Which of the following is an example of an essential fatty acid for humans? Question 7 options: Arachidonic acid Linoleic acid Stearic acid Palmitic acid Myristic acid
Which of the following is an example of an essential fatty acid for humans? Question 7...
Triacylglycerol A contains 53% oleic acid, 29% linoleic acid, 9% palmitic acid, 4% stearic acid, 1% myristic acid and lesser amounts of other fatty acids. Triacylglycerol B contains 39% oleic acid, 29% palmitic acid, 24% stearic acid, 2% myristic acid, 2% linoleic acid, and lesser amounts of other fatty acids. Which of the two samples is expected to be solid at room temperature? Why pls? Thanks
WHICH OF THE FOLLOWING ARE DEEMED “ESSENTIAL” NUTRIENT: MONOUNSATURATED FATTY ACIDS, CHOLESTEROL, STEARIC ACID, LINOLEIC ACID, PHOSPHOLIPS
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
Fatty acids are carboxylic acids with a long, unbranched hydrocarbon chain. There are three main classes of fatty acids. Classify the fatty acids as saturated, monounsaturated, or polyunsaturated. Saturated Monounsaturated Polyunsaturated linoleic acid arachidonic acid oleic acid stearic acid palmitic acid
29. Draw the structure of the following compounds (choose one of the three columns Column A Column B Column Phosphatidylserine Prostaglandin B Oleic acid Palmitic acid Linoleic acid Cerebroside Thromboxane Glycerophospholipids Arachidonic acid Sphingosine Endoperoxides w-6-fatty acid Ceramide Leukotriene Lauric acid Stearic acid Myristic acid Ganglioside B-L-fucose Globoside Sialic acid
29. Draw the structure of the following compounds (choose gne of the three columns). Columa A Column B Column C Phosphatidyl serine Prostaglandin Oleic acid Cerebroside Palmitic acid Linoleic acid Arachidonic acid Glycerophospholipids Thromboxane w-6-fatty acid. Endoperoxides Sphingosine Lauric acid Leukotriene Ceramide Myristic acid Ganglioside Stearic acid B-L-fucose Globoside Sialic acid 1 l
Among the following fatty acids, which is the body not able to synthesize. (select all that apply) stearic acid linoleic acid oleic acid ascorbic acid eicosapentaenoic acid palmitic acid alpha-linolenic acid docosahexaenoic acid
Chemistry 1604 In class Lipids Name: Malio Gomez 1. Draw the following two fatty acids and circle the unsaturated fatty acid. 18:2412.15 20:0 w Which of the following molecules is NOT a naturally occurring fatty acid? 2. а но" с. Но b. CH3(CH2) CH=CH(CH2) CO2H d. Which of the fatty acids below has the highest melting point? 3. stearic acid но arachidonic acid palmitic acid c. arachidonic acid b. palmitic acid stearic acid a. for for short-term energy storage and...
Please show work so I can better understand why. Thank you What does "essential fatty acid" mean? Draw the structural formula of glycerol What is a triacylglycerol or triglyceride? Draw the condensed structural formula for the triglyceride made of linoleic acid, linolenic acid and stearic acid What is the function of triglycerols in the body?
Draw each of the following and identify the ω-6 fatty acid Linoleic acid Oleic acid Palmitic acid