Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
it's asking for the rate constant
pr The reaction pt 2NO(9) + Cl2(g) + 2NOCI(9) pr...
The reaction 2NO(g) + Cl2(9) - 2NOCI(9) was studied at a constant temperature and the following...
The reaction 2NO(g) + Cl2(9) - 2NOCI(9) was studied at a constant temperature and the following results were obtained. 2.3 [NO]initial (Cilinitial Initial rate (M/min) 0.44 M 0.21 M 0.44 M 0.42 M 0.88 M 0.42 M 4.6 Rate is defined as the change in (CI) over time. Part 1: What is the order of the reaction with respect to NO? 2 Submit OK Part 2: What is the order of the reaction with respect to Cl? 1 Submit OK...
Select all that apply. The rate law for the reaction 2NO(g) + Cl2(g) → 2NOCI(g) is...
Select all that apply. The rate law for the reaction 2NO(g) + Cl2(g) → 2NOCI(g) is given by R-k[NO][C121 If the following is the mechanism for the reaction, NO(g) + Cl2(g) → NOC12(g) NOCI,(g) + NO(g) → 2NOCI(g) which of the following statements accurately describes this reaction? Check all that apply. 2nd order reaction The first step is the slow step. Doubling [NO] would quadruple the rate. Cutting (Cl) in half would decrease the rate by a factor of two....
63. At 35°C, K = 1.6 x 10-6 for the reaction 2NOCI(9) = 2NO(g) + Cl2...
63. At 35°C, K = 1.6 x 10-6 for the reaction 2NOCI(9) = 2NO(g) + Cl2 (9) Calculate the concentrations of all species at equilibrium for each of the following original mixtures. a. 2.0 moles of pure NOCI in a 2.0-L flask Answer b. 1.0 mole of NOCI and 1.0 mole of NO in a 1.0-L flask Answer c. 2.0 moles of NOCI and 1.0 mole of Cl, in a 1.0-L flask
Chapter 13, Question 9 For the reaction 2NO + Cl2 + 2NOCI, do the following: Express...
Chapter 13, Question 9 For the reaction 2NO + Cl2 + 2NOCI, do the following: Express the rate in terms of the disappearance of Cl2. Rate = _ A[cz] Rate=(-)(A[cz] 4) LINK TO TEXT We were unable to transcribe this imageIf Cl2 reacts at a rate of 79 M/s, state how fast NOCI will form. M/s exact number, no tolerance
3. Nitric oxide, NO(g) reacts with chlorine gas, Cl2(g), in the reaction 2NO(g) + Cl2(g) →...
3. Nitric oxide, NO(g) reacts with chlorine gas, Cl2(g), in the reaction 2NO(g) + Cl2(g) → 2NOCIG) Initial rates of reaction are determined for various combinations of initial concentrations of reactants and recorded below; Trial Initial [NO] (mol/L) 0.10 0.10 0.20 Initial (C12] (mol/L) 0.10 0.20 0.20 Rate of production of NOCI (mol/L.s) 1.8 x 107 3.6 x 102 1.43 x 10" a) What is the rate law equation for the reaction? (1 mark) b) What is the rate-determining step?...
10. Examine the reaction: 2NOCI(g) 2NO (g) + Cl2(g) When the above reaction reaches equilibrium the...
10. Examine the reaction: 2NOCI(g) 2NO (g) + Cl2(g) When the above reaction reaches equilibrium the concentration of each component is [NOCI] = 2.9 M. [NO] =1.1 Mand [Cl2] = 0.65 M. What is the equilibrium constant, K for this reaction? Does the equilibrium lie on the left side or the right side of the equilibrium? 9. The following equilibrium is endothermic. In the box below, show how the reaction will shift response to the indicated stress by writing,, or...
Part A Consider the reaction between NO and Cl2 to form NOCI: 2NO (9) + Cl2...
Part A Consider the reaction between NO and Cl2 to form NOCI: 2NO (9) + Cl2 (9)=2NOCI (9) A reaction mixture at a certain temperature initially contains only (NO) = 0.60 M and (Cl) = 0.63 M. After the reaction comes to equilibrium, the concentration of NOCI is 0.22 M. You may want to reference (Page 688) Section 15.6 while completing this problem. Find the value of the equilibrium constant (K) at this temperature. Express your answer using two significant...
1. Nitrosyl chloride is produced from the reaction of nitrogen monoxide and chlorine: 2NO(g) + Cl2(g)...
1. Nitrosyl chloride is produced from the reaction of nitrogen monoxide and chlorine: 2NO(g) + Cl2(g) → 2NOCI(g) The following initial rates at a given temperature were obtained for the concentrations listed below. Experiment Initial Rate (mol:L-.h-1) [NO]. (mol.L-1 [Cl2]. (mol.L-1). 2.21 8.84 0.5 0.25 4.42 0.25 0.5 What is the experimental rate law? 0.25 0.25
For the following reaction: 2NOCl(g) → 2NO(g) + Cl2(g) determine: a) the differential rate...
For the following reaction: 2NOCl(g) → 2NO(g) + Cl2(g) determine: a) the differential rate law b) the integrated rate law c) the value for the rate constant d) the concentration of NOCl(g) remaining after 275 s in each trial given: Trial [NOCl]0 (mol/L) Initial Rate (mol/L•s) 1 3.15 7.88 × 10–3 2 6.30 1.57 × 10–2 3 12.6 3.15 × 10–2
2. Good question. The reaction 2NO(g) + O2(g) → 2NO.(g) was studied by a CHEM 154...
2. Good question. The reaction 2NO(g) + O2(g) → 2NO.(g) was studied by a CHEM 154 student and the following data were obtained for the rate of consumption of oxygen. Write the rate law for this reaction. What would be the initial rate for an experiment where [NO), = 1.03 x 10-mol/L and [O),= 1.22 x 102 mol/L? Expt. [NO], (M) (01. (M) Initial rate (M/s) 1 1.66 x 10-3 1.66 x 10-3 3.32 x 10-5 2 4.98 x 10-...
The reaction 2NO(g) + Cl2(9) - 2NOCI(9) was studied at a constant temperature and the following results were obtained. 2.3 [NO]initial (Cilinitial Initial rate (M/min) 0.44 M 0.21 M 0.44 M 0.42 M 0.88 M 0.42 M 4.6 Rate is defined as the change in (CI) over time. Part 1: What is the order of the reaction with respect to NO? 2 Submit OK Part 2: What is the order of the reaction with respect to Cl? 1 Submit OK...
Select all that apply. The rate law for the reaction 2NO(g) + Cl2(g) → 2NOCI(g) is given by R-k[NO][C121 If the following is the mechanism for the reaction, NO(g) + Cl2(g) → NOC12(g) NOCI,(g) + NO(g) → 2NOCI(g) which of the following statements accurately describes this reaction? Check all that apply. 2nd order reaction The first step is the slow step. Doubling [NO] would quadruple the rate. Cutting (Cl) in half would decrease the rate by a factor of two....
63. At 35°C, K = 1.6 x 10-6 for the reaction 2NOCI(9) = 2NO(g) + Cl2 (9) Calculate the concentrations of all species at equilibrium for each of the following original mixtures. a. 2.0 moles of pure NOCI in a 2.0-L flask Answer b. 1.0 mole of NOCI and 1.0 mole of NO in a 1.0-L flask Answer c. 2.0 moles of NOCI and 1.0 mole of Cl, in a 1.0-L flask
Chapter 13, Question 9 For the reaction 2NO + Cl2 + 2NOCI, do the following: Express the rate in terms of the disappearance of Cl2. Rate = _ A[cz] Rate=(-)(A[cz] 4) LINK TO TEXT We were unable to transcribe this imageIf Cl2 reacts at a rate of 79 M/s, state how fast NOCI will form. M/s exact number, no tolerance
3. Nitric oxide, NO(g) reacts with chlorine gas, Cl2(g), in the reaction 2NO(g) + Cl2(g) → 2NOCIG) Initial rates of reaction are determined for various combinations of initial concentrations of reactants and recorded below; Trial Initial [NO] (mol/L) 0.10 0.10 0.20 Initial (C12] (mol/L) 0.10 0.20 0.20 Rate of production of NOCI (mol/L.s) 1.8 x 107 3.6 x 102 1.43 x 10" a) What is the rate law equation for the reaction? (1 mark) b) What is the rate-determining step?...
10. Examine the reaction: 2NOCI(g) 2NO (g) + Cl2(g) When the above reaction reaches equilibrium the concentration of each component is [NOCI] = 2.9 M. [NO] =1.1 Mand [Cl2] = 0.65 M. What is the equilibrium constant, K for this reaction? Does the equilibrium lie on the left side or the right side of the equilibrium? 9. The following equilibrium is endothermic. In the box below, show how the reaction will shift response to the indicated stress by writing,, or...
Part A Consider the reaction between NO and Cl2 to form NOCI: 2NO (9) + Cl2 (9)=2NOCI (9) A reaction mixture at a certain temperature initially contains only (NO) = 0.60 M and (Cl) = 0.63 M. After the reaction comes to equilibrium, the concentration of NOCI is 0.22 M. You may want to reference (Page 688) Section 15.6 while completing this problem. Find the value of the equilibrium constant (K) at this temperature. Express your answer using two significant...
1. Nitrosyl chloride is produced from the reaction of nitrogen monoxide and chlorine: 2NO(g) + Cl2(g) → 2NOCI(g) The following initial rates at a given temperature were obtained for the concentrations listed below. Experiment Initial Rate (mol:L-.h-1) [NO]. (mol.L-1 [Cl2]. (mol.L-1). 2.21 8.84 0.5 0.25 4.42 0.25 0.5 What is the experimental rate law? 0.25 0.25
2. Good question. The reaction 2NO(g) + O2(g) → 2NO.(g) was studied by a CHEM 154 student and the following data were obtained for the rate of consumption of oxygen. Write the rate law for this reaction. What would be the initial rate for an experiment where [NO), = 1.03 x 10-mol/L and [O),= 1.22 x 102 mol/L? Expt. [NO], (M) (01. (M) Initial rate (M/s) 1 1.66 x 10-3 1.66 x 10-3 3.32 x 10-5 2 4.98 x 10-...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago