1. What is PFOA? List the standards for color, pH, odor and taste, and Define MCL...
1. What is PFOA? List the standards for color, pH, odor and taste, and Define MCL and MCLG. What is the MCL for turbidity? Is there any health effect of turbidity in drinking water?
Homework Answers
Add Answer to:
1. What is PFOA? List the standards for color, pH, odor and
taste, and Define MCL...
3 pages 22.. Which of the following ia not a chemical method of taste and odor...
3
pages
22.. Which of the following ia not a chemical method of taste and odor removal: a.- Ozonation b.- Aeration C.- Chlorination d.- Potassium Permanganate oxidation 23.- Which of the following is not a quality of Ozone gas: a.- Pungent bluish gas b.- Powerful oxidizer C.- Leaves no residual d.- Most economical method 24.- Which of the following is true regarding Chlorination for taste & odor removal: a.- Very expensive b.- May create odor problems C.- Is used with...
VII. Study questions 1. Define soil pH. What is the pH of a soil that has...
VII. Study questions 1. Define soil pH. What is the pH of a soil that has a 0.0000065 MH'? soil pH can be estimated using dye indicators 2. What is the relationship between exchangeable Cal and acidity? (Director inverse) 3. Will the amount of reserve acidity influence the amount of lime that must be applied to change pH? 4. Would you expect that two soils with the same water pH would necessarily require the same amount of lime? Explain. 5....
Part C: Unknown pH 1) What color do you see for each sample? Be specific. a....
Part C: Unknown pH 1) What color do you see for each sample? Be specific. a. Unknown 1: Club Soda = b. Unknown 2: Alkaline water = C. Unknown 3: Bleach = d. Unknown 4: Acetate Buffer = e. Unknown 5: Carbonate Buffer= f. Unknown 6: Vodka = 2) Using the ranges of the known substances estimate the pH of each of the unknowns by the color of the red cabbage indicator. a. Unknown 1: Club Soda = b. Unknown...
Project: Fluoride in our Drinking Water 1. What are the standards for fluoride in tap water,...
Project: Fluoride in our Drinking Water 1. What are the standards for fluoride in tap water, fountain water, and DI water? 2. Is this technique (ion-selective electrodes to quantify fluoride) a good one for a quantitative analysis of fluoride in water? Explain your reasoning. 3. Can you think of other methods that might work to analyze fluoride content in water?
1. Using the urine color results below, answer the following question: What is an explanation for...
1. Using the urine color results
below, answer the following
question:
What is an explanation for the difference in color
between Darlene's and Marcus's urine?
2. TURBIDITY TEST: REVIEW THE RESULTS IN BELOW AND
ANSWER THE QUESTION :
What is an explanation for the difference in cloudiness
between Darlene's and Marcus's urine?
3. Using the chemical test results, answer
the following question:
What is an explanation for blood in the
urine?
Darlene Jones Age: 35 Darlene is experiencing frequent urination. Review the...
Exercise 21 Review Questions: 1. Define coliforms. Are all coliforms of fecal origin? Sebordered two 2....
Exercise 21 Review Questions: 1. Define coliforms. Are all coliforms of fecal origin? Sebordered two 2. What is the principal fecal coliform? 3. Why might a water company be interested in knowing the source of coliform in a positive sample (fecal or soil?) 4. Why are coliforms alone not indicative of the sanitary quality of swimming pools? 5. What are the standards for coliforms in drinking water? Who establishes these standards? 6. What is the difference between the MPN test...
1.A solution has a pH of 5.5. What would be the color of the solution if...
1.A solution has a pH of 5.5. What would be the color of the solution if each of the following indicators were added? (i) bromophenol blue(ii) bromothymol blue(iii) methyl red (iv) phenolphthalein 2.Calculate the pH at the equivalence point when 50.0 mL of a 0.100 M HN3 acid (a weak monoprotic acid having a Ka = 1.90x10-5) is titrated with 0.100 M NaOH. The titration reaction can be represented as HA + NaOH --- > NaA + H2O Hint: At...
Need help for answering first part(1) color change is due to presence? And what was the...
Need help for
answering first part(1) color change is due to presence? And what
was the reason for the equilibrium turn to reverse direction? And
also last 2 questions.!
Chemistry 102 EXPERİMENT3 Equilibrium& Le Chatelier's Principle tive Qualita of this experiment is to study qualitative aspects of chemical systems in dynamic equilibrium. in doing this experiment, you will learm the operation of Le Chateliers principle. n Vslowly add 1 to 2 drops of dilute 6 M sodium hydroxide solution to...
Reactants Color of the mixture after adding Biuret reagent Tube 1 (egg white + pepsinogen +...
Reactants Color of the mixture after adding Biuret reagent Tube 1 (egg white + pepsinogen + NaOH) Blue Tube 2 (egg white+ pepsinogen + HCl) Purple Tube 3 (egg white + NaOH) Blue Tube 4 (egg white + HCl) Blue a. In which tube(s) did protein digestion occur? How do you know? b. In which tube(s) protein digestion did not occur? How do you know? c. What effect does pH have on protein digestion with pepsin? Why? 3. Reactants Color...
1.List and define the five traits included in the Big Five theory of personality. 2.What are...
1.List and define the five traits included in the Big Five theory of personality. 2.What are the limitations of this approach?
3
pages
22.. Which of the following ia not a chemical method of taste and odor removal: a.- Ozonation b.- Aeration C.- Chlorination d.- Potassium Permanganate oxidation 23.- Which of the following is not a quality of Ozone gas: a.- Pungent bluish gas b.- Powerful oxidizer C.- Leaves no residual d.- Most economical method 24.- Which of the following is true regarding Chlorination for taste & odor removal: a.- Very expensive b.- May create odor problems C.- Is used with...
VII. Study questions 1. Define soil pH. What is the pH of a soil that has a 0.0000065 MH'? soil pH can be estimated using dye indicators 2. What is the relationship between exchangeable Cal and acidity? (Director inverse) 3. Will the amount of reserve acidity influence the amount of lime that must be applied to change pH? 4. Would you expect that two soils with the same water pH would necessarily require the same amount of lime? Explain. 5....
Part C: Unknown pH 1) What color do you see for each sample? Be specific. a. Unknown 1: Club Soda = b. Unknown 2: Alkaline water = C. Unknown 3: Bleach = d. Unknown 4: Acetate Buffer = e. Unknown 5: Carbonate Buffer= f. Unknown 6: Vodka = 2) Using the ranges of the known substances estimate the pH of each of the unknowns by the color of the red cabbage indicator. a. Unknown 1: Club Soda = b. Unknown...
1. Using the urine color results
below, answer the following
question:
What is an explanation for the difference in color
between Darlene's and Marcus's urine?
2. TURBIDITY TEST: REVIEW THE RESULTS IN BELOW AND
ANSWER THE QUESTION :
What is an explanation for the difference in cloudiness
between Darlene's and Marcus's urine?
3. Using the chemical test results, answer
the following question:
What is an explanation for blood in the
urine?
Darlene Jones Age: 35 Darlene is experiencing frequent urination. Review the...
Exercise 21 Review Questions: 1. Define coliforms. Are all coliforms of fecal origin? Sebordered two 2. What is the principal fecal coliform? 3. Why might a water company be interested in knowing the source of coliform in a positive sample (fecal or soil?) 4. Why are coliforms alone not indicative of the sanitary quality of swimming pools? 5. What are the standards for coliforms in drinking water? Who establishes these standards? 6. What is the difference between the MPN test...
Need help for
answering first part(1) color change is due to presence? And what
was the reason for the equilibrium turn to reverse direction? And
also last 2 questions.!
Chemistry 102 EXPERİMENT3 Equilibrium& Le Chatelier's Principle tive Qualita of this experiment is to study qualitative aspects of chemical systems in dynamic equilibrium. in doing this experiment, you will learm the operation of Le Chateliers principle. n Vslowly add 1 to 2 drops of dilute 6 M sodium hydroxide solution to...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 4 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 21 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 22 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 36 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 6 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago