We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Did I do this correctly? 21. Name and draw the product of the following reaction: H...
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
9) What is the product of the following reaction! H,CrO4 ? Δ COOH COOH IV. I. COOH COOH COOH "COOH V. II. COOH COOH III. D) IV E) V C) IT B) II A) 1
Which of the following is an ionic intermediate in the formation of the major product in the reaction of toluene with HNO3/H2SO4? H3C. NO2 CH3 CH3 H3C Н + + + + NO2 H ON Н. NO2 I II III IV Select one: a. III b. IV c. II d. I
Draw the organic product of the following reaction.
Draw the organic product of the following reaction.
CH3 CH3C CHCH3
1. What is the major product for the following
reaction?
2. What is the major product for the following
reaction?
3.
4. Which reagent or test could be used to distinguish between
3-methyl-2-octene and 3-methyloctane?
Ethanol
Br2/CCl4
Sodium hydroxide aqueous solution
Two of these choices.
All of these choices.
5. Which of the following reagents give the highest yield for
conversion of 2-bromopentane to 1-pentene?
KOH/H2O
KOH/CH3OH
(CH3)3COK/(CH3)3COH
CH3ONa/CH3OH
CH3CH2ONa/CH3CH2OH
6.
What is the major product for the following reaction?...
12. What would be the major product of the following reaction? i. Brz, NaOH ii. H20" ? mo Br НО. O II III Br Br ho IV A. I B. II C. III D. IV E. V 13. What would be the major product of the following reaction sequence? A. I B. II C. III D. IV E. V 2 i. LDA ii. CHEI De ci II I III IV V 14. Which of the following could be used to...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is mixed with allyl chloride and that product is heated and then hydrolyzed? HO ora III A) I B) II C) III D) IV E) V 59. Which reagent would best serve as the basis for a simple chemical test to distinguish between CH3 ? CH3 and M A) NaOI (12 in NaOH) B) Bry/CCL C) CrO3/H2SO4 D) NaHCO3/H20 E) Ag(NH3)2+ 60. What would be...
What is the major organic product obtained from the following reaction? Cl2 FeCl3 CHCI IV Multiple Choice I IV 11 What is the product of the following reaction? KMnO4 OH II III Multiple Choice None of these 11 What is the major organic product of the following reaction? CH3 1. (R)-CBS reagent 2. H20 OH OH HO OH II IV Multiple Choice О IV = Be sure to answer all parts. Give the IUPAC name for the following compound. COOH...
39. What is the major product obtained from the following reaction? Br CH3 (CH3)2CO (CH3)2COH Ol-Bu CH3 CH3 Ol-Bu CH3 CH3 11 III IV A) III B) I C II D IV 40. What must be the starting material of the following reaction? NaOH A B. ОН ОН a. Hori D. ia ОН ОН 41. Which reaction mechanisms are most likely to occur when (R)-2-iodohexane is heated with KOH in acetone? CH, H.C A) Snl and Sn2 B) E1 and...
17. Draw the major organic product(s) generated in the reaction below. Pay particular attention to regio- and stereochemical detail. CH,COH H3CHC CH2CH3 18. Which of the following steps would successfully complete the following reaction? OCH3 HO Стосны A. I only B. II & III GI & IV D.), II, & IV 1 1 ) Brz. 2) NaOCH II. 1) Hg(OAC). 2) NaBH4, 3) NaOCHE III. 1) B2, CH5OH, 2) NaH IV. 1) mCPBA, H. 2) Na°3) CHE! 19. Draw the...