Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
1/8 1. (5 pts.) A student is trying to choose an organic compound that will yield...
fastest hydroly: butanoate, benzoic propanoic anhydride, use? Explain your answer. 2. (4 pts.) Which compound(s) would...
fastest hydroly: butanoate, benzoic propanoic anhydride, use? Explain your answer. 2. (4 pts.) Which compound(s) would undergo nucleophilic acyl addition? Explain your answer. N- cyclohexylpropanamide 4-hydroxypentanal cyclohexanone hexanoyl chloride structure of (R)-2-phenylbutanamide
1-10 Name: Total 100 pts (25X4 pts) 1) Which of the following is the best name...
1-10
Name: Total 100 pts (25X4 pts) 1) Which of the following is the best name for the following compound? A) 1,2-Dichloropentanal )1-Chloro-1-butanecarbonyl chloride C) 2-Chloropentanoyl D) 1-Chloropentanoyl chloride 2) Which of the following is the best name for the following compound? 0 a) tsobutyl ethanoate d) Ethoxy isobutyl ketone b) Ethyl isopropanoate c) 3-methylbutyl ethanoate e) Ethyl 3-methylbutanoate 3) Which compound would have highest pKa? E) D) B) A) 4) Which of the following would be the strongest acid?...
Experiment 12: Synthesis of Benzoic Acid pre-lab (4 pts) 1 (2 pts) Refer to the introduction...
Experiment 12: Synthesis of Benzoic Acid pre-lab (4 pts) 1 (2 pts) Refer to the introduction on the general process of hydrolysis of nitriles to carboxylic acids. Starting with benzonitrile (shown below), show how it is converted to benzoic acid under basic conditions. N 2) (2 pts) The reaction for the synthesis of benzoic acid via benzonitrile hydrolysis is shown below: 1) NaOH, HO YOH + NaCl 2) HCI, H,0 Benzonitrile Density = 1.0 g/mL MM = 103.04 g/mol Benzoic...
1) Draw the structure for each named compound: a) (Z)-N-ethyl-3-bromo-2-isopropyl-5- b) propanoyl chloride methyl-2-hexenamide c) benzoic...
1) Draw the structure for each named compound: a) (Z)-N-ethyl-3-bromo-2-isopropyl-5- b) propanoyl chloride methyl-2-hexenamide c) benzoic anhydride d) (R)-3-chloro-4-ethylhexanoic acid e) ethyl 4-methylpentanoate f) pentanenitrile g) cyclohexanecarboxamide h) octyl butanoate 2) Provide an IUPAC name for each structure: b) 9 CH d) CH.CH нс снсон TH Page
Question 8 1 pts Rank the following in order of acidity-#1 being the strongest acid Assume...
Question 8 1 pts Rank the following in order of acidity-#1 being the strongest acid Assume that the universe is finite. Compound A OH Compound B: OH Compound C HO Compound D CH2 Compound A HO Compound D CH2 Compound A IChoose ] Water IChoose ] HF IChoose ] Compound B IChoose ] propane IChoose ] HCI IChoose ] Compound C IChoose ] Compound D IChoose ] Question 3 1 pts You have a 50/50 mixture of fluorene and aniline...
please answer them 7 and 8 7. A student was given an unknown compound X, which...
please answer them 7 and 8
7. A student was given an unknown compound X, which is one of the four compounds listed below. Substance Literature Melting Point (°C) o-toluic acid 102 122 m-aminophenol benzoic acid Phenyl succinate 122 121 . A mixture of X with benzoic acid melts at 92°C, a mixture of X with phenyl succinate melts at 120°C and a mixture of X with m-amino phenol melts at 102°C. The student wrote that the unknown compound is...
Qualitative Analysis of Organic Compounds: Pre lab questions (5 pts) 1. (1 point) Identify the functional...
Qualitative Analysis of Organic Compounds: Pre lab questions (5 pts) 1. (1 point) Identify the functional groups based on color / odor a. Dark yellow to red color indicates that the functional group could possibly be------------- b. Fruity / Floral odor indicates that the functional group could possibly be------------- c. Fishy odor indicates that the functional group could possibly be------------- d. Sharp, biting odor indicates that the functional group could possibly be------------- 2. (0.5 pts) If a liquid is soluble...
(3 pts each, unless otherwise noted, 17 pts total) 1-5. Nomenclature: provide an acceptable name for...
(3 pts each, unless otherwise noted, 17 pts total) 1-5. Nomenclature: provide an acceptable name for each of the following compounds, but do NOT Google. 1. 2. 3. -CO No HN -CO,H COM 5. (5 pts) Name IUPAC ONLY. i HN-CHE H-C-N(CH)2 (4 pts each, unless otherwise noted, 16 pts total) 6-9. Structures: provide an acceptable structure for: 6. the isobutyl diester of B-bromopimelic acid (5 pts) 7. N-ethyl-B-ethyl-y-valerylactam. 8. benzoic B-chloropropionic anhydride (3 pts) 9. o-bromobenzoyl chloride
Question 5 1 pts A student in the organic lab does the reaction seen below. What...
Question 5 1 pts A student in the organic lab does the reaction seen below. What would be observed in the IR spectra to indicate that the reaction occurred as written below? OH H20+ The student would see a medium band around 3100-3000 in the product that was not in the starting material. The student would see a large, rounded band at 3200-3400 in the product that was not in the starting material. The student would see a large, rounded...
1) Choose one molecule from the set and create an 8-step synthesis scheme using the chosen...
1) Choose one molecule from the set and create an 8-step synthesis scheme using the chosen molecule as your starting material. You need to write the complete set of reagents and draw the product expected from each step. Reagents typically used together are considered one step, e.g. 1) LAH 2) H2O should be considered as one step. Your 8 steps must include at least one reaction from each of the chapters, aldehydes and ketones, carboxylic acid derivatives, alcohols. You can...
fastest hydroly: butanoate, benzoic propanoic anhydride, use? Explain your answer. 2. (4 pts.) Which compound(s) would undergo nucleophilic acyl addition? Explain your answer. N- cyclohexylpropanamide 4-hydroxypentanal cyclohexanone hexanoyl chloride structure of (R)-2-phenylbutanamide
1-10
Name: Total 100 pts (25X4 pts) 1) Which of the following is the best name for the following compound? A) 1,2-Dichloropentanal )1-Chloro-1-butanecarbonyl chloride C) 2-Chloropentanoyl D) 1-Chloropentanoyl chloride 2) Which of the following is the best name for the following compound? 0 a) tsobutyl ethanoate d) Ethoxy isobutyl ketone b) Ethyl isopropanoate c) 3-methylbutyl ethanoate e) Ethyl 3-methylbutanoate 3) Which compound would have highest pKa? E) D) B) A) 4) Which of the following would be the strongest acid?...
Experiment 12: Synthesis of Benzoic Acid pre-lab (4 pts) 1 (2 pts) Refer to the introduction on the general process of hydrolysis of nitriles to carboxylic acids. Starting with benzonitrile (shown below), show how it is converted to benzoic acid under basic conditions. N 2) (2 pts) The reaction for the synthesis of benzoic acid via benzonitrile hydrolysis is shown below: 1) NaOH, HO YOH + NaCl 2) HCI, H,0 Benzonitrile Density = 1.0 g/mL MM = 103.04 g/mol Benzoic...
1) Draw the structure for each named compound: a) (Z)-N-ethyl-3-bromo-2-isopropyl-5- b) propanoyl chloride methyl-2-hexenamide c) benzoic anhydride d) (R)-3-chloro-4-ethylhexanoic acid e) ethyl 4-methylpentanoate f) pentanenitrile g) cyclohexanecarboxamide h) octyl butanoate 2) Provide an IUPAC name for each structure: b) 9 CH d) CH.CH нс снсон TH Page
Question 8 1 pts Rank the following in order of acidity-#1 being the strongest acid Assume that the universe is finite. Compound A OH Compound B: OH Compound C HO Compound D CH2 Compound A HO Compound D CH2 Compound A IChoose ] Water IChoose ] HF IChoose ] Compound B IChoose ] propane IChoose ] HCI IChoose ] Compound C IChoose ] Compound D IChoose ] Question 3 1 pts You have a 50/50 mixture of fluorene and aniline...
please answer them 7 and 8
7. A student was given an unknown compound X, which is one of the four compounds listed below. Substance Literature Melting Point (°C) o-toluic acid 102 122 m-aminophenol benzoic acid Phenyl succinate 122 121 . A mixture of X with benzoic acid melts at 92°C, a mixture of X with phenyl succinate melts at 120°C and a mixture of X with m-amino phenol melts at 102°C. The student wrote that the unknown compound is...
(3 pts each, unless otherwise noted, 17 pts total) 1-5. Nomenclature: provide an acceptable name for each of the following compounds, but do NOT Google. 1. 2. 3. -CO No HN -CO,H COM 5. (5 pts) Name IUPAC ONLY. i HN-CHE H-C-N(CH)2 (4 pts each, unless otherwise noted, 16 pts total) 6-9. Structures: provide an acceptable structure for: 6. the isobutyl diester of B-bromopimelic acid (5 pts) 7. N-ethyl-B-ethyl-y-valerylactam. 8. benzoic B-chloropropionic anhydride (3 pts) 9. o-bromobenzoyl chloride
Question 5 1 pts A student in the organic lab does the reaction seen below. What would be observed in the IR spectra to indicate that the reaction occurred as written below? OH H20+ The student would see a medium band around 3100-3000 in the product that was not in the starting material. The student would see a large, rounded band at 3200-3400 in the product that was not in the starting material. The student would see a large, rounded...
1) Choose one molecule from the set and create an 8-step synthesis scheme using the chosen molecule as your starting material. You need to write the complete set of reagents and draw the product expected from each step. Reagents typically used together are considered one step, e.g. 1) LAH 2) H2O should be considered as one step. Your 8 steps must include at least one reaction from each of the chapters, aldehydes and ketones, carboxylic acid derivatives, alcohols. You can...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 6 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 7 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 21 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago