Consider the following electrochemical cell at 298.15 K: Cd(s) | Cd(NO3)2 (aq, m = 0.200) ||...
Consider the following electrochemical cell at 298.15 K:
Cd(s) | Cd(NO3)2 (aq, m = 0.200) || KCl (aq, m = 0.0150) | Ag(s) |
AgCl(s)
A) Write the overall reaction.
B) Calculate the standard cell potential and ∆GR°.
C) Calculate the cell potential and ∆GR assuming activity coefficients are 1.00.
D) Calculate the cell potential and ∆GR using the Debye-Huckel limiting law for the mean ionic activity coefficients.
E) Is the cell reaction spontaneous as written?
F) How much electrochemical work may be obtained from the cell per gram of reactants?
G) How should the initial ionic concentrations be changed to increase the amount of electrochemical work that may be obtained from the cell?
Homework Answers
there are two many questions, each has some parts so i have solved first 4 questions.please post rest separately...thanks
Add Answer to:
Consider the following electrochemical cell at 298.15 K:
Cd(s) | Cd(NO3)2 (aq, m = 0.200) ||...
the Answer is (A) 15. For the given electrochemical cell at 298.15 K: Pt|H2(g, f= 1...
the Answer is (A)
15. For the given electrochemical cell at 298.15 K: Pt|H2(g, f= 1 atm)|HCl(aq, m) |AgCl) |Ago) The following figure is obtained from derivation of the Nernst equation at different molalities of HCl : 0.235 y = 0.223 +0.06x 80.230 – Ecent (2RT/F) In(m/mº) 0.225 0.220 + 0.0 0.1 0.2 (m/m9) 12 (2RT) The figure shows the plot of (Ecell + F In (m/m°)) vs (m/mº)1/2 . Calculate the experimental mean activity coefficient V+ of HCl at...
8. Consider the following electrochemical cell: Cd Cd? (0.20 M) // H (0.05 M), H2 (1...
8. Consider the following electrochemical cell: Cd Cd? (0.20 M) // H (0.05 M), H2 (1 atm) /Pt Given the following standard reduction potentials: Reaction 2 H+ (aq) + 2 Cd + (aq) + 2e H2 (aq) Cd (s) Eº (volts) 0.00 -0.40 (a) Write the equation for the overall cell reaction. (b) Calculate E' for the overall reaction. (c) Calculate the equilibrium constant for the overall reaction. (d) Calculate the actual value of E for the cell at the...
Consider the following electrochemical cell. Ag(s) | Ag+(aq) || Cr3+(aq) | Cr(s) Determine the overall reaction...
Consider the following electrochemical cell. Ag(s) | Ag+(aq) || Cr3+(aq) | Cr(s) Determine the overall reaction and its standard cell potential (in V) at 25°C for this reaction. (Include states-of-matter under the given conditions in your answer. Use the lowest possible whole number coefficients.) Overall reaction (please provide)= standard cell potential V= Is the reaction spontaneous at standard conditions?
An Ag-Cd electrochemical cell is written as Cd (s) CdCl2 (0.010 M) || AgCl (s) CI-...
An Ag-Cd electrochemical cell is written as Cd (s) CdCl2 (0.010 M) || AgCl (s) CI- (0.50 M) | Ag E°Cd2+/Ca = 0.403 V and EºACIJAg = 0.222 V 1. Write the half-cell reactions at anode and at cathode. 2. Which is oxidant and which is reductant? 3. Calculate the half-cell potentials at both anode and cathode. 4. Calculate the cell potential. 5. Write the whole-cell reaction. 6. Calculate the equilibrium constant for the whole-cell reaction. For the half –...
Electrochemistry 1.Consider the Daniel Cell at the indicated molalities: Zn(s)|ZnSO4(aq, 0.100 M)||CuSO4(aq, 0.500 M)|Cu(s) a) Calculate...
Electrochemistry 1.Consider the Daniel Cell at the indicated molalities: Zn(s)|ZnSO4(aq, 0.100 M)||CuSO4(aq, 0.500 M)|Cu(s) a) Calculate the ionic strength I and mean activity coefficient (gamma+-) for each species, the latter using the Debye - Hückel limiting law, and compare this value to those found in the data tables (i.e., (gamma +-),ZnSO4 = 0.150 at 0.100 M; (gamma +-),CuSO4 = 0.0620 at 0.500 M). b) Calculate E using the molalities indicated in the above Cell...
consider the electrochemical cell 2H^+ (aq)+ Cd(s) = Cd^2+ (aq) + H2(g) Ecell°=0.40 V what would...
consider the electrochemical cell 2H^+ (aq)+ Cd(s) = Cd^2+ (aq) + H2(g) Ecell°=0.40 V what would increase measured cell potential reducing H+ in hydrogen cell increasing the mass of the solid CD electrode reducing cd^2+ ion concentration increasing pressure of hydrogen gas in hydrogen cell none when 1.00kj(1000 j) of heat is added to 50.0 g of water how should the temp of the water change?
