please find the integration and tell what each peak represent
Homework Answers
In camphor there are total 16 proton. At 0 ppm ( that is for reference TMS) integration is 1.0 TMS molecule contain 12 proton , so we have to multiply 12 with each integration value given . Around 1 ppm integration is .67, that signal is for 0.67*12= 8 hydrogen , between 2.4-1.6 ppm integration is 0.21, means there are 0.21*12= around 3 hydrogen and greater than 7 ppm integration is .04 means there are .04*12=0.48 hydrogen . Proton which are shieled gives lower ppm value and deshieled proton gives higher ppm value. Carbonyl oxygen has much electron density around it ,so protons far mostfrom the oxygen are most deshieled giving higher ppm value. And proton at the nearby distance from oxygen are shielded gives the lower ppm value .
Below the protons ate marked acording to their ppm region.
Add Answer to:
please find the integration and tell what each peak
represent
H3C CH3 CH3 camphor
For each separate reaction fill in what goes in the blank box CH3 CH3 H3C H3C...
For each separate reaction fill in what goes in the
blank box
CH3 CH3 H3C H3C Br © P(CH3)3 bideo ed jer Br Me Br
1. Provide an IUPAC name for the following alkynes (1pt each). CH3 H3C CH3 CH3 CH3...
1. Provide an IUPAC name for the following alkynes (1pt each). CH3 H3C CH3 CH3 CH3 H3C
How many unique 'H NMR and 13C NMR signals exist for each compound? CH3 H3C CH3...
How many unique 'H NMR and 13C NMR signals exist for each compound? CH3 H3C CH3 H3C CH3 H A CH3 H3C B CH3 H3c c h Hac o 'CH3 TH NMR signals Number Number Number Number 13C NMR signals Number Number Number Number
Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:
Write the correct name for each compound below. H3C-CH3: H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH=CH2: H-C≡C-H: H-C-(CH3)3: H3C-CH=CH-CH3:
What is the name and condensed structure of this molecule? H3C H3C—c5c-CH2 CH3 tortingetorial
What is the name and condensed structure of this
molecule?
H3C H3C—c5c-CH2 CH3 tortingetorial
Classify each pair of compounds as constitutional isomers, stereoisomers, or identical molecules. H3C-CH2 CH3 H3C-CH2 Classify:...
Classify each pair of compounds as constitutional isomers, stereoisomers, or identical molecules. H3C-CH2 CH3 H3C-CH2 Classify: and O constitutional isomers Ostereoisomers O identical molecules CH3 H3C Classify: H2C-CH2-CH-CH-CH3 and н, с CH-CH-CH, CH3 ан. CH3 CH3 O constitutional isomers stereoisomers identical molecules Classify: H₂C. and сн. НАС O identical molecules stereoisomers O constitutional isomers
Question 5 of 21 > Write the name of each amine. H3C—CH2 —N— CH2 - CH3...
Question 5 of 21 > Write the name of each amine. H3C—CH2 —N— CH2 - CH3 name: H3C—CH2 - CH2 —^—CH2 - CH3 < Question 5 of 21 > name: H3C—CH2 - CH2 —N—CH2 – CH3 name: These compounds are amines.
Please show step by step how to find the chemical shift? How do I know what...
Please show step by step how to find the chemical shift? How
do I know what numbers to use to find the answer? I’m really
lost!!!!
Chemical Shit 2p H3C Multiplicity qupter Multplity qan er Integration Chemical Shift| Seen CH3 Multplicity oab let Integration 2H Chemical Shift 3 Mauipliclypet Integration
what is the IUPAC name for this compound? H3C CH3
what is the IUPAC name for this compound?
H3C CH3
Classify each pair of compounds as constitutional isomers, stereoisomers, or identical molecules. H3C-CH2 CH3 H3C-CH2H Classify:...
Classify each pair of compounds as constitutional isomers, stereoisomers, or identical molecules. H3C-CH2 CH3 H3C-CH2H Classify: and но stereoisomers O identical molecules constitutional isomers НЫС CH3 HC-CH2-CH-CH-CH3 Classify: and н,с CH-CH-CH2 CH3 CH CH O stereoisomers O constitutional isomers O identical molecules Classify: нс and CH₂ 4 нса,
For each separate reaction fill in what goes in the
blank box
CH3 CH3 H3C H3C Br © P(CH3)3 bideo ed jer Br Me Br
1. Provide an IUPAC name for the following alkynes (1pt each). CH3 H3C CH3 CH3 CH3 H3C
How many unique 'H NMR and 13C NMR signals exist for each compound? CH3 H3C CH3 H3C CH3 H A CH3 H3C B CH3 H3c c h Hac o 'CH3 TH NMR signals Number Number Number Number 13C NMR signals Number Number Number Number
What is the name and condensed structure of this
molecule?
H3C H3C—c5c-CH2 CH3 tortingetorial
Classify each pair of compounds as constitutional isomers, stereoisomers, or identical molecules. H3C-CH2 CH3 H3C-CH2 Classify: and O constitutional isomers Ostereoisomers O identical molecules CH3 H3C Classify: H2C-CH2-CH-CH-CH3 and н, с CH-CH-CH, CH3 ан. CH3 CH3 O constitutional isomers stereoisomers identical molecules Classify: H₂C. and сн. НАС O identical molecules stereoisomers O constitutional isomers
Question 5 of 21 > Write the name of each amine. H3C—CH2 —N— CH2 - CH3 name: H3C—CH2 - CH2 —^—CH2 - CH3 < Question 5 of 21 > name: H3C—CH2 - CH2 —N—CH2 – CH3 name: These compounds are amines.
Please show step by step how to find the chemical shift? How
do I know what numbers to use to find the answer? I’m really
lost!!!!
Chemical Shit 2p H3C Multiplicity qupter Multplity qan er Integration Chemical Shift| Seen CH3 Multplicity oab let Integration 2H Chemical Shift 3 Mauipliclypet Integration
what is the IUPAC name for this compound?
H3C CH3
Classify each pair of compounds as constitutional isomers, stereoisomers, or identical molecules. H3C-CH2 CH3 H3C-CH2H Classify: and но stereoisomers O identical molecules constitutional isomers НЫС CH3 HC-CH2-CH-CH-CH3 Classify: and н,с CH-CH-CH2 CH3 CH CH O stereoisomers O constitutional isomers O identical molecules Classify: нс and CH₂ 4 нса,
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 25 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 1 hour ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago