Describe how adherens junctions can give rise to invaginations of the ectoderm (4 pts)
Describe how adherens junctions can give rise to invaginations of the ectoderm (4 pts)
Homework Answers
EAdherens junction are protein complexes that occur at cell junctions in epithelial and endothelial tissues, usually more basal than tight junctions.Adherens junctions help epithelial surfaces resist separation during various contractile activities, as when food moves through the intestines.Adherens junctions help epithelial surfaces resist separation during various contractile activities, as when food moves through the intestines.
.
Add Answer to:
Describe how adherens junctions can give rise to invaginations
of the ectoderm (4 pts)
Please answer all :) 1. The [v] includes somites, which give rise to [w). The ectoderm...
Please answer all
:)
1. The [v] includes somites, which give rise to [w). The ectoderm includes the [x), which gives rise to the lyl. The [z] gives rise to the gut. Answer Choices: endoderm mesoderm muscles . ectoderm brain and spinal cord e gut neural tube . somites . notochord Which of the following land plant characteristics are NOT found in green algae? MULTIPLE ANSWERS CAN BE SELECTED 2. a. embryo retention b. cell walls made of cellulose c....
10. Describe how different G protein-coupled receptors can give rise to the synthesis of different 2nd messengers. EXTRA 5 points: Name three such G protein-induced 2nd messengers and name their...
10. Describe how different G protein-coupled receptors can give rise to the synthesis of different 2nd messengers. EXTRA 5 points: Name three such G protein-induced 2nd messengers and name their subsequent target.
10. Describe how different G protein-coupled receptors can give rise to the synthesis of different 2nd messengers. EXTRA 5 points: Name three such G protein-induced 2nd messengers and name their subsequent target.
Question 7 4 pts This embryonic germ layer is only found in Bilateria. O a.) ectoderm...
Question 7 4 pts This embryonic germ layer is only found in Bilateria. O a.) ectoderm O b.) endoderm c.) mesoderm O a and b O a, b, and
Question 3 [1.3 pts] What type of proton NMR signal will proton Hc give rise to?...
Question 3 [1.3 pts] What type of proton NMR signal will proton Hc give rise to? Hc Ho Question 4 [1.3 pts] What type of proton NMR signal will proton Ho give rise to?
6. Describe the processes that give rise to mature mRNA (capping and splicing)
6. Describe the processes that give rise to mature mRNA (capping and splicing)
Explain how a small number of mutations can give rise to a new morphological type. Explain...
Explain how a small number of mutations can give rise to a new morphological type. Explain how organisms evolve and diversify.
Identify four distinct sources of monopoly. Very briefly describe the market conditions that give rise to...
Identify four distinct sources of monopoly. Very briefly describe the market conditions that give rise to natural monopoly.
1. Be able to describe/define an animal 2. Be able to describe the early steps in...
1. Be able to describe/define an animal 2. Be able to describe the early steps in animal development (including cleavage, formation of a blastula, and gastrulation) 3. Know the structures and tissue layers associated with a gastrula (e.g., blastopore, ectoderm, endoderm, etc.) 4. Know why animals are considered to be closely related to choanoflagellates 5. Be able to briefly describe the early radiations of animals (Ediacaran, Cambrian explosion) 6. Know that animal body plans are characterized by symmetry, the number...
How do organizational processes give rise to potential failures?
How do organizational processes give rise to potential failures?
how do externalities give rise to government intervention in the market?
how do externalities give rise to government intervention in the market?
Please answer all
:)
1. The [v] includes somites, which give rise to [w). The ectoderm includes the [x), which gives rise to the lyl. The [z] gives rise to the gut. Answer Choices: endoderm mesoderm muscles . ectoderm brain and spinal cord e gut neural tube . somites . notochord Which of the following land plant characteristics are NOT found in green algae? MULTIPLE ANSWERS CAN BE SELECTED 2. a. embryo retention b. cell walls made of cellulose c....
10. Describe how different G protein-coupled receptors can give rise to the synthesis of different 2nd messengers. EXTRA 5 points: Name three such G protein-induced 2nd messengers and name their subsequent target.
10. Describe how different G protein-coupled receptors can give rise to the synthesis of different 2nd messengers. EXTRA 5 points: Name three such G protein-induced 2nd messengers and name their subsequent target.
Question 7 4 pts This embryonic germ layer is only found in Bilateria. O a.) ectoderm O b.) endoderm c.) mesoderm O a and b O a, b, and
Question 3 [1.3 pts] What type of proton NMR signal will proton Hc give rise to? Hc Ho Question 4 [1.3 pts] What type of proton NMR signal will proton Ho give rise to?
6. Describe the processes that give rise to mature mRNA (capping and splicing)
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago