Why is translation such a burden for the cell?
Why is translation such a burden for the cell?
Homework Answers
The cost of translation is higher and is coordinated with intra and extra cellular conditions. This will ensure that the required protein is produced. Making proteins consumes cellular resources by using energy and nutrients as building blocks. It will also use cellular machineries such as ribosomes, polymerases, or chaperones whose availability are limited. Majority of cellular GTP pool is used for amino acid polymerization and very little is allocated for transcription and other process. Also over expression of any gene segment will limit tge cell growth rates.
In the in vitro translation system, is it possible for bacterial cell components used in translation...
In the in vitro translation system, is it possible for bacterial cell components used in translation such as Ribsomes, tRNA, and aminos acids, to be used with the addition of eukaryotic mRNA to produce a protein? Explain it in as clear terms as possible.
22. Why is transcription and translation coupled in prokaryotes? 23. Why is transcription and translation uncoupled...
22. Why is transcription and translation coupled in prokaryotes? 23. Why is transcription and translation uncoupled in eukaryotes? 24. Define transcription 25. Define translation Score 125 x 100
1. How important are noncommunicable diseases to the global burden of disease? Why? 2. Why are...
1. How important are noncommunicable diseases to the global burden of disease? Why? 2. Why are noncommunicable diseases less important to the burden of disease in sub Saharan Africa than any other regions?
Assuming transcription and translation are taking place simultaneously, is the cell below a eukaryotic or prokaryotic...
Assuming
transcription and translation are taking place
simultaneously, is the cell below a eukaryotic or
prokaryotic cell? Please explain your answer.
RNA polymerase DNA Ribosome Transcription Polypeptide- Translation MRNA
Explain why the excess burden of a lump-sum tax will always be zero. Why is the...
Explain why the excess burden of a lump-sum tax will always be zero. Why is the payroll tax not a lump-sum tax? Show how a payroll tax affects the wages paid by employers and received by workers, assuming that it is withheld from their paychecks. Assuming that the supply of labor is not perfectly inelastic, show how the excess burden can be measured.
Who bears the burden of the government debt? Explain why.
Who bears the burden of the government debt? Explain why.
TRUE or FALSE: All viruses require host cell enzymes for translation.
TRUE or FALSE: All viruses require host cell enzymes for translation.
In what part of the cell does the Translation phase of protein synthesis occur? A. nucleus...
In what part of the cell does the Translation phase of protein synthesis occur? A. nucleus B. cell wall C. mytochondria D. cytoplasm
A memory management unit (MMU) uses address translation. Describe the process of address translation and explain why it...
A memory management unit (MMU) uses address translation. Describe the process of address translation and explain why it is useful.
Translation occurs in or at the Prokaryotic cell in a O A. Nucleus OB. Vacuoles OC....
Translation occurs in or at the Prokaryotic cell in a O A. Nucleus OB. Vacuoles OC. Inclusions OD. Ribosomes Reset Selection Mark for Review What's This?
22. Why is transcription and translation coupled in prokaryotes? 23. Why is transcription and translation uncoupled in eukaryotes? 24. Define transcription 25. Define translation Score 125 x 100
Assuming
transcription and translation are taking place
simultaneously, is the cell below a eukaryotic or
prokaryotic cell? Please explain your answer.
RNA polymerase DNA Ribosome Transcription Polypeptide- Translation MRNA
Who bears the burden of the government debt? Explain why.
TRUE or FALSE: All viruses require host cell enzymes for translation.
Translation occurs in or at the Prokaryotic cell in a O A. Nucleus OB. Vacuoles OC. Inclusions OD. Ribosomes Reset Selection Mark for Review What's This?
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago