Homework Answers
1. Impurity of compound = extracted caffiene in most cases are not pure in which yield is less than 50% .so, due to this melting point was 2 degree lesser than theoretical.
2. low boling of methylene chloride= During extraction, due low boling of methylene chloirde it only evaporates 40% and remaing form crystal (due to high solubility) with caffiene. and due to this melting point low.
Add Answer to:
Extraction of caffeine from tea with methylene chloride
List some specific explanations for why your melting...
1. Outline a separation scheme for isolating pure caffeine from tea. Use a flowchart that begins...
1. Outline a separation scheme for isolating pure caffeine from tea. Use a flowchart that begins with the tea bag and ends with the pure caffeine. Explain what is being separated at each step throughout the procedure. 2. Why was the sodium carbonate added to the tea solution? 3. The crude caffeine isolated from tea often has a green tinge. Why? 4. What are some possible explanations for why the melting point of your isolated caffeine was lower than the...
This Question is concerning a lab experiment I did on the extraction of caffeine from Tea....
This Question is concerning a lab experiment I did on the extraction of caffeine from Tea. I wanted to you to Comment on the relative solubility of caffeine in water and methylene chloride at room temperature by explaining in detail using the molecular structures and properties of the various substances involved. Thank you very much!!
#1-6 1. Outline a separation scheme for isolating caffeine from tea. Use a flowchart similar in format to that shown...
#1-6
1. Outline a separation scheme for isolating caffeine from tea. Use a flowchart similar in format to that shown in Technique 2, Section 2.2. 2. Why was the sodium carbonate added in Experiment 13A? 3. The crude caffeine isolated from tea often has a green tinge. Why? 4. What are some possible explanations for why the melting point of your isolated caffeine was lower than the literature value (236°C)? 5. An alternative procedure for removing the tannins and gallic...
During Caffeine extraction and purification under the workflow of; steeping tea, L-L extraction, Add NaOH, dry,...
During Caffeine extraction and purification under the workflow of; steeping tea, L-L extraction, Add NaOH, dry, use roto-vap, recrystallization, and then recovering the crystals with dichloromethane what could be some potential reasons for caffeine loss when comparing to theoretical yield (0.034g) and what can be some possible reasons for the crude yield weighing in higher (0.05g) than the expected theoretical yield therefore giving an above 100 percent yield after doing the exact calculation
Post-Lab Report Extraction of Caffeine from Tea Leaves 1. What is liquid-liquid extraction? Explain its principle...
Post-Lab Report Extraction of Caffeine from Tea Leaves
1. What is liquid-liquid extraction? Explain its principle and show illustrations. 2. What are alkaloids and xanthines? 3. Aside from being a natural stimulant, what are the other effects of caffeine in the human body? 4. What are tannins? What are the manifestations of tannins in tea? why is it necessary to boil the solution when extracting the components from the tea leaves? 6. What can be done to avoid tannins from...
Methylene chloride has a melting point of - 94.8°C, a boiling point of 40.0°C, a specific...
Methylene chloride has a melting point of - 94.8°C, a boiling point of 40.0°C, a specific heat of 1.21 J/g *K for the solid and liquid, and 0.608 J/g*K for the gas. The heats of fusion and vaporization are ΔHfus of 73.40 J/g, and ΔHvap of 334.35 J/g respectively. Determine how many joules of energy are needed to heat 40 grams of methylene chloride from -171.4 ° F to 333 K. Draw out and label your heating curve. This will...
If each bag of Lipton black tea contains 55 mg of caffeine, what is the maximum...
If each bag of Lipton black tea contains 55 mg of caffeine, what is the maximum amount of caffeine that you could extract from one using our procedure? Assume one bag and 40mL of tea-water at the end of initial solid-liquid extraction. The partition coefficient (K) for caffeine in methylene chloride is 7.2. How much caffeine could be extracted using our procedure if we had used ethyl acetate (K = 2.0) instead of methylene chloride? Explain why the amount does...
experiment-2-coffeine-extraction-l.pdf
Introduction: Pre-lab Questions Turn in typed responses in the beginning of lab. Answer in complete sentences. Show your work in pen where applicable. 1. What other compounds are extracted along with caffeine into the tea? Use what you know about the relative polarity of the functional groups within these compounds to determine the final destination of the following compounds: cellulose, tannins, chlorophylls, sodium carbonate. Do the majority of these compounds end up in the tea bag, filtered solid, aqueous layer,...
Organic chemistry d 1.43 grams of caffeine from 10 tea bags. If each tea bag weighs...
Organic chemistry
d 1.43 grams of caffeine from 10 tea bags. If each tea bag weighs 3.3 grams, what is the percent yield caffeine in the tea. 7. If the density of a certain liquid material is 1.27 gyml, caleulate the volume of the material that would be equivalent to 10 grams of the materials. The melting point of a pure compound is known to be 110-111°. Describe the melting behavior expected if this compound is contaminated with a 10...
Part A 1. If you had used more methylene chloride in each step, you could have...
Part A 1. If you had used more methylene chloride in each step, you could have extracted more caffeine. Explain why you did not. Hint - What step would have taken longer (Hint: not drying). PART A Mass of Beaker & Caffeine Mass of Beaker 167.750g 67.6809 Mass of Caffeine 0.0 75 Calculations. Show your work and circle the answers. Mass of caffeine recovered: 012919 b) Actual:.07 % caffeine recovered: a) Predicted: 9 7:213% b) Actual: 92.105% PART B Unknown...
1. Outline a separation scheme for isolating pure caffeine from tea. Use a flowchart that begins with the tea bag and ends with the pure caffeine. Explain what is being separated at each step throughout the procedure. 2. Why was the sodium carbonate added to the tea solution? 3. The crude caffeine isolated from tea often has a green tinge. Why? 4. What are some possible explanations for why the melting point of your isolated caffeine was lower than the...
#1-6
1. Outline a separation scheme for isolating caffeine from tea. Use a flowchart similar in format to that shown in Technique 2, Section 2.2. 2. Why was the sodium carbonate added in Experiment 13A? 3. The crude caffeine isolated from tea often has a green tinge. Why? 4. What are some possible explanations for why the melting point of your isolated caffeine was lower than the literature value (236°C)? 5. An alternative procedure for removing the tannins and gallic...
Post-Lab Report Extraction of Caffeine from Tea Leaves
1. What is liquid-liquid extraction? Explain its principle and show illustrations. 2. What are alkaloids and xanthines? 3. Aside from being a natural stimulant, what are the other effects of caffeine in the human body? 4. What are tannins? What are the manifestations of tannins in tea? why is it necessary to boil the solution when extracting the components from the tea leaves? 6. What can be done to avoid tannins from...
Organic chemistry
d 1.43 grams of caffeine from 10 tea bags. If each tea bag weighs 3.3 grams, what is the percent yield caffeine in the tea. 7. If the density of a certain liquid material is 1.27 gyml, caleulate the volume of the material that would be equivalent to 10 grams of the materials. The melting point of a pure compound is known to be 110-111°. Describe the melting behavior expected if this compound is contaminated with a 10...
Part A 1. If you had used more methylene chloride in each step, you could have extracted more caffeine. Explain why you did not. Hint - What step would have taken longer (Hint: not drying). PART A Mass of Beaker & Caffeine Mass of Beaker 167.750g 67.6809 Mass of Caffeine 0.0 75 Calculations. Show your work and circle the answers. Mass of caffeine recovered: 012919 b) Actual:.07 % caffeine recovered: a) Predicted: 9 7:213% b) Actual: 92.105% PART B Unknown...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 29 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago