give two reasons why the second molecule is more nucleophilic in an SN2 rxn
give two reasons why the second molecule is more nucleophilic in an SN2 rxn
Homework Answers
propylide ion is better nucleophile in comparison to alkoxy anion because in alkoxy anion the negative charge is on oxygen which is more electronegative than carbon hence it can stablise the negative charge well where as in case of propylide ion the negative charge is concentrated on carbon hence acetylide ion is a better nucleophile.
the pKa value of prop-1-yne (25) is higher than alkohols (16) which makes propylide ion a better nucleophile.
Add Answer to:
give two reasons why the second molecule is more nucleophilic in
an SN2 rxn
Which carbonyl is more susceptible to nucleophilic attack, cyclohexanone or hexanal? Provide two reasons for this...
Which carbonyl is more susceptible to nucleophilic attack, cyclohexanone or hexanal? Provide two reasons for this choice and explain each one.
Which chemical has more entropy and give two reasons why they do. Linear polyethylene (s) or...
Which chemical has more entropy and give two reasons why they do. Linear polyethylene (s) or hyperbranched polyethylene (s).
Which is more reactive toward nucleophilic attack, an aldehyde or a ketone? There are at least...
Which is more reactive toward nucleophilic attack, an aldehyde or a ketone? There are at least two reasons, give one
3. Give a brief explanation why acid chlorides are more reactive than esters in a nucleophilic...
3. Give a brief explanation why acid chlorides are more reactive than esters in a nucleophilic substitution reaction, like a polymerization. Grading Scheme
c) Briefly discuss ONE method of manufacturing a metal matrix composite and give TWO reasons why...
c) Briefly discuss ONE method of manufacturing a metal matrix composite and give TWO reasons why it is more difficult to manufacture ceramic matrix composites. (8,4)
Orgo lab formation of ether by sn2 rxn Why is it important to fully cool the...
Orgo lab formation of ether by sn2 rxn
Why is it important to fully cool the product in an ice bath prior to isolation by suction filtration? Why do you need to rinse your product with ice water instead of room temperature water? Based on what you have learned in lecture, what would happen if you used 2-iodo-2-methylpropune as your electrophile in this reaction? Based on what you have learned in lecture, w hat would be the impact of changing...
Give two reasons why it is important to carry out extraction procedures in the hood
Give two reasons why it is important to carry out extraction procedures in the hood
Give two reasons why statistical methods tend to be based on the assumption that sampling is...
Give two reasons why statistical methods tend to be based on the assumption that sampling is conducted with replacement, instead of without replacement.
Give two reasons why it is important to assigneach user alon ID and password TTT A...
Give two reasons why it is important to assigneach user alon ID and password TTT A 3(1200 T. E-
Explain the term Financial Account deficit, and give two reasons why a country may have such...
Explain the term Financial Account deficit, and give two reasons why a country may have such a deficit.
Which carbonyl is more susceptible to nucleophilic attack, cyclohexanone or hexanal? Provide two reasons for this choice and explain each one.
3. Give a brief explanation why acid chlorides are more reactive than esters in a nucleophilic substitution reaction, like a polymerization. Grading Scheme
c) Briefly discuss ONE method of manufacturing a metal matrix composite and give TWO reasons why it is more difficult to manufacture ceramic matrix composites. (8,4)
Orgo lab formation of ether by sn2 rxn
Why is it important to fully cool the product in an ice bath prior to isolation by suction filtration? Why do you need to rinse your product with ice water instead of room temperature water? Based on what you have learned in lecture, what would happen if you used 2-iodo-2-methylpropune as your electrophile in this reaction? Based on what you have learned in lecture, w hat would be the impact of changing...
Give two reasons why it is important to assigneach user alon ID and password TTT A 3(1200 T. E-
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago