Homework Answers
Add Answer to:
11. Which of the following is the term used to describe the process that results in...
DIN ANL and Protein Smith 6. Replicate each of the strands of DNA by moving the...
DIN ANL and Protein Smith 6. Replicate each of the strands of DNA by moving the complementary nucleotides into place ONE AT A TIME, beginning at the end of each strand as shown in the photo 7. Compare the base sequences in the strands of these two new DNA molecules with each other, and also with the original strand. Are they identical molecules? 8. Point to the two strands of the original DNA molecule. Note that an original strand represents...
How DNA Is Copied 4. What does it mean that the two strands of DNA are...
How DNA Is Copied 4. What does it mean that the two strands of DNA are complementary? 5. What is DNA replication?, 6. Using your notes, book, and this assignment, place the steps of DNA replication in the correct order. a. The enzyme DNA polymerase moves along the exposed strands and adds complementary nucleotides to each nucleotide in each existing strand. b. The DNA double helix breaks or unzips down the middle between the base pairs. C. A complementary strand...
QUESTION 8 Match each term to it's definition or description. Type of molecule that is the...
QUESTION 8 Match each term to it's definition or description. Type of molecule that is the repeating unit (monomer) for nudleic acids. In other words, many of these molecules A Replication fork strung together results in a nucleic acid strand B Rolling circle replication The position on a DNA molecule where DNA syntheis is initiatecd C Origin of replication D Term used to describe the fact that following DNA synthesis, the two resulting molecules are both composed of . Eukaryotic...
Which term describes the process by which a single strand of DNA serves as a template...
Which term describes the process by which a single strand of DNA serves as a template for the synthesis of an RNA molecule? translation transcription initiation elongation replication
DNA DNA Replication: ONA Because DNA Is the ge m Tumes and heart e ine in...
DNA DNA Replication: ONA Because DNA Is the ge m Tumes and heart e ine in process called DNA curs in the nucleus of s acest FS Parent strand Parent strand Newly replicated DNA Newly replicated DNA- SA0 Daughter DNA molecule Daughter DNA molecule Figure 8.2: Overview of DNA replication and illustration of complementary base pairing. DNA must replicate before cell division so that each new daughter cell receives an exact copy of the parent DNA. 1. Replication begins when...
Matthew Meselson and Franklin Stahl performed an experiment using heavy isotopes and bacteria to determine which...
Matthew Meselson and Franklin Stahl performed an experiment using heavy isotopes and bacteria to determine which model DNA follows to replicate. Their results are evidence supporting which DNA replication model below? a. The parent DNA molecule is broken into its singular nucleotides from which new nucleotides are copied and then all nucleotides to come back together as one larger DNA molecule. b. The parent DNA is mixed into each of the daughter strands such that both daughter molecules contain a...
compare selection and mutation 1. DNA molecules in the cells exist as a........ 2. DNA carry...
compare selection and mutation
1. DNA molecules in the cells exist as a........ 2. DNA carry the information to build and maintain the cells life by four letters of genetic language True False 3. The term phenotype is used to describe all of the organism's genetic information True / False 4. All of the organism DNA encode genes True/ False 5. Bacteria have one chromosome which is circular structure associated with proteins (no histones) True False 6. In the process...
14.2 Modeling the Structure and Function of Nucleic Acids and Their Products 2. The following diagram...
14.2 Modeling the Structure and Function of Nucleic Acids and Their Products 2. The following diagram represents some of the puzzle piece pieces used in this section. a Assembled in this form, do they represent an amino acid, c. a portion of messenger RNA, or a deoxyribonucleotide (b) Explain your answer. Opo 3. Why is DNA often called a double helix? 4. State the following ratios. (a) Guanine to cytosine in a double-stranded DNA molecule: (b) Adenine to thymine: -...
64. Which organelle has its own genetic information? a. endoplasmic reticulum b. ribosome c. mitochondrion d....
64. Which organelle has its own genetic information? a. endoplasmic reticulum b. ribosome c. mitochondrion d. golgi apparatus e. lysosome 65. Which organelle is a series of interconnected membranous canals or channels that run throughout the cytoplasm of the cell? a. golgi apparatus b. peroxisome c. mitochondrion d. endoplasmic reticulum 66. Which organelle is a composed of a double membrane structure with the inner membrane folded to form cristae? a. Lysosome b. endoplasmic reticulum c. mitochondrion d. ribosome 67. How...
D Question 3 1 pts The method of DNA replication, where each original strand is used...
D Question 3 1 pts The method of DNA replication, where each original strand is used as a template to build a new strand, is called the conservative method. semiconservative method. disruptive method. e continuous method. replication and amplification method. 1 pts Question 4 Watson and Crick developed a model of DNA in which the two strands twist into the shape of a Question 1 The two strands in the DNA molecule contain nitrogen bases which are identical. parallel. complementary...
DIN ANL and Protein Smith 6. Replicate each of the strands of DNA by moving the complementary nucleotides into place ONE AT A TIME, beginning at the end of each strand as shown in the photo 7. Compare the base sequences in the strands of these two new DNA molecules with each other, and also with the original strand. Are they identical molecules? 8. Point to the two strands of the original DNA molecule. Note that an original strand represents...
How DNA Is Copied 4. What does it mean that the two strands of DNA are complementary? 5. What is DNA replication?, 6. Using your notes, book, and this assignment, place the steps of DNA replication in the correct order. a. The enzyme DNA polymerase moves along the exposed strands and adds complementary nucleotides to each nucleotide in each existing strand. b. The DNA double helix breaks or unzips down the middle between the base pairs. C. A complementary strand...
QUESTION 8 Match each term to it's definition or description. Type of molecule that is the repeating unit (monomer) for nudleic acids. In other words, many of these molecules A Replication fork strung together results in a nucleic acid strand B Rolling circle replication The position on a DNA molecule where DNA syntheis is initiatecd C Origin of replication D Term used to describe the fact that following DNA synthesis, the two resulting molecules are both composed of . Eukaryotic...
DNA DNA Replication: ONA Because DNA Is the ge m Tumes and heart e ine in process called DNA curs in the nucleus of s acest FS Parent strand Parent strand Newly replicated DNA Newly replicated DNA- SA0 Daughter DNA molecule Daughter DNA molecule Figure 8.2: Overview of DNA replication and illustration of complementary base pairing. DNA must replicate before cell division so that each new daughter cell receives an exact copy of the parent DNA. 1. Replication begins when...
compare selection and mutation
1. DNA molecules in the cells exist as a........ 2. DNA carry the information to build and maintain the cells life by four letters of genetic language True False 3. The term phenotype is used to describe all of the organism's genetic information True / False 4. All of the organism DNA encode genes True/ False 5. Bacteria have one chromosome which is circular structure associated with proteins (no histones) True False 6. In the process...
14.2 Modeling the Structure and Function of Nucleic Acids and Their Products 2. The following diagram represents some of the puzzle piece pieces used in this section. a Assembled in this form, do they represent an amino acid, c. a portion of messenger RNA, or a deoxyribonucleotide (b) Explain your answer. Opo 3. Why is DNA often called a double helix? 4. State the following ratios. (a) Guanine to cytosine in a double-stranded DNA molecule: (b) Adenine to thymine: -...
64. Which organelle has its own genetic information? a. endoplasmic reticulum b. ribosome c. mitochondrion d. golgi apparatus e. lysosome 65. Which organelle is a series of interconnected membranous canals or channels that run throughout the cytoplasm of the cell? a. golgi apparatus b. peroxisome c. mitochondrion d. endoplasmic reticulum 66. Which organelle is a composed of a double membrane structure with the inner membrane folded to form cristae? a. Lysosome b. endoplasmic reticulum c. mitochondrion d. ribosome 67. How...
D Question 3 1 pts The method of DNA replication, where each original strand is used as a template to build a new strand, is called the conservative method. semiconservative method. disruptive method. e continuous method. replication and amplification method. 1 pts Question 4 Watson and Crick developed a model of DNA in which the two strands twist into the shape of a Question 1 The two strands in the DNA molecule contain nitrogen bases which are identical. parallel. complementary...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 13 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago