Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
1. On reaction with acid, 4-pyrone is protonated on the carbonyl-group oxygen to give a stable...
We saw in this experiment that an ester group with the carbonyl carbon attached to the...
We saw in this experiment that an ester group with the carbonyl carbon attached to the benzene ring serves as a meta-director, resulting in methyl Meta-nitrobenzoate as the major product of the reaction. Given that a methoxy (-OCH_3) group attached to the benzene ring serves as an orthopara director, draw the major products of the reaction shown below. Use your pre-lab lecture notes to answer this question. Explain using the resonance structures (referred to as the "sigma complex") why the...
QUESTION 1 Any reaction involving a carbonyl group and a strong acid begins with the same...
QUESTION 1 Any reaction involving a carbonyl group and a strong acid begins with the same first step, which is __________________ of the carbonyl oxygen. QUESTION 2 Using condensed molecular formulas (C#H#X#Y#) for your answers, predict the products of the reactions of C6H5CH2CHO (phenylacetaldehyde) with these reagents, and identify the functional group produced in the product. Note that the Tx symbol above allows you to do a subscript. a. NaBH4 / CH3OH b. 1. CH3MgBr; 2. H2O c. Ph3P=CHCH3 d....
Any reaction involving a carbonyl group and a strong acid begins with the same first step,...
Any reaction involving a carbonyl group and a strong acid begins with the same first step, which is __________________ of the carbonyl oxygen. Using condensed molecular formulas (C#H#X#Y#) for your answers, predict the products of the reactions of C6H5CH2CHO (phenylacetaldehyde) with these reagents, and identify the functional group produced in the product. Note that the Tx symbol above allows you to do a subscript. a. NaBH4 / CH3OH b. 1. CH3MgBr; 2. H2O c. Ph3P=CHCH3 d. CH3CH2OH (excess), H+ e....
1. Nile Blue in acid solution is a protonated imine with a pKa 10.1. Most protonated...
1. Nile Blue in acid solution is a protonated imine with a pKa 10.1. Most protonated imines have pKa values of 7-8. raw structures for the conjugate acid of nile blue and use them to explain why it is less acidic than a typical imine.
What happens in the first step of this reaction? 0 o OCH; H + CH3OH OH...
What happens in the first step of this reaction? 0 o OCH; H + CH3OH OH The hydroxyl group of the alcohol becomes protonated The carbonyl oxygen becomes protonated The methoxy group of the ester becomes protonated The carbonyl carbon becomes protonated OH Ne Cryo H SOHO 1) PB, B2 2) H20 O OH Br H or Br OH Br Why is the following reaction not reversible? O Nao O Naci CI The reactants are more stable than the products...
b: Before neutralization the solution (is acidic/is basic) and the (protonated amino group/deprotonated amino group/protonated ester...
b: Before neutralization the solution (is
acidic/is basic) and the (protonated amino group/deprotonated amino
group/protonated ester group) makes benzocaine soluble in the
aqueous solution. When the sodium carbonate is added, the (amino
group is deprotonated/amino group is protonated/ester group is
deprotonated) and the neutral benzocaine produced has a (low
solubility in water/high solubility in water/higher density than
water).
The local anesthetic, benzocaine, can be prepared by the direct esterification of p-aminobenzoic acid with ethanol, using sulfuric acid as the catalyst....
3. For a) [CH3CH2C(-O)CH2l b) [CH3NHCHCHCH21 1) Draw their possible resonance forms as the Line-Angular structure. 2) Predict the product of the acid-base reaction between more stable resonance forms...
3. For a) [CH3CH2C(-O)CH2l b) [CH3NHCHCHCH21 1) Draw their possible resonance forms as the Line-Angular structure. 2) Predict the product of the acid-base reaction between more stable resonance forms. Use the curved arrow to show the movement of electrons 3) Predict the product of the acid-base reaction between less stable resonance forms. 4) After comparing the reaction mechanisms and its products of 2) and 3). describe your opinion on the difference of stability of product.
3. For a) [CH3CH2C(-O)CH2l b)...
Deducing a Reaction Mechanism for the Isomerization of Maleic acid to fumaric acid. I'm completing my...
Deducing a Reaction Mechanism for the Isomerization of Maleic acid to fumaric acid. I'm completing my organic chemistry lab report and answering questions and I have very confused and would appreciate any help and explanation please. I appreciate it. Test Tube Solids Solvents Precipitate A 1.0 g maleic acid 3.0 mL 6 M HCl Yes B 1.0 g maleic acid 3.0 mL 3 M H2SO4 No C 1.0 g maleic acid 0.5 g ammonium chloride 3.0 mL distilled water No...
10) 10) When the carbonyl group of a ketone is protonated A) the resulting species is...
10) 10) When the carbonyl group of a ketone is protonated A) the resulting species is activated toward nucleophilic addition B) the resulting species becomes more electrophilic subsequent nucleophilic addition on the resulting species is said to occur under acid-catalyzed conditions D) the resulting species has a positive charge. E) all of the above 11) What purpose does FeCl3 serve when benzene undergoes an electrophilic aromatic substitution reaction with chlorine? A) It serves as a Lewis base catalyst by reacting...
#1. Using curved arrows to symbolize electrons, write a complete reaction mechanism for the bromination of...
#1. Using curved arrows to symbolize electrons, write a complete reaction mechanism for the bromination of acetanilide to create the product. Include the resonance structures for any charged, delocalized intermediates that are involved. #2. Why does performing the experiment at 0 degrees Celsius help you identify some of the relative rates of reactivity? #3. Explain why a methyl group is a mildly activating group while a methoxy group is strong activating. #4. Explain why-- NH2 act as an activator and--...
We saw in this experiment that an ester group with the carbonyl carbon attached to the benzene ring serves as a meta-director, resulting in methyl Meta-nitrobenzoate as the major product of the reaction. Given that a methoxy (-OCH_3) group attached to the benzene ring serves as an orthopara director, draw the major products of the reaction shown below. Use your pre-lab lecture notes to answer this question. Explain using the resonance structures (referred to as the "sigma complex") why the...
What happens in the first step of this reaction? 0 o OCH; H + CH3OH OH The hydroxyl group of the alcohol becomes protonated The carbonyl oxygen becomes protonated The methoxy group of the ester becomes protonated The carbonyl carbon becomes protonated OH Ne Cryo H SOHO 1) PB, B2 2) H20 O OH Br H or Br OH Br Why is the following reaction not reversible? O Nao O Naci CI The reactants are more stable than the products...
b: Before neutralization the solution (is
acidic/is basic) and the (protonated amino group/deprotonated amino
group/protonated ester group) makes benzocaine soluble in the
aqueous solution. When the sodium carbonate is added, the (amino
group is deprotonated/amino group is protonated/ester group is
deprotonated) and the neutral benzocaine produced has a (low
solubility in water/high solubility in water/higher density than
water).
The local anesthetic, benzocaine, can be prepared by the direct esterification of p-aminobenzoic acid with ethanol, using sulfuric acid as the catalyst....
3. For a) [CH3CH2C(-O)CH2l b) [CH3NHCHCHCH21 1) Draw their possible resonance forms as the Line-Angular structure. 2) Predict the product of the acid-base reaction between more stable resonance forms. Use the curved arrow to show the movement of electrons 3) Predict the product of the acid-base reaction between less stable resonance forms. 4) After comparing the reaction mechanisms and its products of 2) and 3). describe your opinion on the difference of stability of product.
3. For a) [CH3CH2C(-O)CH2l b)...
10) 10) When the carbonyl group of a ketone is protonated A) the resulting species is activated toward nucleophilic addition B) the resulting species becomes more electrophilic subsequent nucleophilic addition on the resulting species is said to occur under acid-catalyzed conditions D) the resulting species has a positive charge. E) all of the above 11) What purpose does FeCl3 serve when benzene undergoes an electrophilic aromatic substitution reaction with chlorine? A) It serves as a Lewis base catalyst by reacting...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 37 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago