is an acid base reaction (proton transfer). pka = 16 pka = 15 OH a. The pk, for each acid...
Be sure to answer all parts.
Can the aldol addition product of the aldehyde below undergo an
aldol condensation reaction? Why or why not?
If a reaction occurs, draw the structure of the aldol
condensation product. If not, write NR.
Be sure to answer all parts. Can the aldol addition product of the aldehyde below undergo an aldol condensation reaction? Why or why not? If a reaction occurs, draw the structure of the aldol condensation product. If not, write NR....
Match the starting ketone or aldehyde with appropriate product
of either aldol addition or adol condensation reaction.
A ketone or an aldehyde from the list undergo either aldol addition (in a case aldol addition product can not undergo further elimination) or aldol condensation reaction in protic solvent under basic catalysis. Match the starting ketone or aldehyde with appropriate product of either aldol addition or aldol condensation reaction propanal acetaldehyde 2-ethyl-2-hydroxy-hexanal 2-methylbuta ethanal Please answer 2-ethyl-4-methyl 2-hexenal Choose 2-methyl-2-pentenal 2-ethyl-3-hydroxy-2,4-dimethyl hexanal...
СО cat. H + NH2CH3 + H2CO2C CO2CH3 CO CHE Cocaine has been prepared by a sequence beginning with a Mannich reaction between dimethyl acetonedicarboxylate, methylamine, and butanedial. The mechanism involves the following steps: 1. Following initial protonation of the carbonyl oxygen, nucleophilic attack by the amine forms carbinolamine 1; 2. Proton transfer and elimination of water forms iminium ion 2; he enol form of the dicarboxylate ester attacks the iminium ion to form adduct 3; 4. Adduct 3 tautomerizes...
How many different aldol addition products can be formed in the reaction of equal amounts of propanal and butanal with aqueous sodium hydroxide at OC? (Consider only constitutional isomer - not stereoisomers.) C1 OOO QUESTION 2 Which of the following is the aldol addition product of butanal in the presence of sodium hydroxide and water? 2-ethyl-3-hydroxyhexanal C2-methyl-2-hydroxyheptanal C 3-ethyl-2-hydroxyhexanal C2-ethyl-2-hydroxyhexanal QUESTION 3 The reaction of benzophenone in a Aldol self-condensation reaction with sodium hydroxide and water gives which product? C...
Organic Chemistry 2
Experimental Outline In its simplest form, the aldol condensation is a self-addition involving two molecules of the same aldehyde or ketone, in the presence of a base, and results in the formation of a new carbon-carbon bond joining the carbonyl carbon of one molecule to the a-position of the second. In many cases - if the reaction conditions aren't sufficiently mild - the initially formed aldol product reacts further in an elimination reaction to give what is...
3. Draw all the aldol addition products that are formed when a
mixture of acetaldehyde and pentanal is treated with aqueous sodium
hydroxide.
4. A reaction, such as described in question 3, which produces a
mixture of products is generally not useful for organic synthesis.
Suggest a change in the reaction starting materials for question 3
that would produce a single, similar product.
5. Draw a generic mechanism for aldol condensation.
6. The last step for an aldol condensation involves...
Determine the theoretical and percent yield for this lab
Wednerdouy 13 CH 4521-8: Crossed Aldol Condensation: Synthesls of trans-p-anisalacetophenone Ketones that contain an a-hydrogen (a hydrogen on the C right next door to the carbonyl group) can be tabilized via keto-enol tautomerization, or through the loss of the a-hydrogen to form an enolate anion. enolate anion Enolate ions actas nudbophiles and are considerable more reactive than tois. The enolate on i the subject of today's experiment. The formation of an...
Draw the starting materials for the compound given below via directed aldol condensation reaction. Show the resonance structure for the following, α,β-unsaturated ketone. 1. Propose reagents or products as needed (you will need sets of reagents for arrows pointing left and 1 product for the right facing arrow). 2. H3C-SH HO
23.3 Give the aldehyde or ketone precursor of the aldol condensation product (a) (b) H (c) (d) (e) 23.3 Give the aldehyde or ketone precursor of the aldol condensation product. where was the OH in the aldol product before loss of H,0 to give the enone?
1. The aldol condensation reaction belongs to a group of reactions characterized by formation of an enolate. For each of the following aldehydes or ketones, draw the enolate ion that forms when treated with a strong base such as sodium hydroxide. If an enolate cannot form, put NR (no reaction). 2. The first step in the aldol addition of acetaldehyde is an acid base reaction (proton transfer). pka = 16 pka = 15 OH a. The pk, for each acid...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago