Homework Answers
Q1.
mass of oxygen = (Mass of oxide ) - (Metal) = 3.915-3.145 = 0.770 g
Q2
the compound (oxide) must be ionic, since Zn+2 and O-2 are charged
Q3
empirical formula
mol of Zn = mass/MW = 3.145/65.39 = 0.048
mol of O = mass/MW = 0.77/16 = 0.048125
raito 0.048125 /0.048 = 1
Zn:O
ZnO
Q4.
% by mass of Zn = mass of Zn /Y Total mass * 100 = 3.145/3.915*100 = 80.33%
% mass of O = 100-80.33 = 19.67% for O
Add Answer to:
1. Using the method described in the lab, you wanted to determine the formula of the...
please answer all my questions for me. thank you!! Use the References to access important values...
please answer all my questions for me. thank you!!
Use the References to access important values if needed Calculate the percentage composition for NO2. Mass percentage of nitrogen = Mass percentage of oxygen = Submit Answer Retry Entire Group 8 more group attempts remaining Reference! Use the References to access important value of needed for this question 53.95 gram sample of iron is heated in the presence of excess oxygen. A metal oxide is formed with a mass of 77.14...
1. A 0.750-g sample of tin metal reacts with 0.201 g of oxygen gas to form tin oxide.
1. A 0.750-g sample of tin metal reacts with 0.201 g of oxygen gas to form tin oxide. Calculate the empirical formula of the tin oxide. 2. A 0.565-g sample of cobalt metal reacts with excess sulfur to give 1.027 g of cobalt sulfide. Calculate the empirical formula of the product. 3. A 1.164-g sample of iron filings reacts with chlorine gas to give 3.384 g of iron chloride. Calculate the empirical formula of the product? 4. A 0.626-8 sample of copper oxide...
3. A student used the procedure described in this module to determine the empirical formula of...
3. A student used the procedure described in this module to determine the empirical formula of an oxide of titanium (Ti). A crucible and crucible cover were heated to a constant mass of 34.749 g. The mass of the crucible, crucible cover, and a sample of Ti was 36.383 g. Following the reaction of the Ti metal with O2, the crucible, crucible cover, and contents were heated to a constant mass of 37 472 g (1) Determine the mass of...
Experiment 7 Empirical Formula Objectives: Determine the expected formula for the ionic oxide expected when Mg...
Experiment 7 Empirical Formula Objectives: Determine the expected formula for the ionic oxide expected when Mg reacts with O2 Find the theoretical and actual yields of magnesium oxide Evaluate results using stoichiometry and error analysis Introduction: The goal of this experiment is to determine the Empirical Formula of a Compound. (The Empirical Formula of a Compound is the simplest whole number ratio between the elements of a compound) If one can synthesize a compound from elements, then it is possible...
Experiment 17 Pre-lab Name 1. Define the following in your own words: Empirical Formula: Molecular Formula:...
Experiment 17 Pre-lab Name 1. Define the following in your own words: Empirical Formula: Molecular Formula: Weigh by difference: 2. A sample of Calcium metal is added to a 38.500 g crucible and the combined weight is 38.750 g. The sample is then heated in the crucible to form calcium Oxide. After the crucible is completely cooled, the crucible and product weigh 38.850 9. a) what is the mass of the calcium in the crucible? b) what is the mass...
1. When 2.50 g of copper metal reacts with molecular oxygen, the copper oxide product of the reaction has a mass of...
1. When 2.50 g of copper metal reacts with molecular oxygen, the copper oxide product of the reaction has a mass of 2.81 g. What is the empirical formula of the copper oxide product 2. When 10.8 g of silver was reacted with sulfur. 12.4 grams of product was produced there was only one product). What is the empirical formula of the product? 3. Lysine is a compound composed of carbon, hydrogen, nitrogen and oxygen. When 1.50 g of lysine is burned,...
()UESTIONS 1. If you had used a different mass of magnesium metal, would you expect the...
()UESTIONS 1. If you had used a different mass of magnesium metal, would you expect the empirical formula of the compound to be the same? Explain. 2. If you had omitted steps 12 and 13 from the experiment, how would this omission have affected your results in terms of the empirical formula of the magnesium oxide? In other words, would the ratio of the magnesium to the oxygen have been greater or less than the obtained ratio? 3. From the...
Pestlab questions 1. Knowing what you do about magnesium and oxygen, what type of compound (lonie...
Pestlab questions 1. Knowing what you do about magnesium and oxygen, what type of compound (lonie or covalent) should form between these two elements? If you expect an ionic compound, comment on what ions will be bonding together, and in what ratio you expect based on their charges. Also, if that wasn't the ratio you obtained in your experiment, comment on possible sources of error 2. A student starts with a 3.96 sample of manganese (Mn, molar mass is 54.94...
What Metal Oxide Has been formed? Final Lab Submission Purpose: (5 points) In 2-3 sentences concisely state the pu...
What Metal Oxide Has been formed? Final Lab Submission Purpose: (5 points) In 2-3 sentences concisely state the purpose of the laboratory and what knowledge this lab helped to further develop Experimental Data: (10 points) List all data that was collected from this experiment to help you determine the molecular formula of the metal oxide that you formed. Be sure that you clearly label what each value represents and includes the correct significant figures and units. Example: Mass of the...
Determine the empirical formula for a compound that contains 15.0% C, 5.0% H, and 80.0% S...
Determine the empirical formula for a compound that contains 15.0% C, 5.0% H, and 80.0% S by mass. empirical formula: A 10.04 g sample of a compound contains 6.41 g of iron, Fe, 1.18 g of phosphorus, P, and oxygen, O. Calculate the empirical formula for the compound. empirical formula: What is the empirical formula of a compound composed of 3.25% hydrogen (H), 19.36% carbon (C), and 77.39% oxygen (0) by mass? Insert subscripts as needed. empirical formula: HCO
please answer all my questions for me. thank you!!
Use the References to access important values if needed Calculate the percentage composition for NO2. Mass percentage of nitrogen = Mass percentage of oxygen = Submit Answer Retry Entire Group 8 more group attempts remaining Reference! Use the References to access important value of needed for this question 53.95 gram sample of iron is heated in the presence of excess oxygen. A metal oxide is formed with a mass of 77.14...
3. A student used the procedure described in this module to determine the empirical formula of an oxide of titanium (Ti). A crucible and crucible cover were heated to a constant mass of 34.749 g. The mass of the crucible, crucible cover, and a sample of Ti was 36.383 g. Following the reaction of the Ti metal with O2, the crucible, crucible cover, and contents were heated to a constant mass of 37 472 g (1) Determine the mass of...
Experiment 17 Pre-lab Name 1. Define the following in your own words: Empirical Formula: Molecular Formula: Weigh by difference: 2. A sample of Calcium metal is added to a 38.500 g crucible and the combined weight is 38.750 g. The sample is then heated in the crucible to form calcium Oxide. After the crucible is completely cooled, the crucible and product weigh 38.850 9. a) what is the mass of the calcium in the crucible? b) what is the mass...
()UESTIONS 1. If you had used a different mass of magnesium metal, would you expect the empirical formula of the compound to be the same? Explain. 2. If you had omitted steps 12 and 13 from the experiment, how would this omission have affected your results in terms of the empirical formula of the magnesium oxide? In other words, would the ratio of the magnesium to the oxygen have been greater or less than the obtained ratio? 3. From the...
Pestlab questions 1. Knowing what you do about magnesium and oxygen, what type of compound (lonie or covalent) should form between these two elements? If you expect an ionic compound, comment on what ions will be bonding together, and in what ratio you expect based on their charges. Also, if that wasn't the ratio you obtained in your experiment, comment on possible sources of error 2. A student starts with a 3.96 sample of manganese (Mn, molar mass is 54.94...
What Metal Oxide Has been formed? Final Lab Submission Purpose: (5 points) In 2-3 sentences concisely state the purpose of the laboratory and what knowledge this lab helped to further develop Experimental Data: (10 points) List all data that was collected from this experiment to help you determine the molecular formula of the metal oxide that you formed. Be sure that you clearly label what each value represents and includes the correct significant figures and units. Example: Mass of the...
Determine the empirical formula for a compound that contains 15.0% C, 5.0% H, and 80.0% S by mass. empirical formula: A 10.04 g sample of a compound contains 6.41 g of iron, Fe, 1.18 g of phosphorus, P, and oxygen, O. Calculate the empirical formula for the compound. empirical formula: What is the empirical formula of a compound composed of 3.25% hydrogen (H), 19.36% carbon (C), and 77.39% oxygen (0) by mass? Insert subscripts as needed. empirical formula: HCO
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 17 seconds ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 22 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago