We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
6. Provide IUPAC names for the following compounds (E-G). Name: H₃ C. CH3 CH, E Name:...
2. Provide IUPAC names for the following compounds (E-G). Name: НАС. eo CH3 CH3 E i Name: Н4С CH3 'N H CH3 F o Name: HO OH CH3 G
CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C H2CH2CH3 CH3-CH2-CH2-C-CH2-CH2-C-CH3 H2 CH₂ CH₂ H CH2CH3
(References) Provide an IUPAC name for each of the compounds shown. (Specify (E) (Z) stereochemistry, if relevant for straight chain alkenes only. Pay attention to commas, dashes, etc.) CIH,C CHCI C=C н H CH(CH3)2 H2C сна Submit Relry Entire Group 7 more group attempts remaining Provide an IUPAC name for each of the compounds shown (Specify (E) (Z) stereochemistry, if relevant, for straight chain alkenes only. Pay attention to commas, dashes, etc.) нс сн; C=C H3C-CH HC-CH3 сна CH3 CH3...
Give the IUPAC name of each of the following compounds aromate D) amine E) ketone 2. Give the IUPAC name of each of the following compounds: H OH HC (a) Hoc (b) CHE (c) Hoc HO (d) CH3 CHE HC (e) Ho-o (1) na CH₂ H CH₂ HyC N. CH3 HC N ( g ) сн.
30. Provide a complete IUPAC name for each of the following compounds. a) b) c) d) Br e) 0 f) h) HN CH.CH CH,CH; CH,CH ОПІ OH HC 'NO a) b) c) d) e) f) g) h)
Provide the IUPAC names of the following compounds. (a) CH2CH2C=CCOOH (b) CH2CH(CH3)CHBCOOH (c) (CH3)2C=CHCOOH NO2 CH, COOH d) COOH O, NVNO
Give the following compounds there IUPAC name? Thank you in advance! e. (CH2CH2)3CCH(CH3)CH2CH2CH3 f. CH2CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)2CH3 g. (CH3CH2CH2)4C
g. 1,1,3-trimethyllytun 2.27 Write expanded formulas for the following compounds, and name them using the IUPAC system: a. CH,(CH2)2CH, b. (CH),CHCH,CH,CH c. (CH3),CCH2CH2CH3 d. (CH2) e. CH,CH,CHFCH3 f. CH,CCI,CBrz h. MeBr g. i-Prci I. CH_CICHCI j. (CH3CH2)2CHCH(CH3)CHCH mon and IUPAC names for the following compounds: C.CH,C2
Give both IUPAC names and common names for the following compounds. (a) PhCH,CH,COOH (b) PCO,K (c) (CH3),CHCHBCOOH (d) HOOCCH,CH(CH3)CO,H (e) (CH3)2CHCH,COONa (f) CHCH(NH4)CH-COOH COOH Br in Loo Me" COOH 0) "CHOV COOH
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....