Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a....
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene b. 3-methyl-4-ethylpent-4-ene C. 3-(isobutyl)but-3-ene d. 4-ethyl-3-methylpent-4-ene e. 2-ethyl-3-methylhex-2-ene f. 2-(sec-butyl)but-1-ene g. 2-ethyl-3-methylpent-1-ene
What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid O b. 2-Ethyl-1,7-dioxodecan-1-ol c. 3-Carboxy-8-oxoundecane d. 9-Ethyl-4-oxodecanoic acid e. 1-Hydroxydecan-1,7-dione f. 9-Ethyl-4-oxodecanal What is the correct IUPAC name for the following alkene? CH3 CH3CH2CHC=CH2 CH2CH3 a. 2-(sec-butyl)but-1-ene b. 3-isobutylbut-3-ene c. 4-ethyl-3-methylpent-4-ene d. 2-ethyl-3-methylpent-l-ene e. 3-methyl-4-ethylpent-4-ene f. 2-ethyl-3-methylhex-2-ene g. octene
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3 A) 4-chloro-4,5-dimethyl-2-hexene B) 3-chloro-1,3,4-trimethyl-1-pentene C) 3-chloro-2,3-dimethyl-4-hexene D) 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-1,3,4,4-tetramethyl-1-butene 2. Name the following compound. CH-CH2 CH,CH CH CCH H-CH A) 2,2-diethylpenatane B) 2,2-diethylpentene C) 4-ethyl-4-methyl-5-hexene D) 3-ethyl-3-methyl-1-hexene E) 4-ethyl-4-methylhexane 3. Name the following compound. CH CH CH, CH,CH CC CH CH2CH CH A) 3-butyl-3-propyl-1-pentyne B) 3-butyl-3-propyl-4-pentyne C) 3-ethyl-3-propyl-1-heptyne D) 5-ethyl-5-propyl-6-heptyne E) 3-ethyl-3-butyl-1-hexyne
Select the correct IUPAC name for the following branched alcohol. Select the correct IUPAC name for the following branched alcohol. CH3CHCH2CHCH2CH2CH2CH3 CH2CHCH2CHCH2CH3 CH3 CH2CH3 O 3-butyl-7-ethyl-1,5-dimethyl-2-nonanol 7-methyl-9-ethyl-5-(2-hydroxypropyl)undecane 4-butyl-8-ethyl-6-methyl-2-decanol 7-butyl-3-ethyl-5-methyl-9-decanol O
Give the correct IUPAC name for the following compound, CH3 CEC CH3-CH, CH, CH3 O a. 3-methyl-3-hexene Ob. 3-methyl-trans-3-hexene Oc. 2-ethyl-trans-2-pentene O d. 3-methyl-cis-3-hexene Oe. 2-ethyl-2-pentene QUESTION 6 The systematic name for the following is CH3CH2-C-CH-CH3 CH3 a. 2-methyl-3-pentanal b.2-methyl-3-pentanone c. ethyl isopropyl ketone d. 2-methyl-3-propanol e. 2-methyl-3-propanone
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
1. What is the IUPAC name of the following compound? CH, CH,CHCH.SH a. isobutyl mercaptan C. 2-methyl-1-propanthiol b. sec-butyl mercaptan d. 2-methyl-1-propanethiol
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
ter 5 HW Assignment ter 5 Reading Question 2 Part A 2,5-Diethyl-2-hexene is an incorrect IUPAC name for the following. CH3CH2CH(CH3)CH2CH=C(CH3)CH2CH3 The correct IUPAC name would be View Available Hint(s) 3-ethyl-5-methyl-4-octene 3,5-diethyl-4-hexene 3-methyl-5-ethyl-3-octene 3.5-dimethyl-3-octene Subm