Homework Answers
Add Answer to:
What is the systematic IUPAC name for the following Organic compound? OH O a. 2-Ethyl-7-oxodecanoic acid...
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene...
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene b. 3-methyl-4-ethylpent-4-ene C. 3-(isobutyl)but-3-ene d. 4-ethyl-3-methylpent-4-ene e. 2-ethyl-3-methylhex-2-ene f. 2-(sec-butyl)but-1-ene g. 2-ethyl-3-methylpent-1-ene
Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a....
Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a. 2-ethyl-3-methylhex-2-ene b. octene c. 3-isobutyl)but-3-ene d. 3-methyl-4-ethylpent-4-ene e. 4-ethyl-3-methylpent-4-ene f. 2-ethyl-3-methylpent-1-ene Gg. 2-(sec-butyl)but-1-ene A Moving to another question will save this response.
What is the systematic IUPAC name for the following Organic compound? ОН O o a. 3-Carboxy-8-oxoundecane...
What is the systematic IUPAC name for the following Organic compound? ОН O o a. 3-Carboxy-8-oxoundecane b. 1-Hydroxydecan-1,7-dione c. 9-Ethyl-4-oxodecanoic acid d. 2-Ethyl-1,7-dioxodecan-1-01 o e. 9-Ethyl-4-oxodecanal f. 2-Ethyl-7-oxodecanoic acid
help pleaseee What is the systematic IUPAC name for the following Organic compound? OH a. 2-Ethyl-1,7-dioxodecan-1-ol...
help pleaseee
What is the systematic IUPAC name for the following Organic compound? OH a. 2-Ethyl-1,7-dioxodecan-1-ol b.2-Ethyl-7-oxodecanoic acid c. 9-Ethyl-4-oxodecanoic acid d. 1-Hydroxydecan-1,7-dione e. 3-Carboxy-8-oxoundecane f. 9-Ethyl-4-oxodecanal Which mechanism(s) listed below generally proceed(s) smoothly when a low concentration of neutral nucleophile/base is used in the presence of a polar protic solvent? a. SN2 b. Sn2 and 2 c. Snl and E1 d. SNI e. El 1. E
Select the correct IUPAC name for the following branched alcohol. Select the correct IUPAC name for...
Select the correct IUPAC name for the following branched
alcohol.
Select the correct IUPAC name for the following branched alcohol. CH3CHCH2CHCH2CH2CH2CH3 CH2CHCH2CHCH2CH3 CH3 CH2CH3 O 3-butyl-7-ethyl-1,5-dimethyl-2-nonanol 7-methyl-9-ethyl-5-(2-hydroxypropyl)undecane 4-butyl-8-ethyl-6-methyl-2-decanol 7-butyl-3-ethyl-5-methyl-9-decanol O
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
What is the correct systematic name for the compound shown here? CH3 CH3 Нас OH 3-...
What is the correct systematic name for the compound shown here? CH3 CH3 Нас OH 3- 6- 2- 5- 4- 1- tri di methyl hex pent ethyl ene al ol oic acid an ane
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the...
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: | methyl ethanoatone CH3CH2CH2CCH2CH3 systematic (IUPAC) name: ethyl propanoatone What is the IUPAC name for the compound shown? IUPAC name:
What is the systematic IUPAC name for the following Organic compound? O a. Ethylpentanoate b. Pentylethanoate...
What is the systematic IUPAC name for the following Organic compound? O a. Ethylpentanoate b. Pentylethanoate c. Octan-2,4-dione d. Butanoic methanoic anhydride e. 2,4-Dioxo)ethoxypentane f. Ethanoic pentanoic anhydride
What is the systematic IUPAC name for the following Organic compound? -CEN a. 3-Phenylpropanenitrile b. 1-Cyano-2-phenylethane...
What is the systematic IUPAC name for the following Organic compound? -CEN a. 3-Phenylpropanenitrile b. 1-Cyano-2-phenylethane c. 2-Cyano-1-Phenylethane d. Cyclohexatrienylethanenitrile e. Benzonitrile f. 2-Phenylethanenitrile What is the systematic IUPAC name for the following Organic compound? o a. Pentanoic propanoic anhydride b. Pentylbutanoate c. Propylpentanoate d. Decan-4-one. e. Butylpentanoate f. Pentoxybutyl ketone What is the systematic IUPAC name for the following Organic compound? o a. Butanoic methanoic anhydride b. Ethanoic pentanoic anhydride c. Octan-2,4-dione O d. Pentylethanoate e. Ethylpentanoate f. 2,4-(Dioxo)ethoxypentane
What is the correct IUPAC name for the following alkene? CH CHỊCH,CHC-CH CH2CH3 O a. octene b. 3-methyl-4-ethylpent-4-ene C. 3-(isobutyl)but-3-ene d. 4-ethyl-3-methylpent-4-ene e. 2-ethyl-3-methylhex-2-ene f. 2-(sec-butyl)but-1-ene g. 2-ethyl-3-methylpent-1-ene
Question 12 What is the correct IUPAC name for the following alkene? CH3 CHỊCH,CHC=CH, CH2CH3 a. 2-ethyl-3-methylhex-2-ene b. octene c. 3-isobutyl)but-3-ene d. 3-methyl-4-ethylpent-4-ene e. 4-ethyl-3-methylpent-4-ene f. 2-ethyl-3-methylpent-1-ene Gg. 2-(sec-butyl)but-1-ene A Moving to another question will save this response.
What is the systematic IUPAC name for the following Organic compound? ОН O o a. 3-Carboxy-8-oxoundecane b. 1-Hydroxydecan-1,7-dione c. 9-Ethyl-4-oxodecanoic acid d. 2-Ethyl-1,7-dioxodecan-1-01 o e. 9-Ethyl-4-oxodecanal f. 2-Ethyl-7-oxodecanoic acid
help pleaseee
What is the systematic IUPAC name for the following Organic compound? OH a. 2-Ethyl-1,7-dioxodecan-1-ol b.2-Ethyl-7-oxodecanoic acid c. 9-Ethyl-4-oxodecanoic acid d. 1-Hydroxydecan-1,7-dione e. 3-Carboxy-8-oxoundecane f. 9-Ethyl-4-oxodecanal Which mechanism(s) listed below generally proceed(s) smoothly when a low concentration of neutral nucleophile/base is used in the presence of a polar protic solvent? a. SN2 b. Sn2 and 2 c. Snl and E1 d. SNI e. El 1. E
Select the correct IUPAC name for the following branched
alcohol.
Select the correct IUPAC name for the following branched alcohol. CH3CHCH2CHCH2CH2CH2CH3 CH2CHCH2CHCH2CH3 CH3 CH2CH3 O 3-butyl-7-ethyl-1,5-dimethyl-2-nonanol 7-methyl-9-ethyl-5-(2-hydroxypropyl)undecane 4-butyl-8-ethyl-6-methyl-2-decanol 7-butyl-3-ethyl-5-methyl-9-decanol O
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
What is the correct systematic name for the compound shown here? CH3 CH3 Нас OH 3- 6- 2- 5- 4- 1- tri di methyl hex pent ethyl ene al ol oic acid an ane
What is the IUPAC name for the compound shown? 0 o= IUPAC name: propan-1-ol Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: | methyl ethanoatone CH3CH2CH2CCH2CH3 systematic (IUPAC) name: ethyl propanoatone What is the IUPAC name for the compound shown? IUPAC name:
What is the systematic IUPAC name for the following Organic compound? O a. Ethylpentanoate b. Pentylethanoate c. Octan-2,4-dione d. Butanoic methanoic anhydride e. 2,4-Dioxo)ethoxypentane f. Ethanoic pentanoic anhydride
What is the systematic IUPAC name for the following Organic compound? -CEN a. 3-Phenylpropanenitrile b. 1-Cyano-2-phenylethane c. 2-Cyano-1-Phenylethane d. Cyclohexatrienylethanenitrile e. Benzonitrile f. 2-Phenylethanenitrile What is the systematic IUPAC name for the following Organic compound? o a. Pentanoic propanoic anhydride b. Pentylbutanoate c. Propylpentanoate d. Decan-4-one. e. Butylpentanoate f. Pentoxybutyl ketone What is the systematic IUPAC name for the following Organic compound? o a. Butanoic methanoic anhydride b. Ethanoic pentanoic anhydride c. Octan-2,4-dione O d. Pentylethanoate e. Ethylpentanoate f. 2,4-(Dioxo)ethoxypentane
Most questions answered within 3 hours.
-
ECO
2013 &
asked 1 minute ago -
Insight refers to:
a.
Adaptive decision-making
b.
Credibility and trustworthness
c.
Understanding of one's problems
d....
asked 7 minutes ago -
Explain the differences between rights and permissions within
Windows. Define the principle of least privilege and...
asked 14 minutes ago -
A solid, frictionless cylindrical reel of mass M=5.00kg and
radius R=0.55m is used to draw water...
asked 16 minutes ago -
how do radio waves get emitted from Jupiter?
- do they come from radiation from planet...
asked 17 minutes ago -
The test statistic used in the F test for the equality of two
variances is calculated...
asked 29 minutes ago -
How does neutralisation of IL-6 trans-signaling affect the
autoimmune disease and inflammation? What if the trans-signaling...
asked 19 minutes ago -
f an allele is 'fixed' in a population, what is its
frequency?
0.50
0.75
0.25
0...
asked 33 minutes ago -
Do we have a duty of national loyalty in business? What is the
major argument in...
asked 33 minutes ago -
compare the international treatment of segment reporting to the
us gaap treatment
asked 30 minutes ago -
A statistics student finds herself struggling with a newspaper
article stating that only eighteen percent of...
asked 1 hour ago -
People with beriberi, a disease caused by a thiamin deficiency,
have elevated levels of blood pyruvate...
asked 50 minutes ago