6. Consider the following electrochemical cell: Write electrode half-reactions and the cell reaction. Determine the standard...
6. Consider the following electrochemical cell: Write electrode half-reactions and the cell reaction. Determine the standard emf E for this cell from standard potential data in the Data Section of your textbook. Calculate the standard Gibbs energy and the equilibrium constant for the cell reaction at 25°C. Write the Nernst equation for the cell and calculate its emf E given that the pressure of H:(g) p = 1 bar, the molality of HCI(aq) b = 0.01 mol kg.. and the...
Consider an electrochemical cell consisting of an Fe(s) electrode, Fe(NO3)2 electrolyte connected through a salt bridge...
Consider an electrochemical cell consisting of an Fe(s) electrode, Fe(NO3)2 electrolyte connected through a salt bridge to a Ag wire coated in AgCl(s) immersed in an aqueous KCl solution. Is the standard cell and balanced galvanic cell reaction: (If needed, refer to Table 17-1.) 0.669 V, Fe(s) + AgCl(s) → Fe2+(aq)+ Ag(s) + Cl-(aq) 0.669 V, Fe(s) + 2AgCl(s) → Fe2+(aq)+ 2Ag(s) + 2Cl-(aq) –0.225 V, Fe(s) + 2AgCl(s) → Fe2+(aq)+ 2Ag(s) + 2Cl-(aq) 0.259 V, Fe(s)+ 3AgCl(s) → Fe3+(aq)+...
Consider an electrochemical cell consisting of an Fe(s) electrode, Fe(NO3)2 electrolyte connected through a salt bridge...
Consider an electrochemical cell consisting of an Fe(s) electrode, Fe(NO3)2 electrolyte connected through a salt bridge to a Ag wire coated in AgCl(s) immersed in an aqueous KCl solution. Is the standard cell and balanced galvanic cell reaction: (If needed, refer to Table 17-1.) 0.669 V, Fe(s) + 2AgCl(s) → Fe2+(aq) + 2Ag(s) + 2Cl-(aq) –0.669 V, Fe(s) + 2AgCl(s) → Fe2+(aq) + 3Ag(s) + 3Cl-(aq) –0.225 V, Fe(s) + 2AgCl(s) → Fe2+(aq) + 2Ag(s) + 2Cl-(aq) 0.669 V, Fe(s)...
Calculate ∆G° (kJ/mol) for the following electrochemical cell: Cd(s) | Cd2+(aq) || Ni2+(aq)| Ni(s)
Calculate ∆G° (kJ/mol) for the following electrochemical cell: Cd(s) | Cd2+(aq) || Ni2+(aq)| Ni(s)
the Answer is (A)
15. For the given electrochemical cell at 298.15 K: Pt|H2(g, f= 1 atm)|HCl(aq, m) |AgCl) |Ago) The following figure is obtained from derivation of the Nernst equation at different molalities of HCl : 0.235 y = 0.223 +0.06x 80.230 – Ecent (2RT/F) In(m/mº) 0.225 0.220 + 0.0 0.1 0.2 (m/m9) 12 (2RT) The figure shows the plot of (Ecell + F In (m/m°)) vs (m/mº)1/2 . Calculate the experimental mean activity coefficient V+ of HCl at...
8. Consider the following electrochemical cell: Cd Cd? (0.20 M) // H (0.05 M), H2 (1 atm) /Pt Given the following standard reduction potentials: Reaction 2 H+ (aq) + 2 Cd + (aq) + 2e H2 (aq) Cd (s) Eº (volts) 0.00 -0.40 (a) Write the equation for the overall cell reaction. (b) Calculate E' for the overall reaction. (c) Calculate the equilibrium constant for the overall reaction. (d) Calculate the actual value of E for the cell at the...
An Ag-Cd electrochemical cell is written as Cd (s) CdCl2 (0.010 M) || AgCl (s) CI- (0.50 M) | Ag E°Cd2+/Ca = 0.403 V and EºACIJAg = 0.222 V 1. Write the half-cell reactions at anode and at cathode. 2. Which is oxidant and which is reductant? 3. Calculate the half-cell potentials at both anode and cathode. 4. Calculate the cell potential. 5. Write the whole-cell reaction. 6. Calculate the equilibrium constant for the whole-cell reaction. For the half –...
6. Consider the following electrochemical cell: Write electrode half-reactions and the cell reaction. Determine the standard emf E for this cell from standard potential data in the Data Section of your textbook. Calculate the standard Gibbs energy and the equilibrium constant for the cell reaction at 25°C. Write the Nernst equation for the cell and calculate its emf E given that the pressure of H:(g) p = 1 bar, the molality of HCI(aq) b = 0.01 mol kg.. and the...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 21 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago