Homework Answers
If you have any query please comment
If you satisfied with the solution please like it thankxx
A metal object with mass of 24.0 g is heated to 97.0 °C and then transferred...
A metal object with mass of 24.0 g is heated to 97.0 °C and then transferred to an insulated container containing 88.5 g of water at 20.5 °C. The water temperature rises and the temperature of the metal object falls until they both reach the same final temperature of 23.2 °C. What is the specific heat of this metal object? Assume that all the heat lost by the metal object is absorbed by the water. specific heat:
A metal object with mass of 20.8 g is heated to 97.0 °C and then transferred to an insulated container containing 8...
A metal object with mass of 20.8 g is heated to 97.0 °C and then transferred to an insulated container containing 86.6 g of water at 20.5 °C. The water temperature rises and the temperature of the metal object falls until they both reach the same final temperature of 23.2 °C. What is the specific heat of this metal object? Assume that all the heat lost by the metal object is absorbed by the water. specific heat: cal
8/30/2018 Dosage Forms Pharmaceutical calculations Anne Chapter 1 Practice Problems 1. If an insulin injection contains...
8/30/2018 Dosage Forms Pharmaceutical calculations Anne Chapter 1 Practice Problems 1. If an insulin injection contains 100 units originemine, how many milliers should be injected to receive 40 units of insulin 2. An injection contains me of medicati in each militer (ml). If a physician prescribes dose or 0.5 mg to be administered to a hospital patient three times daily, how many of injection will be required over a 5-day period? 3. In a clinical study, a drug produced drowsiness...
200 g of an unknown metal powder at Thot = 72°C are dropped into a negligible...
200 g of an unknown metal powder at Thot = 72°C are dropped into a negligible heat capacity calorimeter containing 150 g of water at 16°C. The final equilibrium temperature is measured to be 36.6°C. 1. Calculate the specific heat of the metal powder c. c = J/kg-°C 2. Identify the metal from the list below. Water Beryllium Aluminum Silicon Iron Copper Silver Gold Lead 3. Using the data table, calculate the specific heat per mole Cmolar of each pure...
ID Problems 46) A piece of silver (Ag) metal weighing 194.3 g is placed in a...
ID Problems 46) A piece of silver (Ag) metal weighing 194.3 g is placed in a graduated cylinder containing 242.0 mL of water. The volume of water now reads 260.5 mL. From these data calculate the density of silver 47) The following procedure was used to determine the volume of a flask. The flask was weighed dry and then filled with water. If the masses of the empty flask and filled flask were 56.12 g and 87.39 g, respectively, and...
Incorrect Question 7 0/4 pts 63.0 g of an unknown metal at 100°C is placed in...
Incorrect Question 7 0/4 pts 63.0 g of an unknown metal at 100°C is placed in 50.0 g of water at 24.4°C. The temperature of the system at equilibrium is 27.2°C. What is the unknown metal? Your choices, and their specific heat values in (cal/g°C) Pb (0.0305) Rb (0.086) Sn (0.051) Zn (0.0925) Cu (0.092) Cr(0.111) Ba (0.063)
CHAPTER 18 Pediatric Dosages WORK SHEET DIRECTIONS: The medication order is listed at the beginning of...
CHAPTER 18 Pediatric Dosages WORK SHEET DIRECTIONS: The medication order is listed at the beginning of each problem. Calculate the child's weight in kilograms, determine the safe recommended dosage safety of the order, and calculate the drug dose. Show your work. or range, determine the day for a child weighing 50 lb. You have 1. The physician orders Keflex 250 mg po four times a Keflex 250-mg capsules. The recommended daily po dosage for a child is 25 to 50...
tion 12 of 12 > Attempt 4 When 0.813 g of sodium metal is added to...
tion 12 of 12 > Attempt 4 When 0.813 g of sodium metal is added to an excess ofhydrochloric acid, 8450 J of heat are produced. What is the enthalpy of the reaction as written? 2 Na(s) +2 HCl(aq) 2 NaCl(aq) + H2(g) Enthalpy of reaction: kJ TOOLS x10 contact us help privacy policy terms of use about us careers MacBook Pro When calcium carbonate is added to hydrochloric acid, calcium chloride, carbon dioxide, and water are produced. Attempt 2...
86.bg PART TWO: DATA AND RESULTS Metal: Aluminum (Cal = 0.217 cal/qE)-specific granity Data Item Trial...
86.bg PART TWO: DATA AND RESULTS Metal: Aluminum (Cal = 0.217 cal/qE)-specific granity Data Item Trial 1 Trial 2 1. Mass of metal 50.og 2. Mass of calorimeter 3. Mass of calorimeter and water 124.49 4. Mass of water 120g 5. Initial temperature of water 24°C 23°C 6. Initial temperature of the metal 25°C 75°C 7. Final temperature of the mixture 21.11°C 152.6 g 8. Calculation of the heat energy gained by the water, Q Trial Onc: Trial Two: see...
Question 19 When 27.0 g of an unknown metal at 88.4 °C is placed in water,...
Question 19 When 27.0 g of an unknown metal at 88.4 °C is placed in water, the metal is cooled and loses 1300 J of energy. If the final temperature of the water and metal is 23.7 °C, what is the specific heat capacity of the metal? The specific heat capacity of water is 4.184 lg-k. O 0.74 J/g-K O 1.4g. O 0.34 J/g-K O 0.98J/g.K Next Question 20 Calculate AH for the following reaction, CaO(s) + CO2(g) - CaCO3(s)...
A metal object with mass of 24.0 g is heated to 97.0 °C and then transferred to an insulated container containing 88.5 g of water at 20.5 °C. The water temperature rises and the temperature of the metal object falls until they both reach the same final temperature of 23.2 °C. What is the specific heat of this metal object? Assume that all the heat lost by the metal object is absorbed by the water. specific heat:
A metal object with mass of 20.8 g is heated to 97.0 °C and then transferred to an insulated container containing 86.6 g of water at 20.5 °C. The water temperature rises and the temperature of the metal object falls until they both reach the same final temperature of 23.2 °C. What is the specific heat of this metal object? Assume that all the heat lost by the metal object is absorbed by the water. specific heat: cal
8/30/2018 Dosage Forms Pharmaceutical calculations Anne Chapter 1 Practice Problems 1. If an insulin injection contains 100 units originemine, how many milliers should be injected to receive 40 units of insulin 2. An injection contains me of medicati in each militer (ml). If a physician prescribes dose or 0.5 mg to be administered to a hospital patient three times daily, how many of injection will be required over a 5-day period? 3. In a clinical study, a drug produced drowsiness...
ID Problems 46) A piece of silver (Ag) metal weighing 194.3 g is placed in a graduated cylinder containing 242.0 mL of water. The volume of water now reads 260.5 mL. From these data calculate the density of silver 47) The following procedure was used to determine the volume of a flask. The flask was weighed dry and then filled with water. If the masses of the empty flask and filled flask were 56.12 g and 87.39 g, respectively, and...
Incorrect Question 7 0/4 pts 63.0 g of an unknown metal at 100°C is placed in 50.0 g of water at 24.4°C. The temperature of the system at equilibrium is 27.2°C. What is the unknown metal? Your choices, and their specific heat values in (cal/g°C) Pb (0.0305) Rb (0.086) Sn (0.051) Zn (0.0925) Cu (0.092) Cr(0.111) Ba (0.063)
CHAPTER 18 Pediatric Dosages WORK SHEET DIRECTIONS: The medication order is listed at the beginning of each problem. Calculate the child's weight in kilograms, determine the safe recommended dosage safety of the order, and calculate the drug dose. Show your work. or range, determine the day for a child weighing 50 lb. You have 1. The physician orders Keflex 250 mg po four times a Keflex 250-mg capsules. The recommended daily po dosage for a child is 25 to 50...
tion 12 of 12 > Attempt 4 When 0.813 g of sodium metal is added to an excess ofhydrochloric acid, 8450 J of heat are produced. What is the enthalpy of the reaction as written? 2 Na(s) +2 HCl(aq) 2 NaCl(aq) + H2(g) Enthalpy of reaction: kJ TOOLS x10 contact us help privacy policy terms of use about us careers MacBook Pro When calcium carbonate is added to hydrochloric acid, calcium chloride, carbon dioxide, and water are produced. Attempt 2...
86.bg PART TWO: DATA AND RESULTS Metal: Aluminum (Cal = 0.217 cal/qE)-specific granity Data Item Trial 1 Trial 2 1. Mass of metal 50.og 2. Mass of calorimeter 3. Mass of calorimeter and water 124.49 4. Mass of water 120g 5. Initial temperature of water 24°C 23°C 6. Initial temperature of the metal 25°C 75°C 7. Final temperature of the mixture 21.11°C 152.6 g 8. Calculation of the heat energy gained by the water, Q Trial Onc: Trial Two: see...
Question 19 When 27.0 g of an unknown metal at 88.4 °C is placed in water, the metal is cooled and loses 1300 J of energy. If the final temperature of the water and metal is 23.7 °C, what is the specific heat capacity of the metal? The specific heat capacity of water is 4.184 lg-k. O 0.74 J/g-K O 1.4g. O 0.34 J/g-K O 0.98J/g.K Next Question 20 Calculate AH for the following reaction, CaO(s) + CO2(g) - CaCO3(s)...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 26 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 57 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago