Identify the components of each lipid and classify it as a triacylglycerol, a phosphoacylglycerol, or a sphingomyelin. Classify any phosphoacylglycerol as a cephalin or lecithin.
1. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
2. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
3. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
Lipid: OPTIONS (sphingomyelin) (phosphoacylglycerol, cephalin) (phosphoacylglycerol, lecithin) (triacylglycerol)
1. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
2. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
3. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
Lipid: OPTIONS (sphingomyelin) (phosphoacylglycerol, cephalin) (phosphoacylglycerol, lecithin) (triacylglycerol)
1. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
2. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
3. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative)
Lipid: OPTIONS (sphingomyelin) (phosphoacylglycerol, cephalin) (phosphoacylglycerol, lecithin) (triacylglycerol)
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Identify the components of each lipid and classify it as a
triacylglycerol, a phosphoacylglycerol, or a...
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid...
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid glycerophospholipid The hydrolysis of an unknown lipid produces one glycerol molecule, two stearic acid molecules, choline, and an (unspecified) anion. What kind of lipid was the unknown? O a wax O a triacylglycerol O a glycerophospholipid O a fatty acid O a sphingomyelin What is the correct number for the ketone functional group in this structure? CH, NH, НО CH, | / NH7 Н-...
1) 2) Name each of the following aldehydes and ketones. 3) 4) A carboxylic acid reacts...
1)
2)
Name each of the following aldehydes and ketones.
3)
4)
A carboxylic acid reacts an alcohol to form ________.
an ether
an amine
an anhydride
an ester
an amide
5)
A carboxylic acid reacts with itself to form ________.
an amine
an ether
an anhydride
an ester
an amide
6)
7)
8)
Give the organic product for the following reaction.
CH3CH2COOH + CH3CH2CH2NH2 ?
CH3CH2CH2CONHCH2CH3
CH3CH2NHCH2CH2CH3
CH3CH2N(CH2CH2CH3)2
CH3CH2CON(CH2CH2CH3)2
CH3CH2CONHCH2CH2CH3
Determine the products of the following reaction: CH H2S04...
Question 42 The steps below represent how triacylglycerols (TAGS) are processed during metabolism (stages). Organize them...
Question 42 The steps below represent how triacylglycerols (TAGS) are processed during metabolism (stages). Organize them in the correct order of events. 3) Hydrolysis of TAGS Fatty acyl-CoA production Beta-oxidation 6 points During the digestion of polysaccharides (starch), proteins and triacylglycerol the respectively and functional groups are hydrolyzed acetal disulfide ester amide alkene carboxylic acid hemiacetal Moving to another question will save this response. Question 356 Use the fatty acids below to answer complete the following: OH Fatty acid A...
1. write how many hydrogens are present around each indicated atom OH 2. Identify the type...
1. write how many hydrogens are present around each indicated atom OH 2. Identify the type of organic molecule. Options: ALKANE, ALKENE, ALKYNE, AROMATIC, ETHER, ESTER, ALCOHOL, ALDEHYDE KETONE, THOL, AMIDE, AMINE, CARBOXYLIC ACID a. CH3 H3C-CH2-c-0CH3 CH3 b. 3. Name the organic compound a. Br CH2CH3 CH-CH-CH-CH-04-04-CH, 4.Draw the complete balanced chemical equation for the halogenation reaction of 1-pentene by bromine gas, Br2(g).
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6-...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
4. Classify each of the following reactions as: Acid/ Base, Addition, Elimination, Reduction, Oxidation, Condensation, or...
4. Classify each of the following reactions as: Acid/ Base, Addition, Elimination, Reduction, Oxidation, Condensation, or Hydrolysis. (7 points each) a. CH3CH2OH [O] + CH3-CH (H2) [O] P → CH-E-OH (+0) (conc. Acid and heat) b. CH3-CH2-CH2-OH CH3-CH=CH2 + H2O (Pt cat) c. CH3-CH=CH2 + H2 → CH3CH2CH3
16. Lipid II is labeled A-D. Which of the labeled parts of this molecule comprise the sphingosine backbone? 0-C(CH2...
16. Lipid II is labeled A-D. Which of the labeled parts of this molecule comprise the sphingosine backbone? 0-C(CH2),CH=CH(CH2),CH3 0-C(CH2)16CH3 AHC(HC).HC=HG- O CICHOCH 0-P- O N (CH3), 0-000=0 N(CH3)3 A) B) C) D E) A only A and B B and C A, B, and D The sphingosine backbone is composed of all of the labeled parts of the molecule.
Identify the compound with the higher boiling point in each of the following pairs of compounds:...
Identify the compound with the higher boiling point in each of the following pairs of compounds: 1. CH2-CH2-OH or H--C--0--CHz OH 2. CHz---0-CH3 or CH3-CH-CH2-CH3 0 2, CH, -- pH 3. CHz--2-0-CH, or CH3-CH2-CH2-CH2-CH3 Write the products of hydrolysis or saponification for the following esters. н" 1. CH3-CH-CH2--0--0--CH3 + H2O O 2, CH4-C-0-CH + NaOH 3. O -8-6-CH2-CH; -CH ---CH3 + KOH — -0--CH-CH2-CH3 + H20 - Properties of Esters sters shave higher boiling points than alkanes but lower than...
37) IUPAC name the following structure... Cl A) Ethyl -2-Chlorobenzoate B) Ethyl-2-Chlorobenzoic acid C) Chlorobenzoic acid...
37) IUPAC name the following structure... Cl A) Ethyl -2-Chlorobenzoate B) Ethyl-2-Chlorobenzoic acid C) Chlorobenzoic acid -2- ethyl D) Methyl-2-Chlorobenzoate E) None of the above 40) What is the major organic product of the reaction shown? ???-(CH2 ) 3-???? +CH3 CH CH3 ?? 0 0 B) CH3-(CH2 ) 3-?-?-??-(CH3)2 0 C) CH3 (CH2 )2 C-O CH (CH3)2 ?? D) CH3-(CH2 ) 3-CH-o-cH-(CH3) 2 49) When an amine reacts with a carboxylic acid at high temperature the major product is A)...
Select the type of lipid for each of the numbered lipids below. НО 4U HN HOT...
Select the type of lipid for each of the numbered lipids below. НО 4U HN HOT Lipid 1 [Select Lipid 2 [Selest! Lipid 3 (Select Lipid 4 [Select Question 14 What is the name of the boxed head group of Lipid 42 ethanolamine slycerol choline serine o inositol Question 15 What is the carbon skeleton name of the boxed chain in Lipid 3? [Select] : [Select) [Select ) Question 16 You suspect that Lipid 3 may have been chemically hydrogenated....
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid glycerophospholipid The hydrolysis of an unknown lipid produces one glycerol molecule, two stearic acid molecules, choline, and an (unspecified) anion. What kind of lipid was the unknown? O a wax O a triacylglycerol O a glycerophospholipid O a fatty acid O a sphingomyelin What is the correct number for the ketone functional group in this structure? CH, NH, НО CH, | / NH7 Н-...
1)
2)
Name each of the following aldehydes and ketones.
3)
4)
A carboxylic acid reacts an alcohol to form ________.
an ether
an amine
an anhydride
an ester
an amide
5)
A carboxylic acid reacts with itself to form ________.
an amine
an ether
an anhydride
an ester
an amide
6)
7)
8)
Give the organic product for the following reaction.
CH3CH2COOH + CH3CH2CH2NH2 ?
CH3CH2CH2CONHCH2CH3
CH3CH2NHCH2CH2CH3
CH3CH2N(CH2CH2CH3)2
CH3CH2CON(CH2CH2CH3)2
CH3CH2CONHCH2CH2CH3
Determine the products of the following reaction: CH H2S04...
Question 42 The steps below represent how triacylglycerols (TAGS) are processed during metabolism (stages). Organize them in the correct order of events. 3) Hydrolysis of TAGS Fatty acyl-CoA production Beta-oxidation 6 points During the digestion of polysaccharides (starch), proteins and triacylglycerol the respectively and functional groups are hydrolyzed acetal disulfide ester amide alkene carboxylic acid hemiacetal Moving to another question will save this response. Question 356 Use the fatty acids below to answer complete the following: OH Fatty acid A...
1. write how many hydrogens are present around each indicated atom OH 2. Identify the type of organic molecule. Options: ALKANE, ALKENE, ALKYNE, AROMATIC, ETHER, ESTER, ALCOHOL, ALDEHYDE KETONE, THOL, AMIDE, AMINE, CARBOXYLIC ACID a. CH3 H3C-CH2-c-0CH3 CH3 b. 3. Name the organic compound a. Br CH2CH3 CH-CH-CH-CH-04-04-CH, 4.Draw the complete balanced chemical equation for the halogenation reaction of 1-pentene by bromine gas, Br2(g).
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
4. Classify each of the following reactions as: Acid/ Base, Addition, Elimination, Reduction, Oxidation, Condensation, or Hydrolysis. (7 points each) a. CH3CH2OH [O] + CH3-CH (H2) [O] P → CH-E-OH (+0) (conc. Acid and heat) b. CH3-CH2-CH2-OH CH3-CH=CH2 + H2O (Pt cat) c. CH3-CH=CH2 + H2 → CH3CH2CH3
16. Lipid II is labeled A-D. Which of the labeled parts of this molecule comprise the sphingosine backbone? 0-C(CH2),CH=CH(CH2),CH3 0-C(CH2)16CH3 AHC(HC).HC=HG- O CICHOCH 0-P- O N (CH3), 0-000=0 N(CH3)3 A) B) C) D E) A only A and B B and C A, B, and D The sphingosine backbone is composed of all of the labeled parts of the molecule.
Identify the compound with the higher boiling point in each of the following pairs of compounds: 1. CH2-CH2-OH or H--C--0--CHz OH 2. CHz---0-CH3 or CH3-CH-CH2-CH3 0 2, CH, -- pH 3. CHz--2-0-CH, or CH3-CH2-CH2-CH2-CH3 Write the products of hydrolysis or saponification for the following esters. н" 1. CH3-CH-CH2--0--0--CH3 + H2O O 2, CH4-C-0-CH + NaOH 3. O -8-6-CH2-CH; -CH ---CH3 + KOH — -0--CH-CH2-CH3 + H20 - Properties of Esters sters shave higher boiling points than alkanes but lower than...
37) IUPAC name the following structure... Cl A) Ethyl -2-Chlorobenzoate B) Ethyl-2-Chlorobenzoic acid C) Chlorobenzoic acid -2- ethyl D) Methyl-2-Chlorobenzoate E) None of the above 40) What is the major organic product of the reaction shown? ???-(CH2 ) 3-???? +CH3 CH CH3 ?? 0 0 B) CH3-(CH2 ) 3-?-?-??-(CH3)2 0 C) CH3 (CH2 )2 C-O CH (CH3)2 ?? D) CH3-(CH2 ) 3-CH-o-cH-(CH3) 2 49) When an amine reacts with a carboxylic acid at high temperature the major product is A)...
Select the type of lipid for each of the numbered lipids below. НО 4U HN HOT Lipid 1 [Select Lipid 2 [Selest! Lipid 3 (Select Lipid 4 [Select Question 14 What is the name of the boxed head group of Lipid 42 ethanolamine slycerol choline serine o inositol Question 15 What is the carbon skeleton name of the boxed chain in Lipid 3? [Select] : [Select) [Select ) Question 16 You suspect that Lipid 3 may have been chemically hydrogenated....
Most questions answered within 3 hours.
-
Write a JavaScript program to implement the Least-Squares Linear
Regression algorithm shown below, for an arbitrary...
asked 7 minutes ago -
Determine the solubility of Cadmium in equilibrium with Cadmium
hydroxide, Cd(OH)2, as a function of pH....
asked 10 minutes ago -
When 34.2 grams of strontium reacts with excess molecular
oxygen, how many grams of the product...
asked 21 minutes ago -
nformation related to the Berkley Company for the calendar year
2015 follows:
Liabilities, December 31, 2015...
asked 13 minutes ago -
Please help!
A voltaic cell consists of a Mn/Mn2+ anode (E°= -1.18 V) and a
Fe/Fe2+...
asked 30 minutes ago -
If the consumer price index was 166.6 in 2017 and 167.0 in 2016,
calculate the annual...
asked 25 minutes ago -
Marvin Williams is a 53-year-old farmer. He, along with the
other members of his family, operates...
asked 26 minutes ago -
Scenario:
You own a chain of department stores. You currently have 19
stores. The stores are...
asked 28 minutes ago -
Suppose a firm has a retention ratio of 49 percent and net
income of $8.3 million....
asked 34 minutes ago -
1. A 1200 kg car is practicing on a flat test
track. The car begins moving...
asked 1 hour ago -
An
agency collects demographics concerning the number of people in
families per household in a certain...
asked 1 hour ago -
Writing a Persuasive Essay on:
(Smoking in public places should be banned) Can i please get...
asked 1 hour ago