Choose the structure formula of the water that can be formed from each reaction. a CH,CooH+...
7. Draw the structure of a wax formed from a 30-carbon straight chain alcohol and each carboxylic acid a. lauric acid b. myristic acid c. CH(CH3),COOH 8. What hydrolysis products are formed when each wax is treated with aqueous sulfurie acid? a. CH (CH)COO(CH2)2CH. b. CH:(CH2)24COO(CH2CH, c. CH(CH3)COO(CH2).CH; 9. Draw a triacylglycerol that fits each description: a. A triacylglycerol formed from two molecules of lauric acid and one molecule of palmitic acid b. A polyunsaturated triacylglycerol formed from three molecules...
12.18 Draw the condensed structural formula of the aldehyde or ketone formed when each of the following alcohols is oxidized [O] (if no reaction, write none): CH3 a. CH3-CH-CH2-CH2-OH ОН b. CH3-CH2-C- CH3 CH3 ) ОН c. CH3-CH2-CH-CH2-CH3 d. OH
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
CH2-0-CO-(CH2)10-CH3 | CH-O-CO-(CH2)10-CH3 | CH2-0-CO-(CH2)10-CH3 part-C Write the condensed structural formula(s) of the Products formed & identify the type of reaction taking place when the given Structure reacts with water in the presence of an enzyme. part-D Write the condensed structural formula(s) of the Products formed & identify the type of reaction taking place when the given Structure reacts with potassium hydroxide in the presence of an enzyme.
Complete the ionization reaction of butanoic acid (CH,CH,CH,COOH) in water. Include all hydrogen atoms and charges. Select Draw Rings More Erase // ICOH +H,0- HyC-CH2-CH2-C-OH + 0 2
[References) Choose the structures of the products that are formed when each of the following ethers is hydrolyzed: -CH2-O-CH2- (Select all that apply.) -CH2-CH2-OH CH2-OH -CH2-OH -CH2-CH2-OH OH OH O-CH2-CH3 CH3-CH2-CH2-CH-CH2-CH3 (Select all that apply.) D HO-CH2-CH3 OH CH3-CH2-CH2-CH-CH3 ОН CH3-CH2-CH2-CH-CH2-CH3 CHO-CH2-CH2-CH3 O CHE HO-CH-CH OH CH3-CH2-CH-CH2-CH3
Draw the structure of the principal product of the
soap that will be formed with the following reaction
CH3-0=C(CH)1.CH3 | CHO-C(CHI 4CH3 + 3NaOH TO CH2-O-C(CHD)/4CH
Draw the structure of the MAJOR ORGANIC compound formed in each reaction. Assume the reactions have been terminated and neutralized. a. Ethyl acetate NaOEVEtOH b. EtO C-CH2-CH2-CH2-CH2.CO2Et NaOEU/HOEt Ph-C(O)-CI c. (HaC).CH-CO2Et LDATHF + HO. d. Ethanal Ph-C(O)-H Ha0* (cat) e. Acetone + H2C O + Et NH f. Triethylamine HBr/H2O g. Ph-C(O)-NH2 + Br2 4 NaOH h. (H,C)2CH-C(CH)2 + N(CHs)s HO i.Ph-N2, Cl- CuCN- Na/E1OH HaO* (cat) j. cyclohexanone H2NOH Pd(OAc)2 (1 mole%) k. Ph- 4-O2N-CeHe-HC=CH2 Cul/Pd(PPhale L.HO-CH2-CH2-C-H1-CH-CH-(CH2),-CHg
6. Draw the condensed structural formula for the ester formed in each of the following reactions: C-OH H+, heat + CH3 -CH2-OH CH3 0 H*, heat CH3-CH-0-OH + CH2-OH = b
Draw the organic product formed in each reaction.
Draw the organic product formed in each reaction 2) NNH, (2 Equiv) -CH=CH- 1) CH3-CH2-c=c 2)H,00 HCI (1 Equiv) - CC-H 1) Choc 2) H30 1) NaH =CH-CH-CH, D.O нсас 8 | H (deuterated water) d CH3CH2CH2CH OH нсис " HCE C H.CH 2) сн.